What would be the product in
each case? (Hint: Mononitration often occurs near
00,
What would be the product in
each case? (Hint: Mononitration often occurs near
00,Dinitration near 600, and trinitration near 900)
Homework Answers
Add Answer to:
What would be the product in
each case? (Hint: Mononitration often occurs near
00,
Dinitration near...
36. Select the final product for the multi-step sequence indicated below: ECI NaNO, pyr. AICI KOH...
36. Select the final product for the multi-step sequence indicated below: ECI NaNO, pyr. AICI KOH HCI HBF NH, ACCI ? BF no 0 HO OH 37. What reagents are needed for the transformation required?: OME A. NH3, KOH / NaN 0, HCI / aniline. NaoMe B. HNO,, H2SO4 / HCI. Sn/NaNO2, HCI / anisole C. HNO3, H,80 / KOH, H,SO / NaNO2, HCl/phenol, Mel D, 4-methoxyanline, NH A CI
8. What is the major product formed from the reaction shown? 1. CHẠI 2. Ag,0,H, A....
8. What is the major product formed from the reaction shown? 1. CHẠI 2. Ag,0,H, A. III B. 1 C. II D. IV E. II and III F. I and IV 9. Select the reaction sequence that will produce the desired product HNO3, H2SO 1.Sn.HCI NANO,.HCI Cur 2.NaOH HNO, H SO. 1.Sn, HCI CuBr PCC 2.NaOH HNO3, H2SO 1.Sn, HCI NANO.HCI Bre, FeBr3 2.NaOH HNO3, H2SO4 Bry, FeBr 1.Sn, HCI 1.NaNO2.HCI 2.NaOH 2. H,O, heat HNO3, H2SO4 1.Sn, HCI NaNO,,HCI...
What is the product of the 1 но reaction? so NO 6. What is the product...
What is the product of the 1 но reaction? so NO 6. What is the product of the reaction он HSO (B) (A) NO он NO HOS (B) (A) soH (D) (C) NOz OH HO. both (B) and (C) (D) (C) HO,S 2 What is the product of the reaction? NoOH Which compound will yield only one product after nitration with HNO/HSo 7. OH .сн, (A) (B) сHа- (B) (A) но,, сн, OH (C) (D) сH,сH, none of the these...
Ph cyclopropene HF CH h) OH 1. POCICH.Ch 2. Pri 3 NH4Cl ag) 1.) 1. Li/THE...
Ph cyclopropene HF CH h) OH 1. POCICH.Ch 2. Pri 3 NH4Cl ag) 1.) 1. Li/THE 2.CO 3.NH.CH HNO k.) NH 1. HNO (aq) 2. NaSCH CH.CH AICI, 3-chloro-2-methylpentane m.) 1.Pr.CI. AICI 2. NBS, CCU. n) -OH XS H.CO acetone он 0.) OH XS Bobbit's SiO, CH.CH -OH 1. Ch. AICI 2 NaOH, 30 C 4,000 psi 3. HCI 9.) SCH 2Na, ETOH, NH, r.) 1. LIETO 2. oxirane 3. H,00 1.2 PY-MOBI OMe 2. NHCl(aq) t.) 1. Cl/ Feer...
25 Predict the product in the following examples, showing stereochemistry when appropriate (21) #) Write a...
25 Predict the product in the following examples, showing stereochemistry when appropriate (21) #) Write a structural formula for the principal organic products) of each of the following reactions 1) Na MON 2) H,09 CH.CH -OCH гон i 1 NaCN, DMSO 2) H 3) H,O', heat -CO,H HNO H2SO4 -NO; Br FeBry -NO, CHOCI AICI COM heat cl Febry 1) KOCH, 2) H30 b) Write a structural formula for A-C -EN 1260 1) CHI CHA Mp4r, Et (0) OH WNO...
NO, 00) 1.80.H.SO 2 онкона 3.HO pp.) 2 Na NDIO 1.2.2,0 2 DO XS PCC HO...
NO, 00) 1.80.H.SO 2 онкона 3.HO pp.) 2 Na NDIO 1.2.2,0 2 DO XS PCC HO CH ON OH XSHCIO NH إياها NINH w.) OH OH XS Bobbitt's SiO, CH2Cl2 ww.) OH 1. XS KMnONaOH(aq). A 2. H,O* HO 1. NaNO.HCI 2. H,PO (a) CHO NH yy.) NH 1. NaNO, HCl(conc) 2. D.PO 1. LITHF 2. D20 14 aaa) wo NaBHJEICH bbb.) су Cl2 FeBry HO НО. Feb COL) H 1 KM. NOW 2. Ho didd) cleum com) NO 1....
Lumpletion Status: Ruestion 18 What is the main product expected in the reaction of propanal with...
Lumpletion Status: Ruestion 18 What is the main product expected in the reaction of propanal with 1. Phli, 2. PCC and 3. H2SO4, HNO3? 4 points SO2H -NO₂ NO2 NO2 A Compound A B. Compound B oc. Compound OD. Compound D << Question A Moving to another question will save this response. Ting here to search O Question completion Status: QuestIUIT What reagents will accomplish the following transformation? CO2H Br NO2 1. HNO3, H 2 SO 4 2. Br 2,...
46) What is the major product formed in the 4-step reaction sequence? Io non o od...
46) What is the major product formed in the 4-step reaction sequence? Io non o od NH C AICI NO2 2) H0 3) HNO3, H2SO4 4) H2NNH, KOH 47) What is the final product formed in the following sequence of reactions? NHCOCH3OH 1) H,SO./H201) NaNO,, HCI ? heat Conc. H,SO 2 ) H3PO, SOGH 2) dilute NaOH NH21 oor hoe oud SO,H 48) Which of the following reactions would occur as written? Select all that apply. O CHOCI Snc 1)...
1. Provide the major organic product(s) for each of the following reactions: 1) HNOZ/H, SO 2)...
1. Provide the major organic product(s) for each of the following reactions: 1) HNOZ/H, SO 2) Sn/HCl(aq) 3) HO 1) (CH3)2CHCI/AICI: 2) NBS/hv 1) Cly/FeCl3 2) HNO,/H2SO4 1) CH3CH,COCI/AICI 2) H20 оооооооо 3) Zn(Hg)/HCl(aq) 1) SOZ/H,SO 2) Bry/FeBrz 1) (CH3)3CCI/AICI: 2) KMnO/HOIA 2) H30* 1) CH,COCIAICI: 2) H, 3) Bry/FeBry COH 1) SOCI_/pyridine 2) PhCH/AICI 3) H20 1. Br JFeBry 2. Mg/Eto 3. oxirane 4, HO* 1) Bry/FeBry 2) s09/H230 1) NBS/hv 2) PhoNa (1 CH3COCI / AIC وا (2...
17. Use ANY needed reagents to effect the following transformation. (30 points) starting material product List...
17. Use ANY needed reagents to effect the following transformation. (30 points) starting material product List of Reagents -N:C:N- KMnO4, H2SO4 8 00 (CH3),COCOCOC(CH3)3 Ag(NH3)2+, 120 Fe, HCI KMnO4, NaOH, H2O, cold AlCl3 Bra (excess), NaOH (excess), H20 Brz, Fe Br2, H20 Br2, H2O, H3O+ Br2, hy Br2, NaOH (excess), H2O Br2, P Buli CF3CO,H CH;=0 Formaldehyde оо CH3COCCH o CH_CC1, pyridine H2, Lindlar's catalyst H2.Pd/C H2, Pa/C, high pressure H, Raney-Ni HANNH HENNH, KOH, (HOCH2CH2)20, heat H2O H20, H2SO4,...
36. Select the final product for the multi-step sequence indicated below: ECI NaNO, pyr. AICI KOH HCI HBF NH, ACCI ? BF no 0 HO OH 37. What reagents are needed for the transformation required?: OME A. NH3, KOH / NaN 0, HCI / aniline. NaoMe B. HNO,, H2SO4 / HCI. Sn/NaNO2, HCI / anisole C. HNO3, H,80 / KOH, H,SO / NaNO2, HCl/phenol, Mel D, 4-methoxyanline, NH A CI
8. What is the major product formed from the reaction shown? 1. CHẠI 2. Ag,0,H, A. III B. 1 C. II D. IV E. II and III F. I and IV 9. Select the reaction sequence that will produce the desired product HNO3, H2SO 1.Sn.HCI NANO,.HCI Cur 2.NaOH HNO, H SO. 1.Sn, HCI CuBr PCC 2.NaOH HNO3, H2SO 1.Sn, HCI NANO.HCI Bre, FeBr3 2.NaOH HNO3, H2SO4 Bry, FeBr 1.Sn, HCI 1.NaNO2.HCI 2.NaOH 2. H,O, heat HNO3, H2SO4 1.Sn, HCI NaNO,,HCI...
What is the product of the 1 но reaction? so NO 6. What is the product of the reaction он HSO (B) (A) NO он NO HOS (B) (A) soH (D) (C) NOz OH HO. both (B) and (C) (D) (C) HO,S 2 What is the product of the reaction? NoOH Which compound will yield only one product after nitration with HNO/HSo 7. OH .сн, (A) (B) сHа- (B) (A) но,, сн, OH (C) (D) сH,сH, none of the these...
Ph cyclopropene HF CH h) OH 1. POCICH.Ch 2. Pri 3 NH4Cl ag) 1.) 1. Li/THE 2.CO 3.NH.CH HNO k.) NH 1. HNO (aq) 2. NaSCH CH.CH AICI, 3-chloro-2-methylpentane m.) 1.Pr.CI. AICI 2. NBS, CCU. n) -OH XS H.CO acetone он 0.) OH XS Bobbit's SiO, CH.CH -OH 1. Ch. AICI 2 NaOH, 30 C 4,000 psi 3. HCI 9.) SCH 2Na, ETOH, NH, r.) 1. LIETO 2. oxirane 3. H,00 1.2 PY-MOBI OMe 2. NHCl(aq) t.) 1. Cl/ Feer...
25 Predict the product in the following examples, showing stereochemistry when appropriate (21) #) Write a structural formula for the principal organic products) of each of the following reactions 1) Na MON 2) H,09 CH.CH -OCH гон i 1 NaCN, DMSO 2) H 3) H,O', heat -CO,H HNO H2SO4 -NO; Br FeBry -NO, CHOCI AICI COM heat cl Febry 1) KOCH, 2) H30 b) Write a structural formula for A-C -EN 1260 1) CHI CHA Mp4r, Et (0) OH WNO...
NO, 00) 1.80.H.SO 2 онкона 3.HO pp.) 2 Na NDIO 1.2.2,0 2 DO XS PCC HO CH ON OH XSHCIO NH إياها NINH w.) OH OH XS Bobbitt's SiO, CH2Cl2 ww.) OH 1. XS KMnONaOH(aq). A 2. H,O* HO 1. NaNO.HCI 2. H,PO (a) CHO NH yy.) NH 1. NaNO, HCl(conc) 2. D.PO 1. LITHF 2. D20 14 aaa) wo NaBHJEICH bbb.) су Cl2 FeBry HO НО. Feb COL) H 1 KM. NOW 2. Ho didd) cleum com) NO 1....
Lumpletion Status: Ruestion 18 What is the main product expected in the reaction of propanal with 1. Phli, 2. PCC and 3. H2SO4, HNO3? 4 points SO2H -NO₂ NO2 NO2 A Compound A B. Compound B oc. Compound OD. Compound D << Question A Moving to another question will save this response. Ting here to search O Question completion Status: QuestIUIT What reagents will accomplish the following transformation? CO2H Br NO2 1. HNO3, H 2 SO 4 2. Br 2,...
46) What is the major product formed in the 4-step reaction sequence? Io non o od NH C AICI NO2 2) H0 3) HNO3, H2SO4 4) H2NNH, KOH 47) What is the final product formed in the following sequence of reactions? NHCOCH3OH 1) H,SO./H201) NaNO,, HCI ? heat Conc. H,SO 2 ) H3PO, SOGH 2) dilute NaOH NH21 oor hoe oud SO,H 48) Which of the following reactions would occur as written? Select all that apply. O CHOCI Snc 1)...
1. Provide the major organic product(s) for each of the following reactions: 1) HNOZ/H, SO 2) Sn/HCl(aq) 3) HO 1) (CH3)2CHCI/AICI: 2) NBS/hv 1) Cly/FeCl3 2) HNO,/H2SO4 1) CH3CH,COCI/AICI 2) H20 оооооооо 3) Zn(Hg)/HCl(aq) 1) SOZ/H,SO 2) Bry/FeBrz 1) (CH3)3CCI/AICI: 2) KMnO/HOIA 2) H30* 1) CH,COCIAICI: 2) H, 3) Bry/FeBry COH 1) SOCI_/pyridine 2) PhCH/AICI 3) H20 1. Br JFeBry 2. Mg/Eto 3. oxirane 4, HO* 1) Bry/FeBry 2) s09/H230 1) NBS/hv 2) PhoNa (1 CH3COCI / AIC وا (2...
17. Use ANY needed reagents to effect the following transformation. (30 points) starting material product List of Reagents -N:C:N- KMnO4, H2SO4 8 00 (CH3),COCOCOC(CH3)3 Ag(NH3)2+, 120 Fe, HCI KMnO4, NaOH, H2O, cold AlCl3 Bra (excess), NaOH (excess), H20 Brz, Fe Br2, H20 Br2, H2O, H3O+ Br2, hy Br2, NaOH (excess), H2O Br2, P Buli CF3CO,H CH;=0 Formaldehyde оо CH3COCCH o CH_CC1, pyridine H2, Lindlar's catalyst H2.Pd/C H2, Pa/C, high pressure H, Raney-Ni HANNH HENNH, KOH, (HOCH2CH2)20, heat H2O H20, H2SO4,...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 14 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago