Spermine (structure shown) is a compound isolated from sperm. Which of the following statements correctly describes...
Spermine (structure shown) is a compound isolated from sperm.
Which of the following statements correctly describes an aqueous
solution of spermine?
NH2(CH2)3NH(CH2)4NH(CH2)3NH2
Question 2 options:
|
|||
|
|||
|
|||
|
Homework Answers
ANSWER- OPTION A, The hydroxide ion concentration in the solution would be greater than that in pure water.
Solution-
Spermine is basic in nature as it contains di-amine group (NH2), which is basic in nature i.e. it easily gives off electrons.
Thus being basic spermine solution will have more concentration of Hydroxide ion [OH-].
PLEASE RATE :-)
Add Answer to:
Spermine (structure shown) is a compound isolated from sperm.
Which of the following statements correctly describes...
please answer quickly Which of the following statements correctly describes the hydronium-hydroxide balance in the given...
please answer quickly
Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? In acids, [OH-] is less than [ H30+). In acids, [OH-] = [H3O+]. In neutral solutions, [H3O+] = [H20). In bases, [H3O+] is more than [H20] In acids, [OH-] is greater than [H3O+]. O
9. Consider a 0.15 M solution of H2SO4. Which of the following statements is NOT true?...
9. Consider a 0.15 M solution of H2SO4. Which of the following statements is NOT true? A) This solution would turn litmus to red. B) This solution could neutralize a base. C) This solution has a pH of 11.20. D) This solution could dissolve metal. E) none of the above 10. What is the concentration of the hydronium [Halo ons in a neutral solution? 11. What is the concentration of hydronium ions in an acidic solution? A) 0.0 M B)...
5. In the following reaction CH, NH, +H,0— CH, NH; + OH CH,NH, + H2O ---→...
5. In the following reaction CH, NH, +H,0— CH, NH; + OH CH,NH, + H2O ---→ CH,NH,+ + OH- the compound CH,NH, behaves as: a) an acid b) a base c) a salt d) a conjugate acid 26. In an acidic solution the a) concentration of hydronium ion is greater than that of hydroxide ion. b) concentration of hydroxide ion greater than that of hydronium ion. C) concentration of hydronium ion and hydroxide ion are equal 27. In which of...
D Question 23 4 pts When a 0.100 mol of a pure compound is dissolved in...
D Question 23 4 pts When a 0.100 mol of a pure compound is dissolved in 1.0 L of water, the solution pH changes from 7.00 to 4.24. Which of the following is most likely the identity of the substance? A weak base A neutral salt A weak acid A strong base A strong acid Question 24 4 pts If the hydronium ion concentration, [H30*), in a solution is 5.6x10-10 M, what is the hydroxide ion concentration, [OH"), and the...
Help Save & Exit Sub Assessment A sample of water from the Chesapeake Bay has [H307-31...
Help Save & Exit Sub Assessment A sample of water from the Chesapeake Bay has [H307-31 x 109 M. Which statement below accurately describes this water sample? Multiple Choice The water sample is a basic solution oo The water sample doesn't contain any hydroxide ions. The water sample has a higher concentration of hydronium ions than pure water does O o O The pH of the water sample is 75 < Prev 16 of 41 HI N est > A...
Which of the following statements describes a basic solution? 1. [H30+]> [OH] 2. [H30]<[OH] 3. [H30']...
Which of the following statements describes a basic solution? 1. [H30+]> [OH] 2. [H30]<[OH] 3. [H30'] x [OH] #1 x 10-14 4. [H3O+]/[OH] = 1 x 10-14 5. [H3O+]/[OH]=1 If the pH of a solution is 10, what is the hydronium, H ion concentration? 1. A) 1 x 10-10 M 2. B) 1 x 1010 M 3. C) 10 M 4. D) 10 M 5.E) * 1 1010 M As the pH increases the hydroxide ion concentration 1. A) goes...
A) H20 c) нсоз- E) H2CO3 DOH. 22) Which of the following statements correctly describes the...
A) H20 c) нсоз- E) H2CO3 DOH. 22) Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? A) In acids, [OH-] is greater than [H3O* B) In bases, [OH-]- [H3o*]. C) In neutral solutions, [H3O"] = [H20]. D) In bases, [OH-] is greater than [H3o*]. E) In bases, [OH-] is less than [H30*]. 23) Which of the following is a buffer system? A) NaCl(aq) and NaNO3(aq) C) H2CO3(aq) and KHCO3 (aq) E) H20(0) and HCl(aq)...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e)...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e) HSO (d) F (b) Н:0" 6, Use Table 15.2 (page 529) to decide whether the species on the left or those on the right are favored by the reaction. a. NH4 (aq) + H2PO4" (aq) # NH3(aq) + HsPO b. HCN (aq) + HS(aq) CN" (aq) +H2S c. HCO +OH CO2 H2S d. Al(H20)6 3+ +OH = Al(H20) s2+ OH 7. The equilibrium constant...
i want answer to all questions please Answer: 29) Consider the following generalized buffer solution equilibrium: When a small amount of a strong base such as sodium hydroxide is added to the so...
i want answer to all questions please
Answer: 29) Consider the following generalized buffer solution equilibrium: When a small amount of a strong base such as sodium hydroxide is added to the solution, which of the four species shown would experience an increase in concentration? A) BH B)H C) HO D)B E None of the species would increase in concentration. Answer: ( 30) What is true about a solution whose pH is less than 7 at 25°C? A) It has...
U. The reversible reaction follows Le Chatelier's Principle. 10. What is TRUE about a solution whose...
U. The reversible reaction follows Le Chatelier's Principle. 10. What is TRUE about a solution whose pH is less than 7? 10. a. It has a hydrogen ion concentration less than 1 x 10-7 b. It has a hydrogen ion concentration that is higher than pure water itself. c. It has a hydroxide ion concentration equal to its hydrogen ion conce d. It is a solution that requires a buffer. e. It is a basic solution. 11. The conjugate acid...
please answer quickly
Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? In acids, [OH-] is less than [ H30+). In acids, [OH-] = [H3O+]. In neutral solutions, [H3O+] = [H20). In bases, [H3O+] is more than [H20] In acids, [OH-] is greater than [H3O+]. O
9. Consider a 0.15 M solution of H2SO4. Which of the following statements is NOT true? A) This solution would turn litmus to red. B) This solution could neutralize a base. C) This solution has a pH of 11.20. D) This solution could dissolve metal. E) none of the above 10. What is the concentration of the hydronium [Halo ons in a neutral solution? 11. What is the concentration of hydronium ions in an acidic solution? A) 0.0 M B)...
5. In the following reaction CH, NH, +H,0— CH, NH; + OH CH,NH, + H2O ---→ CH,NH,+ + OH- the compound CH,NH, behaves as: a) an acid b) a base c) a salt d) a conjugate acid 26. In an acidic solution the a) concentration of hydronium ion is greater than that of hydroxide ion. b) concentration of hydroxide ion greater than that of hydronium ion. C) concentration of hydronium ion and hydroxide ion are equal 27. In which of...
D Question 23 4 pts When a 0.100 mol of a pure compound is dissolved in 1.0 L of water, the solution pH changes from 7.00 to 4.24. Which of the following is most likely the identity of the substance? A weak base A neutral salt A weak acid A strong base A strong acid Question 24 4 pts If the hydronium ion concentration, [H30*), in a solution is 5.6x10-10 M, what is the hydroxide ion concentration, [OH"), and the...
Help Save & Exit Sub Assessment A sample of water from the Chesapeake Bay has [H307-31 x 109 M. Which statement below accurately describes this water sample? Multiple Choice The water sample is a basic solution oo The water sample doesn't contain any hydroxide ions. The water sample has a higher concentration of hydronium ions than pure water does O o O The pH of the water sample is 75 < Prev 16 of 41 HI N est > A...
Which of the following statements describes a basic solution? 1. [H30+]> [OH] 2. [H30]<[OH] 3. [H30'] x [OH] #1 x 10-14 4. [H3O+]/[OH] = 1 x 10-14 5. [H3O+]/[OH]=1 If the pH of a solution is 10, what is the hydronium, H ion concentration? 1. A) 1 x 10-10 M 2. B) 1 x 1010 M 3. C) 10 M 4. D) 10 M 5.E) * 1 1010 M As the pH increases the hydroxide ion concentration 1. A) goes...
A) H20 c) нсоз- E) H2CO3 DOH. 22) Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? A) In acids, [OH-] is greater than [H3O* B) In bases, [OH-]- [H3o*]. C) In neutral solutions, [H3O"] = [H20]. D) In bases, [OH-] is greater than [H3o*]. E) In bases, [OH-] is less than [H30*]. 23) Which of the following is a buffer system? A) NaCl(aq) and NaNO3(aq) C) H2CO3(aq) and KHCO3 (aq) E) H20(0) and HCl(aq)...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e) HSO (d) F (b) Н:0" 6, Use Table 15.2 (page 529) to decide whether the species on the left or those on the right are favored by the reaction. a. NH4 (aq) + H2PO4" (aq) # NH3(aq) + HsPO b. HCN (aq) + HS(aq) CN" (aq) +H2S c. HCO +OH CO2 H2S d. Al(H20)6 3+ +OH = Al(H20) s2+ OH 7. The equilibrium constant...
i want answer to all questions please
Answer: 29) Consider the following generalized buffer solution equilibrium: When a small amount of a strong base such as sodium hydroxide is added to the solution, which of the four species shown would experience an increase in concentration? A) BH B)H C) HO D)B E None of the species would increase in concentration. Answer: ( 30) What is true about a solution whose pH is less than 7 at 25°C? A) It has...
U. The reversible reaction follows Le Chatelier's Principle. 10. What is TRUE about a solution whose pH is less than 7? 10. a. It has a hydrogen ion concentration less than 1 x 10-7 b. It has a hydrogen ion concentration that is higher than pure water itself. c. It has a hydroxide ion concentration equal to its hydrogen ion conce d. It is a solution that requires a buffer. e. It is a basic solution. 11. The conjugate acid...
Most questions answered within 3 hours.
-
The manager at a car assembly plant believes that the mean
assembly time for a car...
asked 11 minutes ago -
Which of the following is true of electron capture?
A) It decreases the nuclide's mass number...
asked 1 hour ago -
Assuming an efficiency of 43.10%, calculate the actual yield of
magnesium nitrate formed from 114.9 g...
asked 2 hours ago -
The highly pathogenic bacterium Clostridium
perfringens causes gangrene, a disease that results in the
destruction of...
asked 4 hours ago -
In the context of situation analysis, which of the following is
a category for analysis in...
asked 4 hours ago -
In a study of the gas phase decomposition of sulfuryl chloride
at 600 K SO2Cl2(g)SO2(g) +...
asked 4 hours ago -
75 g of 2-propanol (C3H8O) and 25 g of pentane are mixed in a
200 mL...
asked 4 hours ago -
The 2800-turn coil in a dc motor has an area per turn of 1.1 ×
10-2...
asked 4 hours ago -
Draw a combinational logic circuit diagram with a symbol inside
the box for two I/P of...
asked 4 hours ago -
The cliché we use quite a lot in finance is: there is a need to
maximize...
asked 4 hours ago -
In class we discussed the addition of HCl to alpha pinene. Would
you expect one or...
asked 4 hours ago -
I'm trying to explain to my daughter to help her please help
me
I tagged the...
asked 4 hours ago