A very long charged wire in a particle detector (it can be approximated by an infinite...
A very long charged wire in a particle detector (it can be approximated by an infinite line charge) has a positive linear charge density 4.00×10−12 C/m . A proton (mass 1.67×10−27 kg, charge +1.60×10−19 C) is initially a distance 11.5 cm from the wire and moving directly toward the wire at a speed 2.40×103 m/s .
A) Calculate the proton's initial kinetic energy.
B) How close is the proton to the wire when its speed equals zero?
Homework Answers
Add Answer to:
A very long charged wire in a particle detector (it can be
approximated by an infinite...
A very long charged wire in a particle detector (it can be approximated by an infinite...
A very long charged wire in a particle detector (it can be approximated by an infinite line charge) has a positive linear charge density 6.00x10-12 C/m. A proton (mass 1.67x10-27 kg, charge +1.60 X 10-19 C) is initially a distance 19.0 cm from the wire and moving directly toward the wire at a speed 4.30x103 m/s. Calculate the proton's initial kinetic energy. How close is the proton to the wire when its speed equals zero?
An infinitely long line of charge has linear charge density 4.00×10−12 C/m . A proton (mass...
An infinitely long line of charge has linear charge density 4.00×10−12 C/m . A proton (mass 1.67×10−27 kg, charge +1.60×10−19 C) is 15.0 cmfrom the line and moving directly toward the line at 3.50×103 m/s . Calculate the proton's initial kinetic energy. Express your answer with the appropriate units. Ki = ............................................ How close does the proton get to the line of charge? Express your answer with the appropriate units. d = ....................................................
An infinitely long line of charge has linear charge density 6.00×10−12 C/m . A proton (mass1.67×10−27...
An infinitely long line of charge has linear charge density 6.00×10−12 C/m . A proton (mass1.67×10−27 kg, charge +1.60×10−19 C) is 18.0 cm from the line and moving directly toward the line at 2.90×103 m/s. A) Calculate the proton's initial kinetic energy. B) How close does the proton get to the line of charge? for A I got 7.02×10−21
"An infinitely long line of charge has linear charge density 6.50 10-12 C/m. A proton (mass...
"An infinitely long line of charge has linear charge density 6.50 10-12 C/m. A proton (mass 1.67 10-27 kg, charge +1.60 10-19 C) is 18.0 cm from the line and moving directly toward the line at 1.90 103 m/s. How close does the proton get to the line of charge?" _____ cm
An infinitely long line of charge has linear charge density 5.50 10-12 C/m. A proton (mass...
An infinitely long line of charge has linear charge density 5.50 10-12 C/m. A proton (mass 1.67 10-27 kg, charge +1.60 10-19 C) is 18.0 cm from the line and moving directly toward the line at 1.50 103 m/s. How close does the proton get to the line of charge? Incorrect: 15.17 cm
An infinitely long line of charge has linear charge density 5.00×10−12 C/m . A proton (mass...
An infinitely long line of charge has linear charge density 5.00×10−12 C/m . A proton (mass 1.67×10−27 kg , charge e) is 14.5 cm from the line and moving directly toward the line at 2500 m/s . The protons initial kinetic energy is 5.219x10^-21. How close does the proton get to the line of charge? Show work please. :)
A particle with a positive charge of 3 uC is moving parallel to a long (effectively...
A particle with a positive charge of 3 uC is moving parallel to a long (effectively infinite) wire carrying a current of 30 A. The particle's speed is 20 m/s and is the same direction as the current. The distance between the particle's path and the long wire is 0.5 m. (see figure below) (a) What is the magnitude of the magnetic field at the charged particle due to the long wire? (10 pt) (b) What is the direction of...
An alpha particle is a nucleus of Helium. It has twice the charge and four times...
An alpha particle is a nucleus of Helium. It has twice the charge and four times the mass of the proton (mp = 1.67 � 10-27 kg, c = 1.60 � 10-19 C). A proton and an alpha particle headed directly toward each other, had each initial speed of 0.0030c when they were far away. Here, as is customary when describing processes involving nuclear targets, the speed is expressed as a fraction of the speed of light, c = 3.0...
An alpha particle is a nucleus of helium. It has twice the charge and four times...
An alpha particle is a nucleus of helium. It has twice the
charge and four times the mass of the proton. When they were very
far away from each other, but headed toward directly each other, a
proton and an alpha particle each had an initial speed of 8.2×10−3
c, where c is the speed of light. What is their distance of closest
approach? There are two conserved quantities. Make use of both of
them. (c = 3.00 × 108...
proton is fired from very far away directly at a fixed particle with charge q =...
proton is fired from very far away directly at a fixed particle with charge q = 1.26 ✕ 10−18 C. the initial speed of the proton is 2.8 ✕ 105 m/s, what is its distance of closest approach to the fixed particle? mass of a proton is 1.67 ✕ 10−27 kg.
A very long charged wire in a particle detector (it can be approximated by an infinite line charge) has a positive linear charge density 6.00x10-12 C/m. A proton (mass 1.67x10-27 kg, charge +1.60 X 10-19 C) is initially a distance 19.0 cm from the wire and moving directly toward the wire at a speed 4.30x103 m/s. Calculate the proton's initial kinetic energy. How close is the proton to the wire when its speed equals zero?
A particle with a positive charge of 3 uC is moving parallel to a long (effectively infinite) wire carrying a current of 30 A. The particle's speed is 20 m/s and is the same direction as the current. The distance between the particle's path and the long wire is 0.5 m. (see figure below) (a) What is the magnitude of the magnetic field at the charged particle due to the long wire? (10 pt) (b) What is the direction of...
An alpha particle is a nucleus of helium. It has twice the
charge and four times the mass of the proton. When they were very
far away from each other, but headed toward directly each other, a
proton and an alpha particle each had an initial speed of 8.2×10−3
c, where c is the speed of light. What is their distance of closest
approach? There are two conserved quantities. Make use of both of
them. (c = 3.00 × 108...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago