looking at the generalized nerst equation, what would be the effect on voltage of increasing the...
Homework Answers
As the nerst equation, the temperature is directly proportional to the voltage, thus on increasing the temperature, the voltage will also increase
Add Answer to:
looking at the generalized nerst equation, what would be the
effect on voltage of increasing the...
a. what effect would have the blockade of voltage gated Na+ channels? b. what effect would...
a. what effect would have the blockade of voltage gated Na+ channels? b. what effect would have the opening of chemically-gated Cl- channels? c. what effect does voltage and chemically gated have in common? d. what final effect do you expect to see when either local or general anesthetics are administered?
What would be the effect of raising the temperature or increasing the carrier gas flow rate...
What would be the effect of raising the temperature or increasing the carrier gas flow rate one the ability to resolve two closely spaced peaks?(experiment : The dilute sulfuric acid-catalyzed dehydration on 2-methyl-2-butanol(t-amylalcohol) proceeds readily to give a mixture of alkenes that can be analyzed by gas chromatography)
1. a) State the diode equation and explain the significance of each term. b) Sketch the current - voltage characteristics for a typical silicon diode over the 4 voltage range -2 V to +2 V. Explai...
1. a) State the diode equation and explain the significance of each term. b) Sketch the current - voltage characteristics for a typical silicon diode over the 4 voltage range -2 V to +2 V. Explain how the characteristics would change if the diode was fabricated using germanium. Give an equivalent circuit representation of the device in each case. c) In a silicon diode a current of 200 HA flows when a forward bias voltage of 0.5 V4 is applied...
What would be the effect of increasing the temperature on each of the following systems at...
What would be the effect of increasing the temperature on each of the following systems at equilibrium? H2(g) + I2(g) ⇄ 2HI(g) + Δ PCl5(g) + Δ ⇄ PCl3(g) + Cl2(g) 2SO2(g) + O2(g) ⇄ 2SO3(g); ΔH°=-198kJ 2NOCl(g) ⇄ 2NO(g) + Cl2(g); ΔH°=75kJ C(s) + H2O(g) + Δ ⇄ CO(g) + H2(g)
Increasing the kVp by 15% would have the same effect on IR exposure as what mAs...
Increasing the kVp by 15% would have the same effect on IR exposure as what mAs increase?
What effect would increasing oxytocin release have on the intensity of a person's orgasm? Select one:...
What effect would increasing oxytocin release have on the intensity of a person's orgasm? Select one: a. It would decrease the intensity b. It would increase the intensity c. It would have no effect; oxytocin affects muscle contractions and attachment, not the sexual response
Consider the following reaction at equilibrium. What effect will increasing the temperature have on the system?...
Consider the following reaction at equilibrium. What effect will increasing the temperature have on the system? C3H8(g) + 5O2(g) 3CO2(g) + 4H2O(l) ΔrH° = -2220 kJ
List the two methods of increasing the Vt in pressure control ventilation. What effect does hyperventilation...
List the two methods of increasing the Vt in pressure control ventilation. What effect does hyperventilation have on cerebral blood flow?
4. What is the effect of increasing external C’s on amplifier BW? 5. What would happen...
4. What is the effect of increasing external C’s on amplifier BW? 5. What would happen if external C’s are decreased?
36. Indicate what is the effect of 1) increasing chlorides, 2) increasing Cr in the alloy. Do thi...
36. Indicate what is the effect of 1) increasing chlorides, 2) increasing Cr in the alloy. Do this by drawing arrows and clearly labeling each of these two effects. Current Density 37. Describe the limitations of using a corrosion resistant aluminum alloy in marine service 8. Calculate the PREN for an alloy with the following composition Cr-27.0, Ni-2.0, Mo 4.1,Mn-0.4 N-0.035. Would it be safe to use this alloy in seawater? 39. In certain stagnant situations, where oxygen concentration should...
1. a) State the diode equation and explain the significance of each term. b) Sketch the current - voltage characteristics for a typical silicon diode over the 4 voltage range -2 V to +2 V. Explain how the characteristics would change if the diode was fabricated using germanium. Give an equivalent circuit representation of the device in each case. c) In a silicon diode a current of 200 HA flows when a forward bias voltage of 0.5 V4 is applied...
List the two methods of increasing the Vt in pressure control ventilation. What effect does hyperventilation have on cerebral blood flow?
36. Indicate what is the effect of 1) increasing chlorides, 2) increasing Cr in the alloy. Do this by drawing arrows and clearly labeling each of these two effects. Current Density 37. Describe the limitations of using a corrosion resistant aluminum alloy in marine service 8. Calculate the PREN for an alloy with the following composition Cr-27.0, Ni-2.0, Mo 4.1,Mn-0.4 N-0.035. Would it be safe to use this alloy in seawater? 39. In certain stagnant situations, where oxygen concentration should...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 37 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago