Provide a brief statement to explain why the following
equilibrium favors the enol tautomer. Please further explain the
corrected answer written in red. 
Homework Answers
Add Answer to:
Provide a brief statement to explain why the following equilibrium favors the enol tautomer. Please further explain the corrected answer written in red. 12) Provide a brief statement to explain why t...
Please choose the right answer and explain why: Question 18 0/1 pts Which of the following statements is not true about...
Please choose the right answer and explain why:
Question 18 0/1 pts Which of the following statements is not true about the reaction as written below? C2H4(g) + H2(g) →→ C H (g) Hydrogen is a reactant. C2H4 is a reactant. The reaction is balanced. The reaction is at equilibrium.
12-14 please explain why and what the correct answer is . bond Which of the following...
12-14 please explain why and what the correct answer is
.
bond Which of the following represents the correct ranking of terms from smallest to largest? -.polymer-.monomer→ carbon atom 11. B. Polymer-,m e onomer cule → atom Guanine → polymer E. Carbon atom → monomer → polymer-, macromolecule 12. DNA and RNA are composed of long chains of monomers known as nucleotides. On the guanine molecule shown to the right, which arrow best indicates the5 end of the subunit? A....
i) Please explain dlearly why the following is not possible. There is a circuit with a...
i) Please explain dlearly why the following is not possible. There is a circuit with a 1.5 V battery, 2 resistors (1 12, 112) along with wires and has a total current of 3 A. Please sketch this circuit as well. II) In your house, there are devices/resistors that need to be put in a circuit as you plug and unplug them. And each device requires a certain amount of power as well. So if you add more devices into...
Provide a brief rationale for why ( Please help me answer all questions please this is SO important) When benzoic acid is mixed with inorganic sand, what happens to the melting point of the sa...
Provide a brief rationale for why
( Please help me answer all questions please this is SO
important)
When benzoic acid is mixed with inorganic sand, what happens to the melting point of the sample? 6. a. It increases b. It decreases c. It stays the same. d. It increases above the actual melting point then decreases. e. It goes below the eutectic point 7. In thin-layer chromatography, the observed Rr will change upon changing any of the following parameters...
PLEASE EXPLAIN WHY ANSWER WAS CHOSEN QUESTION 9 Which of the following is not a correct...
PLEASE EXPLAIN WHY ANSWER WAS CHOSEN QUESTION 9 Which of the following is not a correct IPv4 address? a. 110.2.2.1 b. 200.001.256.132 c. 192.32.54.128 d. 240.240.255.1 QUESTION 10 Given the IPv4 address in CIDR notation 215.200.110.50/26, identify the subnet ID it belongs to. a. 215.200.110.0 b. 215.200.110.64 c. 215.200.110.128 d. 215.200.110.192 QUESTION 11 Select the correct statement(s) regarding the Address Resolution Protocol (ARP). a. When an IP datagram is received, ARP initially inspects its cache to see if the IP...
4. Refer to the Case Study below to answer the following: Explain why Ally must provide support services relating only t...
4. Refer to the Case Study below to answer the following: Explain why Ally must provide support services relating only to her specialist field of social work. Case study Ally, the manager of a disability services agency in regional Queensland, is a qualified social worker with 10 years managerial experience. The agency she manages provides accommodation and respite support to adults with disabilities in their own homes, with support provided by paid departmental staff. In a typical household, two to...
Can someone please help me with the following questions. Please provide an answer/explanation especially for the...
Can someone please help me with the following questions. Please provide an answer/explanation especially for the first three. ?. Suppose a population of flour beetles has 1,000 individuals. Normally the beetles are red; however, this population is polymorphic for a mutant autosomal body color, black, designated by bb. Red is dominant to black, so BB and Bb genotypes are red. Assume the population is at Hardy–Weinberg equilibrium, with equal frequencies of the two alleles. What would be the allele frequencies...
Please answer all four of these questions and explain WHY. I don't understand any of this. Thank you! Consider the following reaction: 2 SO2(g)O2(g)2 SO3(g) If 1.55 moles of SO2 and 1.55 moles of...
Please answer all four of
these questions and explain WHY. I don't understand any of this.
Thank you!
Consider the following reaction: 2 SO2(g)O2(g)2 SO3(g) If 1.55 moles of SO2 and 1.55 moles of O2 are added to an empty sealed container: What is the rate of the reverse reaction BEFORE any SO3 has been formed? Greater than zero, and greater than the rate of the forward reaction. What is the rate of the reverse reaction an instant AFTER some...
solve please Project (Individual) Read the following statements (Balance sheet & Income Statement) to answer the...
solve please
Project (Individual) Read the following statements (Balance sheet & Income Statement) to answer the following questions? Consolidated balance sheets of the BASF Group December 31, 2019 14525.00 21792.00 15008.00 636.00 51961.00 11223.00 9093.00 2427.00 15013.00 37756.00 89717.00 December 31, 2018 16554.00 20780.00 15008.00 570.00 52912.00 10166.00 9565.00 2300.00 14607.00 36638.00 89550.00 Assets (Million ) Intangible assets Property plant equipment Fixed Assets Inventories Accounts receivable, Cash short-term investments Current assets Total assets Equity and liabilities (Million €) Preferred Stocks...
Please choose the right answer and explain why:
Question 18 0/1 pts Which of the following statements is not true about the reaction as written below? C2H4(g) + H2(g) →→ C H (g) Hydrogen is a reactant. C2H4 is a reactant. The reaction is balanced. The reaction is at equilibrium.
12-14 please explain why and what the correct answer is
.
bond Which of the following represents the correct ranking of terms from smallest to largest? -.polymer-.monomer→ carbon atom 11. B. Polymer-,m e onomer cule → atom Guanine → polymer E. Carbon atom → monomer → polymer-, macromolecule 12. DNA and RNA are composed of long chains of monomers known as nucleotides. On the guanine molecule shown to the right, which arrow best indicates the5 end of the subunit? A....
i) Please explain dlearly why the following is not possible. There is a circuit with a 1.5 V battery, 2 resistors (1 12, 112) along with wires and has a total current of 3 A. Please sketch this circuit as well. II) In your house, there are devices/resistors that need to be put in a circuit as you plug and unplug them. And each device requires a certain amount of power as well. So if you add more devices into...
Provide a brief rationale for why
( Please help me answer all questions please this is SO
important)
When benzoic acid is mixed with inorganic sand, what happens to the melting point of the sample? 6. a. It increases b. It decreases c. It stays the same. d. It increases above the actual melting point then decreases. e. It goes below the eutectic point 7. In thin-layer chromatography, the observed Rr will change upon changing any of the following parameters...
Please answer all four of
these questions and explain WHY. I don't understand any of this.
Thank you!
Consider the following reaction: 2 SO2(g)O2(g)2 SO3(g) If 1.55 moles of SO2 and 1.55 moles of O2 are added to an empty sealed container: What is the rate of the reverse reaction BEFORE any SO3 has been formed? Greater than zero, and greater than the rate of the forward reaction. What is the rate of the reverse reaction an instant AFTER some...
solve please
Project (Individual) Read the following statements (Balance sheet & Income Statement) to answer the following questions? Consolidated balance sheets of the BASF Group December 31, 2019 14525.00 21792.00 15008.00 636.00 51961.00 11223.00 9093.00 2427.00 15013.00 37756.00 89717.00 December 31, 2018 16554.00 20780.00 15008.00 570.00 52912.00 10166.00 9565.00 2300.00 14607.00 36638.00 89550.00 Assets (Million ) Intangible assets Property plant equipment Fixed Assets Inventories Accounts receivable, Cash short-term investments Current assets Total assets Equity and liabilities (Million €) Preferred Stocks...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 26 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 57 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago