1. A magnet can be used to efficiently separate a mixture of sand and very small...
1. A magnet can be used to efficiently separate a mixture of sand and very small iron pieces because the iron pieces will "bind" to the magnet but not the sand. When screening a library, what (in general) acts as the magnet? (One word)
Homework Answers
Ans. SUBJECT
# In a library, the books are generally and broadly categorized into subjects (like maths, biology, physics, etc.). So, if anyone wants to scree a library (to get any specified book), the SUBJECT of that book would act as magnet (the platform/rack where that book could be found).
Add Answer to:
1. A magnet can be used to efficiently separate a mixture of
sand and very small...
1.describe how you would separate a mixture of acetanilide and sand 2.water is a convenient solvent...
1.describe how you would separate a mixture of acetanilide and sand 2.water is a convenient solvent for recrsytallizing what type of compound. 3. why is fluted filter paper usually used when doing the hot filtration during a recrystallization. 4.describe how seed crystal are used in recrystallization. 5.explain the adage " like dissolve lik
2. Can Na2SO4 be used as a precipitating agent to separate a mixture of Fe2+ and...
2. Can Na2SO4 be used as a precipitating agent to separate a mixture of Fe2+ and Ca2+? Explain. 3. Can ammonia be used as a precipitating agent to separate a mixture of Al3+ and Cu2+? Explain. Describe a possible step-by-step procedure for separating a mixture of Ca2+, Al3+, Fe3+, and Zn2+. Be clear about what precipitating agent you will add in what order, and what will get filtered out at each step. At the end, you should have each of...
Question 6 1 pts It is no longer impossible to separate north and south poles in...
Question 6 1 pts It is no longer impossible to separate north and south poles in the manner that + and - charges can be separated, because the Gran Sasso Experiment in Italy successfully separated an N monopole from Earth's magnetic field, on Sept. 31, 2018. True False D 1 pts Question 7 Each atom in a chunk of ferromagnetic material, like iron, acts like a tiny bar magnet. True False 1 pts D Question 8
Given a solid mixture of the following molecules determine a separate scheme that can be used...
Given a solid mixture of the following molecules determine a separate scheme that can be used to separate the mixture using acid base extraction. - 2-hydroxybenzoic acid - 4-chloroanaline - trans-stillbene The following solvents and reagents will be available for use during the experiment 1. 5% sodium bicarbonate 2. 10% sodium hydroxide 3. Saturated sodium chloride 4. 5% hydrochloric acid 5. 6 M hydrochloric acid 6. Diethyl ether 7. Anhydrous sodium or magnesium sulfate *Can you include a experimental procedure...
1. Three separation unit operations (trommel screen, magnet, air classifier) are used to separate paper, ferrous,...
1. Three separation unit operations (trommel screen, magnet, air classifier) are used to separate paper, ferrous, and glass. The fraction of each material being rejected is: Material Feed (tons/hour) Trommel Screen Rejection Fraction Magnet Rejection Fraction Air Classifier Rejection Fraction Paper 40 0.9 0.9 0.1 Ferrous 10 0.5 0.05 0.95 Glass 10 0.1 1 0.5 Determine the appropriate order and combination of the units to achieve the highest recovery (you may use one, two, or three of the unit operations)
1. The stack of magnets works as one big bar magnet. Do the poles change when...
1. The stack of magnets works as one big bar magnet. Do the poles change when you divide the magnet into pieces? 2. In step 3 of the experiment, do both sides of the magnet attract the metal surface? Explain how a single magnet can repel the rest of the stack, but still stick to the other surface. 3. How does the magnet attract something that is originally non?magnetic? 1. Describe the direction of the compass needle as you moved...
5. The same procedure used in this lab can also be used to separate a 3-component mixture of benz...
Referring to liquid-liquid separation
5. The same procedure used in this lab can also be used to separate a 3-component mixture of benzoic acid, 2-naphthol and naphthalene. Predict the contents of the flasks 1-3 in the following situations (for flasks 1 and 2 after acidification with HCI). [3 points per part 9 points] a) The procedure was performed correctly. b) A student accidentally used 5% NaOH (aq) for the first set of extractions (flask 1) instead of 10% NaHCO3(aq). He...
1. The maximum weight percentage of carbon atoms (which are very small atoms) that can be...
1. The maximum weight percentage of carbon atoms (which are very small atoms) that can be contained in spaces between the iron atoms in a crystal of face-centered cubic iron at 1333 deg F (723 degC) is 0.8%C. PLEASE EXPLAIN IN DETAIL
How is it that cell fractionation can be used to separate nuclei, lipids, mitochondria, and ribosomes...
How is it that cell fractionation can be used to separate nuclei, lipids, mitochondria, and ribosomes from one another? What properties of the components is/are being used for separation? What can you modify or change about the centrifugation process in order to separate mixtures of components whose properties are very similar?
The goal of this experiment is to separate a mixture of two unknown compounds into individual...
The goal of this experiment is to separate a mixture of two unknown compounds into individual Components and to identify the compounds. Answer the questions below. More than one answer may be possible. Why do we need to be especially careful when working with diethyl ether? Fumes can cause drowsiness & dizziness, and in high concentration, loss of consciousness Because it is highly acidic and can burn the skin Because it is extremely volatile and flammable. Of all of the...
Question 6 1 pts It is no longer impossible to separate north and south poles in the manner that + and - charges can be separated, because the Gran Sasso Experiment in Italy successfully separated an N monopole from Earth's magnetic field, on Sept. 31, 2018. True False D 1 pts Question 7 Each atom in a chunk of ferromagnetic material, like iron, acts like a tiny bar magnet. True False 1 pts D Question 8
Referring to liquid-liquid separation
5. The same procedure used in this lab can also be used to separate a 3-component mixture of benzoic acid, 2-naphthol and naphthalene. Predict the contents of the flasks 1-3 in the following situations (for flasks 1 and 2 after acidification with HCI). [3 points per part 9 points] a) The procedure was performed correctly. b) A student accidentally used 5% NaOH (aq) for the first set of extractions (flask 1) instead of 10% NaHCO3(aq). He...
The goal of this experiment is to separate a mixture of two unknown compounds into individual Components and to identify the compounds. Answer the questions below. More than one answer may be possible. Why do we need to be especially careful when working with diethyl ether? Fumes can cause drowsiness & dizziness, and in high concentration, loss of consciousness Because it is highly acidic and can burn the skin Because it is extremely volatile and flammable. Of all of the...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 12 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 11 hours ago