-What is the difference between the quantal and quantitative method of virus titration?
-What is the difference between the quantal and quantitative method of virus titration?
Homework Answers
To measure infectivity, one could look at any virus-cell interaction indicative of virus replication, and develop an assay to obtain a titer for a given virus stock, where a titer is defined as a given number of infectious virus units per unit volume, and an infectious unit is the smallest amount of virus that produces some recognizable effect in the host system employed. There are two basic types of infectivity assays: (1) quantal assays and (2) quantitative assays. Quantal assays do not count the number of infectious virus particles present in the inoculum but instead obtain a value for the virus titer where the measurement is based on an all-or-nothing principle. In quantitative assays, the number of infectious virus particles present in the original suspension can be quantified.
Add Answer to:
-What is the difference between the quantal and quantitative
method of virus titration?
_Please explain, What is the difference between (+)Sense Virus, (-)sense virus, and retroviruses? _What is the...
_Please explain, What is the difference between (+)Sense Virus, (-)sense virus, and retroviruses? _What is the difference between single ORF and multiple ORF, I know one is single reading frame and one is multiple reading frame, but what the use of them in term of genetics of viruses?
What is the difference between qualitative and quantitative research? Include mention of possible differences in purpose,...
What is the difference between qualitative and quantitative research? Include mention of possible differences in purpose, method, data sources, and data analysis.
What is the difference between quantitative and qualitative research? Select one: O a. Quantitative is product-oriented...
What is the difference between quantitative and qualitative research? Select one: O a. Quantitative is product-oriented and qualitative is process- oriented O b. Quantitative focus on subjective data and qualitative on objective data. O C. Quantitative is broad and inclusive in scope and qualitative is narrow in scope. O d. Quantitative is based on social values and qualitative is based on psychological and biophysical facts.
What is the difference between a direct titration and a back titration? (Select all that apply.)...
What is the difference between a direct titration and a back titration? (Select all that apply.) In a direct titration, a known excess of reagent that reacts with analyte is used. The excess is then measured with a second titrant. In a back titration, titrants react directly with analyte. In a direct titration, titrants react directly with analyte. In a back titration, a known excess of reagent that reacts with analyte is used. The excess is then measured with a...
What is the difference between a qualitative and quantitative test. How would this be related to...
What is the difference between a qualitative and quantitative test. How would this be related to bacterial susceptibility?
What is the difference between an enveloped vs. non-enveloped virus? Give one example of each. In...
What is the difference between an enveloped vs. non-enveloped virus? Give one example of each. In an enveloped virus, where does the envelope come from?
9. What are the crucial difference between virus-host interactions and predator-prey interactions...
9. What are the crucial difference between virus-host interactions and predator-prey interactions? 10. What are restriction enzymes? How do they play a role a resistant to viral infection? How do the host protect their own genome from restriction enzymes?
9. What are the crucial difference between virus-host interactions and predator-prey interactions? 10. What are restriction enzymes? How do they play a role a resistant to viral infection? How do the host protect their own genome from restriction enzymes?
What is the difference between a quantitative and qualitative research article? How can you quickly identify...
What is the difference between a quantitative and qualitative research article? How can you quickly identify the difference between the two when reading a nursing research article?
What is the difference between the equivalence point of a titration and the end point of...
What is the difference between the equivalence point of a titration and the end point of a titration? They are not different. The equivalence point is when the reaction has reached completion while the end point is an estimate of the completion. The equivalence point is when the reaction has reached completion while the end point is the half-way point of the titration. The equivalence point allows us to calculate unknown quantities of reactants while the end point does not.
What is the difference between qualitative and quantitative research sampling strategies? Compare and contrast the strategies...
What is the difference between qualitative and quantitative research sampling strategies? Compare and contrast the strategies and describe some of the advantages and disadvantages of each.
What is the difference between quantitative and qualitative research? Select one: O a. Quantitative is product-oriented and qualitative is process- oriented O b. Quantitative focus on subjective data and qualitative on objective data. O C. Quantitative is broad and inclusive in scope and qualitative is narrow in scope. O d. Quantitative is based on social values and qualitative is based on psychological and biophysical facts.
9. What are the crucial difference between virus-host interactions and predator-prey interactions? 10. What are restriction enzymes? How do they play a role a resistant to viral infection? How do the host protect their own genome from restriction enzymes?
9. What are the crucial difference between virus-host interactions and predator-prey interactions? 10. What are restriction enzymes? How do they play a role a resistant to viral infection? How do the host protect their own genome from restriction enzymes?
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 14 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 45 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago