Homework Answers
Add Answer to:
Unit 3 Homework Assignment Name 1. The first two steps in the base-catalyzed condensation of acetaldehyde...
A 3-ethylcyclohexan-1-one reacts with both propMgBr, and water. In the first part of the reaction, the...
A 3-ethylcyclohexan-1-one reacts with both propMgBr, and water. In the first part of the reaction, the propane part of propMgBr takes the bonding electrions from MgBr, becoming a carbanion. The carbanion attacks the slightly positive carbon of the carbonyl group. The pi obnd between the oxygen and carbon break, and the electron pair moves toward the oxygen atom. Now the intermediate reacts with water. First a hydrogen atom loses it's bonding pair to the oxygen in the water molecule. Now...
HW 22: Enolates 1. Provide a detailed, stepwise mechanism for the base-catalyzed enolization (keto enol tautomerism) of acetaldehyde. 2. Provide the major organic product of the folowing reactio...
HW 22: Enolates 1. Provide a detailed, stepwise mechanism for the base-catalyzed enolization (keto enol tautomerism) of acetaldehyde. 2. Provide the major organic product of the folowing reaction. 3. Provide the major organic product of the following reaction LDA 4. Which of the following ketones will give a positive iodoform test? A) 4-heptanone D) cyclohexanone B) 3-hexanone C)2-hexanone 5. Provide the major organic product of the following reaction. 6. Provide the structure of the major organic product which results when...
What is the IUPAC name of the given molecule? OH Br 1-bromo-2-ethyl-2-hydroxy-3-methylpentanoic acid 2-ethyl-3-methylpentan-2-ol-1-carboxyl bromide 2-ethyl-3-methyl-2-ol-pentanoyl...
What is the IUPAC name of the given molecule? OH Br 1-bromo-2-ethyl-2-hydroxy-3-methylpentanoic acid 2-ethyl-3-methylpentan-2-ol-1-carboxyl bromide 2-ethyl-3-methyl-2-ol-pentanoyl bromide O2-ethyl-2-hydroxy-3-methylpentanoyl bromide What statement is TRUE about the mechanism for the reaction shown here? CH,(CH)2CO,CH, NaOH CH3(CH12COCH excess heat CH3(CH)2CO,CH2 Water attacks the carbonyl carbon to form a tetrahedral intermediate. The first step of the reaction involves protonation of the ester carbonyl oxygen. One of the products formed is glycerol. The hydroxide deprotonates the alpha carbon. Which bases among the following is/are used...
4. Multiple Choice Place your answer in the space provided. (2 pts. each; 12 pts. total)...
4. Multiple Choice Place your answer in the space provided. (2 pts. each; 12 pts. total) Which is NOT true of the aldol condensation? A. It accomplishes the formation of a new carbon-carbon bond B. The enolate is favored at equilibrium (assume NaOH as the base) C. The key step is the mechanism is attack of the enolate ion on a carbonyl carbon atom D. Dehydration of the aldol product is often observed and is irreversible. _Which sets of hydrogen...
Experimental Outline In its simplest form, the aldol condensation is a self-addition involving tw...
Organic Chemistry 2
Experimental Outline In its simplest form, the aldol condensation is a self-addition involving two molecules of the same aldehyde or ketone, in the presence of a base, and results in the formation of a new carbon-carbon bond joining the carbonyl carbon of one molecule to the a-position of the second. In many cases - if the reaction conditions aren't sufficiently mild - the initially formed aldol product reacts further in an elimination reaction to give what is...
Question 1 Match each reagent with its role in aldol condensation reaction. Not yet answered D-anisaldehyde...
Question 1 Match each reagent with its role in aldol condensation reaction. Not yet answered D-anisaldehyde Choose... Points out of 10.00 dium hydroxide Choose... P Flag question acetophenone Choose... ethanol Choose... Question 2 Not yet answered To purify the aldol condensation product you will have to recrystallize it from methanol. Give the steps in recrystallization procedure the appropriate order numbering. Points out of 10.00 The compound is kept under vacuum for 10 min Choose... + P Flag question The solution...
____ 1. The diagram below represents serine, a polar, uncharged amino acid. Which functional group gives...
____ 1. The diagram below represents serine, a polar, uncharged
amino acid. Which functional group gives serine its
distinct property?
a. H3
b. CH2OH
c. –H
d. COO–
____ 2. The monomers shown below are monomers for which of the
following natural polymers?
a. polysaccharides
b. plastics
c. DNA
d. proteins
____ 3. Which of the following processes illustrates the production
of a protein?
a. specific code for amino acids --> amino acid chain -->
gene --> DNA --> specific...
**(left structure)****(right structure)** The two structures for the assignment are above and the task is: 1....
**(left structure)****(right
structure)**
The two structures for the assignment are above and
the task is:
1. Perform a retrosynthetic analysis on the two target
molecules assigned to you. In each case the organic
starting material (what you have to work backwards toward) depends
upon the target. For the structure given above (structure on left),
the starting material is either malonic ester or acetoacetic ester
and any halide. For the structure given above (structure on right),
the starting material is any...
Can you help me identify reagent (i), Compound 8 and Compound 12 in the reaction scheme?...
Can you help me identify reagent (i), Compound 8 and
Compound 12 in the reaction scheme?
You have laboratory data on all the compounds in the
synthesis, however the amount of data available to you varies. Some
have the entirety of the spectral data, others have as little as
the elemental analysis. Use the laboratory data to help you
discover which reaction has been performed.
The lab data for Compound 8 and 12 is as
follows:
You can use any...
Page 1 Synthesis using Carbonyl O-Substitution Chemistry Preamble This experiment involves the synthesis of target molecules...
Page 1 Synthesis using Carbonyl O-Substitution Chemistry Preamble This experiment involves the synthesis of target molecules using a-substitution chemistry. You are assigned two target molecules, one of which is best synthesized by an alkylation approach, while the other is best synthesized by an addition or condensation approach. You must do the following: 1. Perform a retrosynthetic analysis on the two target molecules assigned to you. In each case the organic starting material (what you have to work backwards toward) depends...
HW 22: Enolates 1. Provide a detailed, stepwise mechanism for the base-catalyzed enolization (keto enol tautomerism) of acetaldehyde. 2. Provide the major organic product of the folowing reaction. 3. Provide the major organic product of the following reaction LDA 4. Which of the following ketones will give a positive iodoform test? A) 4-heptanone D) cyclohexanone B) 3-hexanone C)2-hexanone 5. Provide the major organic product of the following reaction. 6. Provide the structure of the major organic product which results when...
What is the IUPAC name of the given molecule? OH Br 1-bromo-2-ethyl-2-hydroxy-3-methylpentanoic acid 2-ethyl-3-methylpentan-2-ol-1-carboxyl bromide 2-ethyl-3-methyl-2-ol-pentanoyl bromide O2-ethyl-2-hydroxy-3-methylpentanoyl bromide What statement is TRUE about the mechanism for the reaction shown here? CH,(CH)2CO,CH, NaOH CH3(CH12COCH excess heat CH3(CH)2CO,CH2 Water attacks the carbonyl carbon to form a tetrahedral intermediate. The first step of the reaction involves protonation of the ester carbonyl oxygen. One of the products formed is glycerol. The hydroxide deprotonates the alpha carbon. Which bases among the following is/are used...
4. Multiple Choice Place your answer in the space provided. (2 pts. each; 12 pts. total) Which is NOT true of the aldol condensation? A. It accomplishes the formation of a new carbon-carbon bond B. The enolate is favored at equilibrium (assume NaOH as the base) C. The key step is the mechanism is attack of the enolate ion on a carbonyl carbon atom D. Dehydration of the aldol product is often observed and is irreversible. _Which sets of hydrogen...
Organic Chemistry 2
Experimental Outline In its simplest form, the aldol condensation is a self-addition involving two molecules of the same aldehyde or ketone, in the presence of a base, and results in the formation of a new carbon-carbon bond joining the carbonyl carbon of one molecule to the a-position of the second. In many cases - if the reaction conditions aren't sufficiently mild - the initially formed aldol product reacts further in an elimination reaction to give what is...
Question 1 Match each reagent with its role in aldol condensation reaction. Not yet answered D-anisaldehyde Choose... Points out of 10.00 dium hydroxide Choose... P Flag question acetophenone Choose... ethanol Choose... Question 2 Not yet answered To purify the aldol condensation product you will have to recrystallize it from methanol. Give the steps in recrystallization procedure the appropriate order numbering. Points out of 10.00 The compound is kept under vacuum for 10 min Choose... + P Flag question The solution...
____ 1. The diagram below represents serine, a polar, uncharged
amino acid. Which functional group gives serine its
distinct property?
a. H3
b. CH2OH
c. –H
d. COO–
____ 2. The monomers shown below are monomers for which of the
following natural polymers?
a. polysaccharides
b. plastics
c. DNA
d. proteins
____ 3. Which of the following processes illustrates the production
of a protein?
a. specific code for amino acids --> amino acid chain -->
gene --> DNA --> specific...
**(left structure)****(right
structure)**
The two structures for the assignment are above and
the task is:
1. Perform a retrosynthetic analysis on the two target
molecules assigned to you. In each case the organic
starting material (what you have to work backwards toward) depends
upon the target. For the structure given above (structure on left),
the starting material is either malonic ester or acetoacetic ester
and any halide. For the structure given above (structure on right),
the starting material is any...
Can you help me identify reagent (i), Compound 8 and
Compound 12 in the reaction scheme?
You have laboratory data on all the compounds in the
synthesis, however the amount of data available to you varies. Some
have the entirety of the spectral data, others have as little as
the elemental analysis. Use the laboratory data to help you
discover which reaction has been performed.
The lab data for Compound 8 and 12 is as
follows:
You can use any...
Page 1 Synthesis using Carbonyl O-Substitution Chemistry Preamble This experiment involves the synthesis of target molecules using a-substitution chemistry. You are assigned two target molecules, one of which is best synthesized by an alkylation approach, while the other is best synthesized by an addition or condensation approach. You must do the following: 1. Perform a retrosynthetic analysis on the two target molecules assigned to you. In each case the organic starting material (what you have to work backwards toward) depends...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 4 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 21 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 22 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 36 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 6 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago