need help with these two rxns please NaNO2, HCl (CH3CH2)2NH, HT 2 CH3 CH2CH3
Please Help!!
QUESTION 1 What is the IUPAC name for this compound? CH3 CH3CH2 QUESTION 2 What is the IUPAC name for this compound? CH2CH3 QUESTION 3 What is the IUPAC name for this compound? снэ HE
Question 5 Which structure below is a tertiary amine? (CH3CH2)3CNHCH2CH3 (CH3)3CHNH2 CH3CH2NHCH(CH3)2 CH3CH2N(CH3)CH2CH3 Question 6 What is the IUPAC name of CH3C(CH3)2CH2CH(CH2CH3)CH2CH2CH3? 4-isopropyl-2,2-dimethyheptane 2,2,3,4-tetramethylheptane 4-ethyl-2,2-dimethylheptane 2,2,4-trimethyloctane
Please provide an IUPAC name for each of the following structures CH3 HзС, CH2CH3CHCH3 F CH2CH3 CH3CH2 CH3 Br CI BrCH2CH2CH-CCH3 CH2CH3 CH3CH2CH2CH2CCH2CH2CH3 CH2 CHз CH3CH2CH2 CH2CH3CH2CH3 н н НзС CH3
A. 1. CCN 2.Ht, H2O, a B. 1. NaNO2, HCl 2. Cu CN c. 1. Mg D. INGH 2. CO2 3. H3O+ 2. ^ Br E. 1. mg 2. To 3. H+, H2O F. PCC G. KMn DA H2O, HO- Jo ling H. 1. mg 2.co 3. Haot 4. PCC 3. Ht, H2O + PCC He Ko Al Cly carry *Determine the reagents necessary to out each of the following transformation. -NH2 .CN -OH OH -OH 16 ibis
could someone help with this plz
Identify the correct structure of trans-2-methyl-3-hexene Select one CH3CH2 CH 3 CH3 CH2CH3 CH CH2 CH2CH3 CH3 CH CH CH2CH3 ?-? CH CH CH C=C CH2CH3
please help
Which reaction sequence would best accomplish this transformation? ON N(CH3)2 LIN(CH3)2 SOCI (CH3)2NH NH, CH 1 (excess) O NaBH (CH3)NH Question 5 (2 points) Which reaction sequence is preferred for this conversion? chyckéon --ch,CH.CH O soc. CHUMBO SOCCHIO Which reaction sequence is preferred for this conversion? chyce.Con -ca.ch.ch O sock CHxMgBr – H40 O soch. (CH)Culi. OCHMBYMO O sock, CHL. HO
Which of following is the best starting material for the reaction below? 1. (CH3)2NH ? 2. LIAIHA 3. H20 'N NK CN NH2 What is the major product in the following reaction? 1. DIBAL 2. H20 O H O OH OH СІ Which reaction sequence would accomplish this transformation? CN H2SO4/HNO3 Br2 NaNO2/HCI CuCN O Br2/FeBr3 H2SO4/HNO3 KF NaNO2/HCI O H2SO4/HNO3 Zn(Hg)/HCI NaNO2/HCI CuCN o H2SO4/HNO3 Zn(Hg/HCI NaNO2/HCI HBF4
need help please
나hur 5. OH Ht
Please analyze the IR and NMR spectra. The product is
N,N-diethyl-m-toluamide. The product is obtained by the following
reactions
Please label all major peaks.
Solvent is Et2O. Extracted with NaOH and then HCl and then
H2O. Dried and then evaporated. To further purify, hexane was used
in column chromatography to elute the product. Then
evaporated.
CH3 CH3 SOCI2 + SO2 O=0 ОН CH3 CH3 -- + excess (CH3CH2)2NH + (CH3CH2)2NH2* crt ether CI 'N-CH2CH3 CH,CHE 1000 11 100 100 100...
please help with these 2 questions
the following is formed in the step shown below? CH3CH2 CI +NH3 CH3CH2NH3 3) CH3CH2CCI NH3 OH CH3CH2 C NH3 re more acidic than alcoh