Describe what happens in glutamate metabolism. How does this amino acid work into central metabolism for...
Describe what happens in glutamate metabolism. How does this amino acid work into central metabolism for carbon and energy?
Homework Answers
Glutamate plays an important role in the metabolism of amino acids. It serves to remove the toxic amino (NH2) group from the body. Glutamate is produced in the body as a result of transamination of amino acids, and hydrolysis of glutamine. The glutamate work into central metabolism for carbon and energy by,
- Oxidative deamination to alpha ketoglutarate
- Amination to glutamine
- Decarboxylation to form gamma amino butyric acid (GABA)
- Formation of N-acetyl glutamate
Add Answer to:
Describe what happens in glutamate metabolism. How does this
amino acid work into central metabolism for...
what would happen to the flow of carbon in central metabolism if alpha-ketoglutarate was being removed...
what would happen to the flow of carbon in central metabolism if alpha-ketoglutarate was being removed to make the amino acid glutamate?
What role does glutamine play in amino acid metabolism of plants and how is it affected...
What role does glutamine play in amino acid metabolism of plants and how is it affected by light?
Describe how inorganic nitrogen is assimilated into glutamate and the other 19 amino acids used for...
Describe how inorganic nitrogen is assimilated into glutamate and the other 19 amino acids used for protein synthesis. What are the products of amino acid oxidation and how do humans dispose of their nitrogenous waste?
Serotonin is a downstream product of Amino Acid metabolism. Describe this process and the possible effects...
Serotonin is a downstream product of Amino Acid metabolism. Describe this process and the possible effects that dietary proteins can have on mood and higher-order brain function.
QUESTION 13 In general, amino acid metabolism differs from carbohydrate and lipid metabolism because: A. amino...
QUESTION 13 In general, amino acid metabolism differs from carbohydrate and lipid metabolism because: A. amino acids can not be metabolized for energy while carbohydrates and lipids can. B. excess nitrogen is stored as amino acids while excess carbohydrates and lipids are stored. C. excess nitrogen beyond the needs of the cell are excreted while excess lipids and carbohydrates are stored. D. all of the above answers are correct. QUESTION 14 In the termination of DNA replication, the motion of...
Sickle cell anemia is a genetic disease resulting from a single amino acid substitution (glutamate to...
Sickle cell anemia is a genetic disease resulting from a single amino acid substitution (glutamate to valine in the sixth position, or E6V) in the hemoglobin β chain. This mutation causes hemoglobin to polymerize into strands in the deoxygenated state, leading to the erythrocytes forming a sickled shape. Speculate as to why the mutation leads to the polymerization of hemoglobin and why this only happens in the deoxygenated state.
Describe how the body maintains homeostasis in regulating glucose metabolism in the body. Tell what happens...
Describe how the body maintains homeostasis in regulating glucose metabolism in the body. Tell what happens when there is too much or too little of each major regulatory hormone. Describe the path food follows as it travels through the digestive system. Summarize the major structures and functions of those structures along the way.
Explain how the tri-carboxylic acid cycle connects the metabolism of carbohydrates, amino acids and lipids.
Explain how the tri-carboxylic acid cycle connects the metabolism of carbohydrates, amino acids and lipids.
describe the basic structure of an amino acid. what classes of amino acids are there?
describe the basic structure of an amino acid. what classes of amino acids are there?
In reference to muscle metabolism, how does ATP synthesis occur, what are the immediate needs for...
In reference to muscle metabolism, how does ATP synthesis occur, what are the immediate needs for energy for a muscle both short term and long term, what causes fatigue of a muscle and describe maximum oxygen uptake in endurance?
QUESTION 13 In general, amino acid metabolism differs from carbohydrate and lipid metabolism because: A. amino acids can not be metabolized for energy while carbohydrates and lipids can. B. excess nitrogen is stored as amino acids while excess carbohydrates and lipids are stored. C. excess nitrogen beyond the needs of the cell are excreted while excess lipids and carbohydrates are stored. D. all of the above answers are correct. QUESTION 14 In the termination of DNA replication, the motion of...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 22 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago