The balanced equation P4 (s) + 6H2 (g) --> 4PH3 tells us that 2 mol H2 a
a. reacts with 1 mol 4
b. produces 4 mol PH3
c. cannot react with phosphorus
d. produces 2 mol PH3
e. reacts with 2 mol P4
idk y i cant seem to get the answer from the choices above?
Homework Answers
Add Answer to:
The balanced equation P4 (s) + 6H2 (g) --> 4PH3 tells us that 2 mol H2
a
Question 9 5 pts The reaction: P4 (s) + 6H2(g) — 4PH3 (g) tells us that...
Question 9 5 pts The reaction: P4 (s) + 6H2(g) — 4PH3 (g) tells us that 7.0 moles of H2 reacts with how many moles of Phosphorous, P4? 6.00 O 3.00 1.00 7.00 01.17 Question 10 5 pts
The reaction: P4 (s) + 6H2(g) +4PH3 (g) tells us that 7.0 moles of H2reacts with...
The reaction: P4 (s) + 6H2(g) +4PH3 (g) tells us that 7.0 moles of H2reacts with how many moles of Phosphorous, P4? 1.00 3.00 1.17 6.00 7.00
2. Consider the reaction 4PH3(g) → P4(g) + 6H2(g) Suppose that, at a particular moment during...
2. Consider the reaction 4PH3(g) → P4(g) + 6H2(g) Suppose that, at a particular moment during the reaction, molecular hydrogen is being formed at rate of 0.234 M/s. (a) At what rate is P4 changing? _______ M/s (b) At what rate is PH3 changing? ________ M/sF
2) Consider the reaction 4PH3(g) → P4(g) + 6H2(g) Suppose that, at a particular moment during...
2) Consider the reaction 4PH3(g) → P4(g) + 6H2(g) Suppose that, at a particular moment during the reaction, molecular hydrogen is being formed at rate of 0.227 M/s. (a) At what rate is P4 changing? ______ M/s (b) At what rate is PH3 changing? _______ M/sF 4. Consider the reaction: N2(g) + 3H2(g) → 2NH3(g) Suppose that a particular moment during the reaction, molecular hydrogen is reacting at a rate of −0.0220 M/s. At what rate is ammonia being formed?...
5. Phosphine (PH3) decomposes into phosphorus and molecular hydrogen: 4PH3(9) - P4(9) + 6H2(9) Experiments show...
5. Phosphine (PH3) decomposes into phosphorus and molecular hydrogen: 4PH3(9) - P4(9) + 6H2(9) Experiments show that this is a first-order reaction, with a rate constant of 0.0173 s at 650°C. Identify each of the following statements about this reaction as true or false. (Use the drop-down menu and select "True" or "False" for each. You must get all 4 correct.) The rate constant would be smaller than 0.0173 sat 550°C. The reaction PH3 - PH2 + H might be...
Question 1 P4 (s) + 6 H2(g) → 4 PH3(g) What are the correct mole ratios...
Question 1 P4 (s) + 6 H2(g) → 4 PH3(g) What are the correct mole ratios based on the chemical equation above? BLANK-1 mol P4 : BLANK-2 mol PH3 BLANK-3 mol H2 : BLANK-4 mol PH3 BLANK-5 mol P4: BLANK-6 mol H2 BLANK-1 Add your answer BLANK-2 Add your answer BLANK-3 Add your answer BLANK-4 Add your answer BLANK-5 Add your answer BLANK-6 Add your answer
Given the balanced chemical equation, 2 H(g) → H2(g) ΔH0rxn = −436 kJ/mol Determine the mass...
Given the balanced chemical equation, 2 H(g) → H2(g) ΔH0rxn = −436 kJ/mol Determine the mass (in grams) of H(g) produced when 823 kJ of heat is released.
Equations and Molar Ratios 1. The equation S+O2 SO2 tells us that 1 mole of sulphur...
Equations and Molar Ratios 1. The equation S+O2 SO2 tells us that 1 mole of sulphur reacts with 1 mole of oxygen to give 1 mole of Sulphur Dioxide 02 = so, 1 mole 1 mole 1 mole How many moles of oxygen would react with a) 2 moles of sulphur b) 10 moles of sulphur c) 0.5 moles of sulphur d) 0.15 moles of sulphur How many moles of SO2 would be made by burning e) f) g) h)...
a Consider the balanced chemical equation 4Cr(s) + 302(g) + 2Cr2O3(s) What mole ratio would you...
a Consider the balanced chemical equation 4Cr(s) + 302(g) + 2Cr2O3(s) What mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of chromium metal? 4 mol O2 3 mol Cr 2 mol O2 3 mol Cr 3 mol O2 2 mol Cr 3 mol O2 4 mol Cr b Consider the balanced chemical equation 4Cr(s) + 302 (9) + 2Cr2O3(s) What mole ratio would...
2. In the ICE table below, a balanced chemical equation is shown. Initial amounts are given...
2. In the ICE table below, a balanced chemical equation is shown. Initial amounts are given for the reactants, and a final observed concentration for the product. The volume of the vessel is 1.0 L (a) (0.5 pts) Show by calculation if there is enough Pa s) to permit that amount of the product PH to form, with some P4(s) left over. (Ps has to be present in excess for the equilibirum to be established) (b) (0.5 pts) Complete this...
Question 9 5 pts The reaction: P4 (s) + 6H2(g) — 4PH3 (g) tells us that 7.0 moles of H2 reacts with how many moles of Phosphorous, P4? 6.00 O 3.00 1.00 7.00 01.17 Question 10 5 pts
The reaction: P4 (s) + 6H2(g) +4PH3 (g) tells us that 7.0 moles of H2reacts with how many moles of Phosphorous, P4? 1.00 3.00 1.17 6.00 7.00
5. Phosphine (PH3) decomposes into phosphorus and molecular hydrogen: 4PH3(9) - P4(9) + 6H2(9) Experiments show that this is a first-order reaction, with a rate constant of 0.0173 s at 650°C. Identify each of the following statements about this reaction as true or false. (Use the drop-down menu and select "True" or "False" for each. You must get all 4 correct.) The rate constant would be smaller than 0.0173 sat 550°C. The reaction PH3 - PH2 + H might be...
Question 1 P4 (s) + 6 H2(g) → 4 PH3(g) What are the correct mole ratios based on the chemical equation above? BLANK-1 mol P4 : BLANK-2 mol PH3 BLANK-3 mol H2 : BLANK-4 mol PH3 BLANK-5 mol P4: BLANK-6 mol H2 BLANK-1 Add your answer BLANK-2 Add your answer BLANK-3 Add your answer BLANK-4 Add your answer BLANK-5 Add your answer BLANK-6 Add your answer
Equations and Molar Ratios 1. The equation S+O2 SO2 tells us that 1 mole of sulphur reacts with 1 mole of oxygen to give 1 mole of Sulphur Dioxide 02 = so, 1 mole 1 mole 1 mole How many moles of oxygen would react with a) 2 moles of sulphur b) 10 moles of sulphur c) 0.5 moles of sulphur d) 0.15 moles of sulphur How many moles of SO2 would be made by burning e) f) g) h)...
a Consider the balanced chemical equation 4Cr(s) + 302(g) + 2Cr2O3(s) What mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of chromium metal? 4 mol O2 3 mol Cr 2 mol O2 3 mol Cr 3 mol O2 2 mol Cr 3 mol O2 4 mol Cr b Consider the balanced chemical equation 4Cr(s) + 302 (9) + 2Cr2O3(s) What mole ratio would...
2. In the ICE table below, a balanced chemical equation is shown. Initial amounts are given for the reactants, and a final observed concentration for the product. The volume of the vessel is 1.0 L (a) (0.5 pts) Show by calculation if there is enough Pa s) to permit that amount of the product PH to form, with some P4(s) left over. (Ps has to be present in excess for the equilibirum to be established) (b) (0.5 pts) Complete this...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 minute ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 32 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago