What is the major product from the above dehydration reaction? a. CH3CH2CH3 b. CH3CH2CH2CH3 c. CH3CH2CH2CH2-O-CH2CH2CH2CH3...
What is the major product from the above dehydration reaction?
a. CH3CH2CH3
b. CH3CH2CH2CH3
c. CH3CH2CH2CH2-O-CH2CH2CH2CH3
d. CH3CH=CH-CH3
e. CH3CH2CH=CH2
Homework Answers
When ethanol is heated with conc. H₂SO₄ at about 413K ,intermolecular dehydration takes place to form diethyl ether.
But ethyl alcohol undergoes intramolecular dehydration when
heated with conc. H₂SO₄ at about 443K to give ethylene.
similarly in the question also the above rule will follow
so correct answer is C.
When ethanol is heated with conc. H₂SO₄ at about 413K ,intermolecular dehydration takes place to form diethyl ether.
But ethyl alcohol undergoes intramolecular dehydration when
heated with conc. H₂SO₄ at about 443K to give ethylene.
similarly in the question also the above rule will follow
so correct answer is C.
Add Answer to:
What is the major product from the above dehydration
reaction?
a. CH3CH2CH3
b. CH3CH2CH2CH3
c.
CH3CH2CH2CH2-O-CH2CH2CH2CH3...
the following compound is 9 Which is the major product of the follow CHOCH, OH NaBr...
the following compound is
9 Which is the major product of the follow CHOCH, OH NaBr ? of the following substitution reaction? D) All of the Above E) None of the Above A) CH₃ CH₂ Br B) CH3CH(Na, c) CH₂-E-H 20 Which is the major product of 5 CHA CH=CH-CH2 HBr ? the following substitution reaction? major product of CHE OH SHA A) CH₂ CH-CH=CH3 CH2 () CH3 C=CH-CH2 B) CH3 C- CH₂ - CH3 D) None of the Above...
is the major product of the following substitution reaction! CH₂CH₂OH NaBr ? A) CH₃ CH₂ Br D) All of the Above B) C...
is the major product of the following substitution reaction! CH₂CH₂OH NaBr ? A) CH₃ CH₂ Br D) All of the Above B) CH₃ CH₂ Na E) None of the above c) CH3-C-H 20 Which is the major product of the following substitution reaction? ? CHICH-CH-CH2 HBr CH OH CH₂ C) CH₂ C=CH-CH₂ Shy A) CH₂ CH-CH=CH₂ D) None of the Above. B) CH₃ ¢-CH₂-CH₃ Br 2) Which is the major product of the following reaction? CH3 CH PBr3 ? CH₂...
What is the major product of the reaction shown below? Question 4 What b the major...
What is the major product of the reaction shown
below?
Question 4 What b the major product of the reacton shown below CH,-CH2-CH-CH2+ HOH → ● CH,-CHI-CH2-CH2CH o CH CH 3-CE-CH.CH3 CH 매3-CH2-c.on CH3 CH2-C CH2 CH3 CH2-CH-CH3 OH OH CH3-CH2-CH CH2
16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br...
16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br CH CH2-C-CH3 он CH CH-C=CH2 CH CH-GẠCH он н сна -CH=CH-CH3 CH CH2-CH-CH, OH AI B) II C) III D) IV 17) What is the major product of the following reaction? CH3 e CH3CH20 + CH3CBC - CH 3 A) CH2=CH2 B) СН3 CH3CH20C-CH3 CH3 CH 3C=CH2 CH3 D) A and B E) A and C
7 the following substitution reaction? Which is the major product of the follow CHOCHOH NaBr ?...
7 the following substitution reaction? Which is the major product of the follow CHOCHOH NaBr ? A) CH₂ CH₂ Br B) CH CH. Na c) CH₂-E-H D) All of the Above E) None of the Above of the following substitution reaction? CHE is the major product of the following substitut CH₂CH=CH-CH2 HBr ? CHz CÓ CH2=CH-CH3 OH A) CH₂CH=CH-CH3 B) CH3C-CH₂-CH3 D) None of the Above ? Which is the major product of the following reaction? PBra ? CHCH OH...
Complete the following reaction equations (Hint for b and c: Markonikov’s Rule applies; reaction in e...
Complete the following reaction equations (Hint for b and c: Markonikov’s Rule applies; reaction in e refers to oxidation) a. CH3(CH2)2CH=CH2 + Br2 -->?? b. CH3CH2C(CH3)=CHCH3 + HI -->?? c. CH3CH2CH=CH2 + H2O (in the presence of H+) --> ?? d. C6H5-CH=CH2 + H2 (in the presence of Pt @ 25o C and 1 atm) -->?? (note: C6H5 = benzene ring) e. CH3CH=CHCH3 + KMnO4 (in the presence of H2O; cold) --> ??
1. Which is the formula for an alkyne? a. CH3CH2CCH2 b. CH3CH2CH2CH3 C. CH3CH2CCH d. CH3CH2CCH2...
1. Which is the formula for an alkyne? a. CH3CH2CCH2 b. CH3CH2CH2CH3 C. CH3CH2CCH d. CH3CH2CCH2 2. Which of the following compounds is not possible? a. Brb. Bi C. Brd . BI, Br 3. What is the correct classification for the alcohol shown? CH3-CH=CH-CH-CH2 Сн,ОН a. Primary b. Secondary c. Tertiary d. Quaternary 4. Which of the following compounds is correctly classified as a tertiary alcohol? a. 3-methyl-1-butanol b. 2-methyl-1-butanol c. 3-methyl-2-butanol d. 2-methyl-2-butanol 5. Which of the following compounds...
9 . What is the major product of the following reaction? AlCla + CH,CH.CH CHCIAh d. Both a and b a. e. No Reaction b. C. NO 10. What is the major product of the following reaction? AlCla d. Bath...
9 . What is the major product of the following reaction? AlCla + CH,CH.CH CHCIAh d. Both a and b a. e. No Reaction b. C. NO 10. What is the major product of the following reaction? AlCla d. Bath a and b e. No Reaction a. Ha b. C. 41 . what is the r ajor product of the following reaction? a. NO d. Nohe of the Above b. H3 NO, 2. What is the major product of the...
53) What alkene is formed in greatest yield in the following Hofmann elimination? он CH3 CH3...
53) What alkene is formed in greatest yield in the following Hofmann elimination? он CH3 CH3 CH 3CH2CH2N CCH3? CH3 CH3 lheat A) CH3CH2CH-CH2 B) CH3CH2C=CH2 CH3 C) CH3-C-CH3 CH2 D) CH3CHCH CH2 CH3 E) CH3CH-CH2 54) What is the product of the following reaction sequence? (CH3)2Culi Ho C CCH CCH CH2OH C CCHCH CH OH IIL. CH,OCH,CH,
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос...
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос B A D What is the major product of the following reaction? Cl2 Н,0 НО СІ. A \ Он С В с D CI CI ОН ОН Ов ОА D с What is the major product of the following reaction? CH3 нс Н сH,CH, NaNH2 DMSO Br А В CH3 CHCH3 9 CH3 с CH,CH H4C. D нс CH2CH3 CH3 "NH, нс Сн HECH...
the following compound is
9 Which is the major product of the follow CHOCH, OH NaBr ? of the following substitution reaction? D) All of the Above E) None of the Above A) CH₃ CH₂ Br B) CH3CH(Na, c) CH₂-E-H 20 Which is the major product of 5 CHA CH=CH-CH2 HBr ? the following substitution reaction? major product of CHE OH SHA A) CH₂ CH-CH=CH3 CH2 () CH3 C=CH-CH2 B) CH3 C- CH₂ - CH3 D) None of the Above...
is the major product of the following substitution reaction! CH₂CH₂OH NaBr ? A) CH₃ CH₂ Br D) All of the Above B) CH₃ CH₂ Na E) None of the above c) CH3-C-H 20 Which is the major product of the following substitution reaction? ? CHICH-CH-CH2 HBr CH OH CH₂ C) CH₂ C=CH-CH₂ Shy A) CH₂ CH-CH=CH₂ D) None of the Above. B) CH₃ ¢-CH₂-CH₃ Br 2) Which is the major product of the following reaction? CH3 CH PBr3 ? CH₂...
What is the major product of the reaction shown
below?
Question 4 What b the major product of the reacton shown below CH,-CH2-CH-CH2+ HOH → ● CH,-CHI-CH2-CH2CH o CH CH 3-CE-CH.CH3 CH 매3-CH2-c.on CH3 CH2-C CH2 CH3 CH2-CH-CH3 OH OH CH3-CH2-CH CH2
16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br CH CH2-C-CH3 он CH CH-C=CH2 CH CH-GẠCH он н сна -CH=CH-CH3 CH CH2-CH-CH, OH AI B) II C) III D) IV 17) What is the major product of the following reaction? CH3 e CH3CH20 + CH3CBC - CH 3 A) CH2=CH2 B) СН3 CH3CH20C-CH3 CH3 CH 3C=CH2 CH3 D) A and B E) A and C
7 the following substitution reaction? Which is the major product of the follow CHOCHOH NaBr ? A) CH₂ CH₂ Br B) CH CH. Na c) CH₂-E-H D) All of the Above E) None of the Above of the following substitution reaction? CHE is the major product of the following substitut CH₂CH=CH-CH2 HBr ? CHz CÓ CH2=CH-CH3 OH A) CH₂CH=CH-CH3 B) CH3C-CH₂-CH3 D) None of the Above ? Which is the major product of the following reaction? PBra ? CHCH OH...
1. Which is the formula for an alkyne? a. CH3CH2CCH2 b. CH3CH2CH2CH3 C. CH3CH2CCH d. CH3CH2CCH2 2. Which of the following compounds is not possible? a. Brb. Bi C. Brd . BI, Br 3. What is the correct classification for the alcohol shown? CH3-CH=CH-CH-CH2 Сн,ОН a. Primary b. Secondary c. Tertiary d. Quaternary 4. Which of the following compounds is correctly classified as a tertiary alcohol? a. 3-methyl-1-butanol b. 2-methyl-1-butanol c. 3-methyl-2-butanol d. 2-methyl-2-butanol 5. Which of the following compounds...
9 . What is the major product of the following reaction? AlCla + CH,CH.CH CHCIAh d. Both a and b a. e. No Reaction b. C. NO 10. What is the major product of the following reaction? AlCla d. Bath a and b e. No Reaction a. Ha b. C. 41 . what is the r ajor product of the following reaction? a. NO d. Nohe of the Above b. H3 NO, 2. What is the major product of the...
53) What alkene is formed in greatest yield in the following Hofmann elimination? он CH3 CH3 CH 3CH2CH2N CCH3? CH3 CH3 lheat A) CH3CH2CH-CH2 B) CH3CH2C=CH2 CH3 C) CH3-C-CH3 CH2 D) CH3CHCH CH2 CH3 E) CH3CH-CH2 54) What is the product of the following reaction sequence? (CH3)2Culi Ho C CCH CCH CH2OH C CCHCH CH OH IIL. CH,OCH,CH,
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос B A D What is the major product of the following reaction? Cl2 Н,0 НО СІ. A \ Он С В с D CI CI ОН ОН Ов ОА D с What is the major product of the following reaction? CH3 нс Н сH,CH, NaNH2 DMSO Br А В CH3 CHCH3 9 CH3 с CH,CH H4C. D нс CH2CH3 CH3 "NH, нс Сн HECH...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 20 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago