If all the phosphate available in 5.25 g Mg3 (PO4)2 is converted to AlPO4 using chemical...
If all the phosphate available in 5.25 g Mg3 (PO4)2 is converted to AlPO4 using chemical reactions, what is the maximum amount (theoretical yield) of AlPO4 that can be obtained? In the lab, the yield of AlPO4 was only 75%. How many grams of AlPO4 was actually obtained?
Homework Answers
thanks and hope you like the
answerAdd Answer to:
If all the phosphate available in 5.25 g Mg3 (PO4)2 is converted
to AlPO4 using chemical...
(a) How many grams of magnesium phosphate, Mg3(PO4)2, would you need if you were required to...
(a) How many grams of magnesium phosphate, Mg3(PO4)2, would you need if you were required to make 215.0 mL of a magnesium phosphate solution with a concentration of 0.110 mol L-1? (5 marks) Molar masses: Mg3(PO4)2 = 262.9 g mol-1 1 L = 1000 mL g Mg3(PO4)2 and What is the concentration of PO43- ions in the 0.110 mol L-1 solution of magnesium phosphate? (2 marks) mol L-1
1. Consider the reaction: MnO2 (s) + 4 HCl (g)MnCl2 (s) + Cl2 (g) + 2 H20 (g) If 10.00 g of MnO2 ...
1. Consider the reaction: MnO2 (s) + 4 HCl (g)MnCl2 (s) + Cl2 (g) + 2 H20 (g) If 10.00 g of MnO2 and 10.00 g of HCl are reacted, how many grams of MnCl2 can be produced? Show all calculations 2. Consider the following unbalanced equation: NH4NOs(aq) + Na PO4(aq)(NH4)3PO4(aq NaNOs(aq) Assuming you start with 50.0 g of NHNOs and 50.0 g of NasPO4, which is the limiting reagent? What is the theoretical yield (g) of ammonium phosphate? a....
Phosphoric acid can be prepared from calcium phosphate according to the following reaction: Ca3(PO4)2 (s) +...
Phosphoric acid can be prepared from calcium phosphate according to the following reaction: Ca3(PO4)2 (s) + 3 H2SO4 (l) → 3 CaSO4 (s) + 2 H3PO4 (l) 310. g/mol 98.0 g/mol 136 g/mol 98.0 g/mol [a] If 0.664 mole of Ca3(PO4)2 are combined with 1.53 mole of H2SO4, how many grams of H3PO4 can be produced? [4 pts] [b] If 62.6 g of H3PO4 is actually produced in the above reaction, what is the percent yield for the reaction? [2...
6.10 Balance the chemical equation: 2 AI +3 CI, 2 AICI, a. How many moles of...
6.10 Balance the chemical equation: 2 AI +3 CI, 2 AICI, a. How many moles of chlorine gas will react with 0.160 mole of aluminum? b. The theoretical yield (Sec. 6.9) for a chemical reaction is the maximum amount of a product that can be obtained from given amounts of reactants. Calculate the theoretical yield, in grams, of aluminum chloride that could be produced from 5.27 moles of aluminum. (Assume that enough Cl, is present.) c. What is the theoretical...
6.10 2 AICI, a. 2.224 12- 112 mol 112 x 61.9789 €6.949 Balance the chemical equation:...
6.10 2 AICI, a. 2.224 12- 112 mol 112 x 61.9789 €6.949 Balance the chemical equation: 2 Al +3 Cl, How many moles of chlorine gas will react with 0.160 mole of aluminum? 29 b. The theoretical yield (Sec. 6.9) for a chemical reaction is the maximum amount of a product that can be obtained from given amounts of reactants. Calculate the theoretical yield, in grams, of aluminum chloride that could be produced from 5.27 moles of aluminum. (Assume that...
total volume of 500 . mL In the laboratory you dissolve 18.1 g of ammonium phosphate...
total volume of 500 . mL In the laboratory you dissolve 18.1 g of ammonium phosphate in a volumetric flask and add water to What is the molarity of the solution? M How many milliliters of an aqueous solution of 0.137 M calcium chloride is needed to obtain 18.1 grams of the salt? mL You need to make an aqueous solution of 0.232 M aluminum nitrate for an experiment in lab, using a 125 mL volumetric flask. How much solid...
Mg + O2 ——> 2MgO Using the above balanced chemical equation, if a 0.23 g strip...
Mg + O2 ——> 2MgO Using the above balanced chemical equation, if a 0.23 g strip of magnesium is completely reacted…. a. How many grams of oxygen would be required to complete the reaction? b. How many grams of magnesium oxide would be formed? Note that this is called the theoretical yield of a reaction…in other words, based on a calculation, how much of a given product is theoretically possible.
Calculate the percent yield of your product assuming you started with 0.545 grams of Al metal...
Calculate the percent yield of your product assuming you started with 0.545 grams of Al metal and collect 5.25 grams of alum product? 1) Calculate the number of moles of Al used in your reaction. 2) Calculate the molar mass of alum, potassium aluminum sulfate dodecahydrate (do not forget to include the associated water in you molar mass calculation). 3) This experiment has been set up such that Al is the limiting reagent,(determines the maximum amount of product that could...
2. what is the limiting reactant if 0.5g Al is reacted with 3.5g CuCl2? Take into...
2. what is the limiting reactant if 0.5g Al is reacted with
3.5g CuCl2? Take into account CuCl2 is a dihydrate when calculating
the molecular weight
is this EC? Limiting Reactant and Percent Yield Lab Objectives: top 5 colors • Learn to determine the limiting reagent of a reaction. • Learn how to calculate theoretical, actual, and percent yield of a reaction. Background: During a chemical reaction when two substances react, often times one reactant will be consumed before the...
Exact mass of sodium bicarbonate: 2.110g Molar mass of sodium bicarbonate: 84.007 g/mol Molar mas...
Exact mass of sodium bicarbonate: 2.110g
Molar mass of sodium bicarbonate: 84.007 g/mol
Molar mass of sodium acetate: 82.034 g/mol
After you have recorded and any other glassware you have used. All waste can go down the sink. the mass of the beaker after the reaction, you may rinse out the beaker 10. CALCULATIONS: a) Rewrite the balanced chemical equation here Calculate the theoretical amount of sodium acetate that should be formed in the reaction (follow steps 1-3 below). b)...
1. Consider the reaction: MnO2 (s) + 4 HCl (g)MnCl2 (s) + Cl2 (g) + 2 H20 (g) If 10.00 g of MnO2 and 10.00 g of HCl are reacted, how many grams of MnCl2 can be produced? Show all calculations 2. Consider the following unbalanced equation: NH4NOs(aq) + Na PO4(aq)(NH4)3PO4(aq NaNOs(aq) Assuming you start with 50.0 g of NHNOs and 50.0 g of NasPO4, which is the limiting reagent? What is the theoretical yield (g) of ammonium phosphate? a....
6.10 Balance the chemical equation: 2 AI +3 CI, 2 AICI, a. How many moles of chlorine gas will react with 0.160 mole of aluminum? b. The theoretical yield (Sec. 6.9) for a chemical reaction is the maximum amount of a product that can be obtained from given amounts of reactants. Calculate the theoretical yield, in grams, of aluminum chloride that could be produced from 5.27 moles of aluminum. (Assume that enough Cl, is present.) c. What is the theoretical...
6.10 2 AICI, a. 2.224 12- 112 mol 112 x 61.9789 €6.949 Balance the chemical equation: 2 Al +3 Cl, How many moles of chlorine gas will react with 0.160 mole of aluminum? 29 b. The theoretical yield (Sec. 6.9) for a chemical reaction is the maximum amount of a product that can be obtained from given amounts of reactants. Calculate the theoretical yield, in grams, of aluminum chloride that could be produced from 5.27 moles of aluminum. (Assume that...
total volume of 500 . mL In the laboratory you dissolve 18.1 g of ammonium phosphate in a volumetric flask and add water to What is the molarity of the solution? M How many milliliters of an aqueous solution of 0.137 M calcium chloride is needed to obtain 18.1 grams of the salt? mL You need to make an aqueous solution of 0.232 M aluminum nitrate for an experiment in lab, using a 125 mL volumetric flask. How much solid...
2. what is the limiting reactant if 0.5g Al is reacted with
3.5g CuCl2? Take into account CuCl2 is a dihydrate when calculating
the molecular weight
is this EC? Limiting Reactant and Percent Yield Lab Objectives: top 5 colors • Learn to determine the limiting reagent of a reaction. • Learn how to calculate theoretical, actual, and percent yield of a reaction. Background: During a chemical reaction when two substances react, often times one reactant will be consumed before the...
Exact mass of sodium bicarbonate: 2.110g
Molar mass of sodium bicarbonate: 84.007 g/mol
Molar mass of sodium acetate: 82.034 g/mol
After you have recorded and any other glassware you have used. All waste can go down the sink. the mass of the beaker after the reaction, you may rinse out the beaker 10. CALCULATIONS: a) Rewrite the balanced chemical equation here Calculate the theoretical amount of sodium acetate that should be formed in the reaction (follow steps 1-3 below). b)...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 3 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 52 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago