1. Explain why electrons are located in different “zones” of space outside the nucleus. 2. Why...
1. Explain why electrons are located in different “zones” of space outside the nucleus.
2. Why are these zones of space not “real” 3-D regions of space?
3. Recall, these probabilistic regions of space are called principal energy levels or “shells.” How many different shells are there?
Homework Answers
Answer#1) Orbitals are grouped in "zones" at different distances from the center.
These "zones" are known as energy levels of the atoms.
Electrons are located in different "zones" because of difference in energies of the electrons.
*Electrons in the zones, near the center, are lower in energy.
*Electrons in the zones , far from the center, have higher energy than the nearer one.
The lowest energy level is a single 1s orbital, that can hold 2e-.
Next zone is 2s , 2p1, 2p2, 2p3 orbitals. So total electrons will be 8e-.
Next zone is the higher level, 3s and 3p.
Add Answer to:
1. Explain why electrons are located in different
“zones” of space outside the nucleus.
2. Why...
1. How many valence electrons are in the following: N 2. Tell if these will become...
1. How many valence electrons are in the following: N 2. Tell if these will become anions or cations. ca Mg. 3. If pH changes from 6 to 9 how much more basic is the solution? Will it have more or less H* in it than the original solution? 4. How many electron shells would have around the nucleus? 5. What is the atomic number of P? Nitrogenous base NH, 6. The molecule NaCl forms when Nat and Clare attracted...
8. Why does carbon contain only 4 valence electrons when it has 6 total electrons? 9.True...
8. Why does carbon contain only 4 valence electrons when it has
6 total electrons?
9.True or False. Oxygen and sulfur have the same number of
valence electrons.
10. True or False. Beryllium and magnesium have the same number
of valence electrons.
11. True or False. Sodium and magnesium have the same number of
valence electrons.
12. What is the relationship between the number of valence
electrons and the column on the periodic table?
13. How is the number of...
3. Atomic physics of sodium. In the sodium atom, there is a transition between the 3s and 3p atomic states that produce...
3. Atomic physics of sodium. In the sodium atom, there is a transition between the 3s and 3p atomic states that produces the yellow-orange light seen in many street lamps a. Sodium has 11 protons and 11 electrons with ten of the electrons filling the n =1 and n = 2 levels. Including interactions between the outer electron and the electrons in the underlying shells, should the 3s or the 3p energy level have the highest energy? Use properties of...
Copper has two stable isotopes, Cu and electrons in Copper-65? Cu. How many protons, neutrons and...
Copper has two stable isotopes, Cu and electrons in Copper-65? Cu. How many protons, neutrons and 29 protons, 34 neutrons and 29 electrons 65 protons, 29 neutrons and 65 electrons 29 protons, 36 neutrons and 29 electrons 36 protons, 29 neutrons and 36 electrons Which statement is FALSE about electrons and the energy levels they occupy in the structure of an atom? While the mass of an electron amounts to almost nothing they can absorb and emit significant amounts of...
1. Write out the full name for DNA. 2. Why is the nucleus called the "control...
1. Write out the full name for DNA. 2. Why is the nucleus called the "control center" of the cell? 3. Where in the cell are the chromosomes located? 4. What is a gene? 5. What do proteins do for your body? 6. What holds the sides of the DNA ladder together? 7. What are the sides of the DNA ladder made of? 8. What three parts make up a single nucleotide? 9. What are the 4 bases that make...
1. Using basic electrostatic arguments, explain why an electron “in” the 2s orbital of neon is...
1. Using basic electrostatic arguments, explain why an electron “in” the 2s orbital of neon is of higher potential energy than it would be “in” the 1s orbital. 2. Explain why is it that periods 2 and 3 of the periodic table have 8 elements apiece while periods 4 and 5 have 18 elements and why aren't there 18 elements in period 3? 3. How many orbitals exists when n=5, l=3? What are these orbitals called? Are these orbitals degenerate?...
Each of the statements below attempts to explain why some periodic property varies predictably among elements...
Each of the statements below attempts to explain why some periodic property varies predictably among elements in the periodic table. Determine if each statement is true or false. True False Within a family, elements with higher atomic numbers have atoms of larger radius because the atoms have lower effective nuclear charge. True False Within a period, elements with lower atomic numbers have lower electronegativity because the valance electrons are in higher principal energy levels. True False Within a family, elements with lower atomic...
Discussion 1. Is there any difference in staining between the nucleus and cytoplasm? Why? 2. Is...
Discussion 1. Is there any difference in staining between the nucleus and cytoplasm? Why? 2. Is the polysaccharide homogeneously distributed throughout the cytoplasm or is it granular in appearance? Why? 3. Monosaccharides such as glucose are used in energy metabolism. Would they obscure glycogen staining in the slide you prepared? Explain your answer. 10. Consider the rational function RO (*+ 4x + 4)(21 - 2) I -a (a) Find the domain of R(x). (b) List all of the vertical asymptotes...
65) The nucleus of an atom contains: a) protons and electrons b) just electrons c) electrons and neutrons d) proton...
65) The nucleus of an atom contains: a) protons and electrons b) just electrons c) electrons and neutrons d) protons and neutrons e) neutrons 66) The atomic number of an atom is: a) the number of electrons it has b) the number of neutrons it has c) the number of protons it has d) the number of protons plus the number of neutrons it has e) the combined total of protons, neutrons and electrons that it has 67) In water,...
1. How many valence electrons are in the following: N 2. Tell if these will become anions or cations. ca Mg. 3. If pH changes from 6 to 9 how much more basic is the solution? Will it have more or less H* in it than the original solution? 4. How many electron shells would have around the nucleus? 5. What is the atomic number of P? Nitrogenous base NH, 6. The molecule NaCl forms when Nat and Clare attracted...
8. Why does carbon contain only 4 valence electrons when it has
6 total electrons?
9.True or False. Oxygen and sulfur have the same number of
valence electrons.
10. True or False. Beryllium and magnesium have the same number
of valence electrons.
11. True or False. Sodium and magnesium have the same number of
valence electrons.
12. What is the relationship between the number of valence
electrons and the column on the periodic table?
13. How is the number of...
3. Atomic physics of sodium. In the sodium atom, there is a transition between the 3s and 3p atomic states that produces the yellow-orange light seen in many street lamps a. Sodium has 11 protons and 11 electrons with ten of the electrons filling the n =1 and n = 2 levels. Including interactions between the outer electron and the electrons in the underlying shells, should the 3s or the 3p energy level have the highest energy? Use properties of...
Copper has two stable isotopes, Cu and electrons in Copper-65? Cu. How many protons, neutrons and 29 protons, 34 neutrons and 29 electrons 65 protons, 29 neutrons and 65 electrons 29 protons, 36 neutrons and 29 electrons 36 protons, 29 neutrons and 36 electrons Which statement is FALSE about electrons and the energy levels they occupy in the structure of an atom? While the mass of an electron amounts to almost nothing they can absorb and emit significant amounts of...
1. Write out the full name for DNA. 2. Why is the nucleus called the "control center" of the cell? 3. Where in the cell are the chromosomes located? 4. What is a gene? 5. What do proteins do for your body? 6. What holds the sides of the DNA ladder together? 7. What are the sides of the DNA ladder made of? 8. What three parts make up a single nucleotide? 9. What are the 4 bases that make...
Discussion 1. Is there any difference in staining between the nucleus and cytoplasm? Why? 2. Is the polysaccharide homogeneously distributed throughout the cytoplasm or is it granular in appearance? Why? 3. Monosaccharides such as glucose are used in energy metabolism. Would they obscure glycogen staining in the slide you prepared? Explain your answer. 10. Consider the rational function RO (*+ 4x + 4)(21 - 2) I -a (a) Find the domain of R(x). (b) List all of the vertical asymptotes...
65) The nucleus of an atom contains: a) protons and electrons b) just electrons c) electrons and neutrons d) protons and neutrons e) neutrons 66) The atomic number of an atom is: a) the number of electrons it has b) the number of neutrons it has c) the number of protons it has d) the number of protons plus the number of neutrons it has e) the combined total of protons, neutrons and electrons that it has 67) In water,...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago