Homework Answers
Add Answer to:
please work out problem with example
Calculate the volume of CO2(g) formed at STP when 75.0...
1. 16.50 g of glucose, C6H12O6 was burned in the presence of excess oxygen, calculate the volume of CO2(g) that is...
1. 16.50 g of glucose, C6H12O6 was burned in the presence of excess oxygen, calculate the volume of CO2(g) that is produced at STP? C6H12O6(s) + 602(g) + 6CO2(g) + 6H2O(g) 2. What volume of 0.250 M HCl is required to completely react with 0.350 g of Na2CO3? Na2CO3(s) + 2HCl(aq) + 2NaCl(aq) + H2O(l) + CO2(g) 3. Calcium carbonate decomposes at high temperatures to give calcium oxide and carbon dioxide. What volume of CO2 will be collected at 950...
please show work How many grams of HCl, are needed to produce 125 ml of carbon...
please show work
How many grams of HCl, are needed to produce 125 ml of carbon dioxide gas at STP in the following reaction? CaCO3(s) + 2 HCl(aq) - -> CaCl(aq) + CO2(g) + H20(1) In a reaction similar to this laboratory experiment, 0.625 g of aluminum metal was completely consumed and the H, gas collected over water at 55.0°C and atmospheric pressure of 759 mm Hg. What was the volume of H, gas produced? (Be sure to correct H2...
STOICHIOMETRY INVOLVING SOLIDS, LIQUIDS, AND GASES 1. 16.50 g of glucose, C6H12O6 was burned in the...
STOICHIOMETRY INVOLVING SOLIDS, LIQUIDS, AND GASES 1. 16.50 g of glucose, C6H12O6 was burned in the presence of excess oxygen, calculate the volume of CO2(g) that is produced at STP? CH120e(s) + 6O2(g) 6CO2(g) + 6H2O(g) 16.5g/1 mol CGHI2O 16 mol CO2 | 22.4L = 12.312 1180.156 C6H12 Ool Imol C6H12O6 mol CO2 What volume of 0.250 M HCl is required to completely react with 0.350 g of Na2CO3? Na2CO3(s) + 2HCl(aq) + 2NaCl(aq) + H2O(0) + CO2(g) (3.) Calcium...
WOL 2. What volume of 0.250 M HCl is required to completely react with 0.350 g of Na2CO3? Na2CO3(s) + 2HCl(aq) + 2N...
WOL 2. What volume of 0.250 M HCl is required to completely react with 0.350 g of Na2CO3? Na2CO3(s) + 2HCl(aq) + 2NaCl(aq) + H2O(l) + CO2(g) 3. Calcium carbonate decomposes at high temperatures to give calcium oxide carbon dioxide. What volume of CO2 will be collected at 950 torr and 500°C when 75.0 g of CaCO3 react? CaCO3(s) → Cao(s) + CO2(g) 4. How many mL of 0.250 M KMnO4 are needed to react with 3.36 g of FeSO4...
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowe...
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowed to react with 5.00 g of potassium. (write the chemical reaction first) 7.36 7.38 14.7 4.77 9.53 Question 2 1 pts Carbon dioxide is produced in the following reaction: 5 H2C204(aq) + 2 KMnO4 (aq) + 3 H2SO4 (aq) → 10 CO2(g) + 2 MnSO4 (aq) + K2SO4 (aq) + 8 H20 (1) What is the limiting reagent...
When 11.2 g Ca CO3 reacts with 300ml of 37% hyd rochloric acid (density: 1.2 g/mL),...
When 11.2 g Ca CO3 reacts with 300ml of 37% hyd rochloric acid (density: 1.2 g/mL), 4.61 g of CO2 is produced. What is the percent yield of CO2? (the rest f the products is calcium chloride and water) CO2(g)+CaCl2 (aq) + H2O() (not balanced) CACO3(s) +HCl(aq)
Determine the volume of O_2 (at STP) formed when 50.0 g of KClO_3 decomposes according to...
Determine the volume of O_2 (at STP) formed when 50.0 g of KClO_3 decomposes according to the following reaction. The molar mass for KClO_3 is 122.55 g/mol. 2 KClO_3 (s) rightarrow 2 KCl(s) + 3 O_2(g) A) 12.3 L B) 9.14 L C) 14.6 L D) 8.22 L E) 13.7 L A gas mixture consists of N_2, O_2, and Ne, where the mole fraction of N_2 is 0.55 and the fraction of Ne is 0.25. If the mixture is at...
Thankyou! Consider the following unbalanced equation: O2(g) + C2H6(9) + CO2(g) + H20(1) If 24.7 moles...
Thankyou!
Consider the following unbalanced equation: O2(g) + C2H6(9) + CO2(g) + H20(1) If 24.7 moles of O2(g) reacts with an excess of C2H6(9), what is the theoretical yield of CO2(g) in moles? O 97.2 moles 14.1 moles 37.7 moles 88.6 moles O 26.8 moles A 1.80 g sample of barium chloride hydrate, BaCl2 mass of 1.72 g. Calculate the value of x. XH2O is treated with excess sulfuric acid, forming a BaSO4 precipitate which has a i ooooo When...
3-What volume (in mL) of 0.125 M AgNO3 is required to react completely with 35.31 mL...
3-What volume (in mL) of 0.125 M AgNO3 is required to react completely with 35.31 mL of 0.225 M Na3 PO4? The balanced reaction is given below: 3 AgNO3(aq) + Nas PO4(aq) —>Ag3SO4(6)+ 3 NaNO3(aq) 4-What volume (in mL) of 0.550 M HCl is required to react completely with 4.72 g of sodium hydrogen carbonate? NaHCO3(s)+ HCl aq) —>NaCl(aq) + CO2(g)+ H2O) 5-Determine the volume of O2 (at STP) formed when 30.0 g of KCIO3 decomposes according to the following...
please explain and help calculate the orange cirlced ones L in volume at STP 1. One...
please explain and help calculate the orange cirlced ones
L in volume at STP 1. One mole of an IDEAL GAS occupies a) 12.2 6) 22.4 c) 23.6 d) 40 (2What are the units for the molar volume of a gas? -a) Moles/liter -b) Liters/mole Grams/mole d) Moles/grams What is the gas produce in this experiment CaCO3+ HCI? a) O2 b) CO2 c) NO2 d) H2 e) Natural gas on: 2:23 los molhoz 4 When CaCO3 react with HCI, calculate...
1. 16.50 g of glucose, C6H12O6 was burned in the presence of excess oxygen, calculate the volume of CO2(g) that is produced at STP? C6H12O6(s) + 602(g) + 6CO2(g) + 6H2O(g) 2. What volume of 0.250 M HCl is required to completely react with 0.350 g of Na2CO3? Na2CO3(s) + 2HCl(aq) + 2NaCl(aq) + H2O(l) + CO2(g) 3. Calcium carbonate decomposes at high temperatures to give calcium oxide and carbon dioxide. What volume of CO2 will be collected at 950...
please show work
How many grams of HCl, are needed to produce 125 ml of carbon dioxide gas at STP in the following reaction? CaCO3(s) + 2 HCl(aq) - -> CaCl(aq) + CO2(g) + H20(1) In a reaction similar to this laboratory experiment, 0.625 g of aluminum metal was completely consumed and the H, gas collected over water at 55.0°C and atmospheric pressure of 759 mm Hg. What was the volume of H, gas produced? (Be sure to correct H2...
STOICHIOMETRY INVOLVING SOLIDS, LIQUIDS, AND GASES 1. 16.50 g of glucose, C6H12O6 was burned in the presence of excess oxygen, calculate the volume of CO2(g) that is produced at STP? CH120e(s) + 6O2(g) 6CO2(g) + 6H2O(g) 16.5g/1 mol CGHI2O 16 mol CO2 | 22.4L = 12.312 1180.156 C6H12 Ool Imol C6H12O6 mol CO2 What volume of 0.250 M HCl is required to completely react with 0.350 g of Na2CO3? Na2CO3(s) + 2HCl(aq) + 2NaCl(aq) + H2O(0) + CO2(g) (3.) Calcium...
WOL 2. What volume of 0.250 M HCl is required to completely react with 0.350 g of Na2CO3? Na2CO3(s) + 2HCl(aq) + 2NaCl(aq) + H2O(l) + CO2(g) 3. Calcium carbonate decomposes at high temperatures to give calcium oxide carbon dioxide. What volume of CO2 will be collected at 950 torr and 500°C when 75.0 g of CaCO3 react? CaCO3(s) → Cao(s) + CO2(g) 4. How many mL of 0.250 M KMnO4 are needed to react with 3.36 g of FeSO4...
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowed to react with 5.00 g of potassium. (write the chemical reaction first) 7.36 7.38 14.7 4.77 9.53 Question 2 1 pts Carbon dioxide is produced in the following reaction: 5 H2C204(aq) + 2 KMnO4 (aq) + 3 H2SO4 (aq) → 10 CO2(g) + 2 MnSO4 (aq) + K2SO4 (aq) + 8 H20 (1) What is the limiting reagent...
When 11.2 g Ca CO3 reacts with 300ml of 37% hyd rochloric acid (density: 1.2 g/mL), 4.61 g of CO2 is produced. What is the percent yield of CO2? (the rest f the products is calcium chloride and water) CO2(g)+CaCl2 (aq) + H2O() (not balanced) CACO3(s) +HCl(aq)
Determine the volume of O_2 (at STP) formed when 50.0 g of KClO_3 decomposes according to the following reaction. The molar mass for KClO_3 is 122.55 g/mol. 2 KClO_3 (s) rightarrow 2 KCl(s) + 3 O_2(g) A) 12.3 L B) 9.14 L C) 14.6 L D) 8.22 L E) 13.7 L A gas mixture consists of N_2, O_2, and Ne, where the mole fraction of N_2 is 0.55 and the fraction of Ne is 0.25. If the mixture is at...
Thankyou!
Consider the following unbalanced equation: O2(g) + C2H6(9) + CO2(g) + H20(1) If 24.7 moles of O2(g) reacts with an excess of C2H6(9), what is the theoretical yield of CO2(g) in moles? O 97.2 moles 14.1 moles 37.7 moles 88.6 moles O 26.8 moles A 1.80 g sample of barium chloride hydrate, BaCl2 mass of 1.72 g. Calculate the value of x. XH2O is treated with excess sulfuric acid, forming a BaSO4 precipitate which has a i ooooo When...
please explain and help calculate the orange cirlced ones
L in volume at STP 1. One mole of an IDEAL GAS occupies a) 12.2 6) 22.4 c) 23.6 d) 40 (2What are the units for the molar volume of a gas? -a) Moles/liter -b) Liters/mole Grams/mole d) Moles/grams What is the gas produce in this experiment CaCO3+ HCI? a) O2 b) CO2 c) NO2 d) H2 e) Natural gas on: 2:23 los molhoz 4 When CaCO3 react with HCI, calculate...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 33 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago