Diffusion is when molecules move from an area of high concentration to low concentration. True or...
Diffusion is when molecules move from an area of high concentration to low concentration. True or False
Homework Answers
Answer----- TRUE
The movement of particles by diffusion is always from a higher to a lower concentration .
Add Answer to:
Diffusion is when molecules move from an area of high
concentration to low concentration. True or...
When testing the effect of molecular weight on diffusion, the hydrochloric acid and ammonia molecules were...
When testing the effect of molecular weight on diffusion, the hydrochloric acid and ammonia molecules were placed at different ends of a sealed tube. The ammonium chloride that formed when the molecules diffused towards each other and met was closer to the ammonia end of the tube. TRUE OR FALSE? Diffusion continues to occur until there is an equal concentration of particles on both sides of a semi-permeable membrane. TRUE OR FALSE? Diffusion is the spontaneous net movement of particles...
3. True/False. If False, correct the underlined word. [4pts] Capillary Action is the diffusion of water...
3. True/False. If False, correct the underlined word. [4pts] Capillary Action is the diffusion of water through a semipermeable membrane from a high water concentration to a low water concentration. a) b) Cohesion is a property of water. It occurs when water molecules bind to other water molecules forming Hydrogen bonds
The passive movement of ions or molecules from a point of high concentration to a point...
The passive movement of ions or molecules from a point of high concentration to a point of low concentration is known as: solubility. active transport. diffusion. endocytosis.
A concentration gradient affects the direction that solutes diffusion. Describe how molecules move with respect to...
A concentration gradient affects the direction that solutes diffusion. Describe how molecules move with respect to the concentration. How does size affect the rate of diffusion? Does polarity affect the rate of diffusion? Explain your answer. If a piece of celery is placed in a glass of pure water, are the celery cells hypertonic, hypotonic or isotonic compared to the water? In which direction will water move? What is the water potential of pure water? Why don’t red blood cells...
4. Diffusion always causes particles to move from a region of to a region of _...
4. Diffusion always causes particles to move from a region of to a region of _ concentration concentration 5. Does a cell use energy when molecules diffuse in or out of the cell? Why?
Transporters move molecules against their concentration gradient by: A. Facilitating passive diffusion. B. Using the energy...
Transporters move molecules against their concentration gradient by: A. Facilitating passive diffusion. B. Using the energy of ATP hydrolysis. C. Coupling to the concentration gradient of another molecule. D. A and B E. B and C F. A and C G. None of the above. H. All of the above
Pre-Lab Questions A concentration gradient affects the direction that solutes diffusion. Describe how molecules move with...
Pre-Lab Questions A concentration gradient affects the direction that solutes diffusion. Describe how molecules move with respect to the concentration. How does size affect the rate of diffusion? Does polarity affect the rate of diffusion? Explain your answer. If a piece of celery is placed in a glass of pure water, are the celery cells hypertonic, hypotonic or isotonic compared to the water? In which direction will water move? What is the water potential of pure water? Why don’t red...
How are facilitated diffusion and diffusion similar? Both processes involve the movement of solute from an...
How are facilitated diffusion and diffusion similar?
Both processes involve the movement of solute from an area of
low concentration to an area of high concentration.
Both processes involve the movement of solute from an area of
high concentration to an area of low concentration.
In both kinds of movement across a cell membrane, proteins do
not play a role in assisting the passage of compounds and ions
through a membrane.
In both kinds of movement across a cell membrane,...
Which statements are false about facilitated diffusion. Select all that apply! a. molecules or ions are transported with the...
Which statements are false about facilitated diffusion. Select all that apply! a. molecules or ions are transported with the help of a protein b. atp energy is required to move the molecules or ions down their concentration gradient. c. the molecules or ions move down their concentration gradient. d. the molecules move against their concentration gradient.
7. Which of the following is involved in the synthesis and packaging of certain molecules produced...
7. Which of the following is involved in the synthesis and packaging of certain molecules produced for secretion by a cell? A. cell granule B. Golgi apparatus C. flagella D. nucleolus 8. Which of the following organelles contains a green-colored pigment? Alysosome B. mitochondria C. chloroplast D. leucoplastosome 9. Eukaryotic cells are found in the group known as the A. fungi. B. plants. C. animals D. All of these answers are true. 10. An outside source of energy (ATP) is...
3. True/False. If False, correct the underlined word. [4pts] Capillary Action is the diffusion of water through a semipermeable membrane from a high water concentration to a low water concentration. a) b) Cohesion is a property of water. It occurs when water molecules bind to other water molecules forming Hydrogen bonds
4. Diffusion always causes particles to move from a region of to a region of _ concentration concentration 5. Does a cell use energy when molecules diffuse in or out of the cell? Why?
How are facilitated diffusion and diffusion similar?
Both processes involve the movement of solute from an area of
low concentration to an area of high concentration.
Both processes involve the movement of solute from an area of
high concentration to an area of low concentration.
In both kinds of movement across a cell membrane, proteins do
not play a role in assisting the passage of compounds and ions
through a membrane.
In both kinds of movement across a cell membrane,...
7. Which of the following is involved in the synthesis and packaging of certain molecules produced for secretion by a cell? A. cell granule B. Golgi apparatus C. flagella D. nucleolus 8. Which of the following organelles contains a green-colored pigment? Alysosome B. mitochondria C. chloroplast D. leucoplastosome 9. Eukaryotic cells are found in the group known as the A. fungi. B. plants. C. animals D. All of these answers are true. 10. An outside source of energy (ATP) is...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 30 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago