Homework Answers
Add Answer to:
8. The reaction of bromide 1 may proceed via an Sp2 mechanism. For this Sn2 mechanism, you may assume that the final de...
Questions 2-10 please!! 1) A substitution reaction is: [2] a) A reaction during which an OH...
Questions 2-10 please!!
1) A substitution reaction is: [2] a) A reaction during which an OH group of a molecule is replaced by a halogen. b) A reaction during which water is the leaving group. c) A reaction during which a functional group of a molecule is replaced by an electrophile. d) A reaction during which a functional group of a molecule is replaced by another functional group. V 12 2) Substitution reactions are classified either as electrophilic or nucleophilic...
explain whether the reaction would more likely proceed via Sn1 or Sn2 mechanism (consider both) H2SO4...
explain whether the reaction would more likely proceed via Sn1
or Sn2 mechanism (consider both)
H2SO4 H2O
1. Predict whether the following reactions are likely to proceed by an E1 or E2 mechanism....
1. Predict whether the following reactions are likely to proceed
by an E1 or E2 mechanism. PLEASE show the mechanism and product of
the reaction!!!!
2. Explain each prediction.
Predicting mechanisms: E1 or E2? 1. Predict whether the following reactions are likely to proceed by an El or E2 mechanism. 2. Explain each prediction. Br co KOH H2O Br CH,CH,OH Br CH2CH OH CH,0/CH,OH Br
1.1 In which of the following solvents would the reaction of 1-bromobutane with sodium azide,NaN3, proceed...
1.1 In which of the following solvents would the reaction of
1-bromobutane with sodium azide,NaN3, proceed the fastest?
a.aceticacid
b.ethanol
c.water
d.acetonitrile
1.2 Which of the following solvents is the best choice for the
reaction of 1-chlorohexane with sodium bromide?
a.dimethylsulfoxide
b.water
c.hexane
d.toluene,PhCH3
1.3 Which of the following is most likely to undergo
rearrangement during reaction with methanol?
1.4 Name which energy diagrams represents the course of an
exothermic SN1, SN2,E1, or E2 reaction?
1.5 Which of the following...
Consider the SN2 reaction of butyl bromide with hydroxide ion , Assuming no other changes, what...
Consider the SN2 reaction of butyl bromide with hydroxide ion , Assuming no other changes, what effect on the reaction rate would result from simultaneously doubling the concentrations of both butyl bromide and hydroxyl ion No effect (B)It would double the rate (C)it would increase the rate six times (D) It would increase the rate four times. 2. Which alky halide would you expect to undergo SN1 hydrolysis most rapidly? (A) (CH3)3C-I (B) (CH3)3C-Br (C) (CH3)3C-Cl (D) (CH3)3C-F 3....
for possible organic products from the following reaction via sn1 and sn2 mechanism select the one...
for possible organic products from the following reaction via
sn1 and sn2 mechanism select the one with the lowest heat of
combustion
QUESTION 11 11) For possible organic products from the following reaction via Sul or S 2 mechanism (both a possible): select the one with LOWEST Heat of Combustion: or organic + CH2OH → product + HBr D. CHO* -- or to werden med barn when we OCH3 .CH OH CH3 H2C are
30. Late papers not accepted. Work Independently. 1. Predict the most likely reaction mechanism (SN1, SN2,...
30. Late papers not accepted. Work Independently. 1. Predict the most likely reaction mechanism (SN1, SN2, E1, E2) and draw all products. CH₂ Na O=CH₂ Hic Br 2 Draw complete mechanism with arrows for the SNI/E1 mechanism. Check for carbocation rearrangements CH3 + H2O 3. Which is the major product for the following reaction? Y CH + NaOH CH HO HO H₃ CH₂ H₃ HOCH CH₂ H₃ CHE CH₂ CH₂ CH3 CH 4. Name the following including the R/S, E/Z...
7) Give the mechanism including the transition state. сн.ct çı SN2 НН 8) Give the mechanism....
7) Give the mechanism including the transition state. сн.ct çı SN2 НН 8) Give the mechanism. CH1 보 SN1 CHCH,CH-C CH. но H Br 9) Give the mechanism of the reaction shown below. CH CI E1 CH,OH 10) When 1-bromo-2,2-dimethylcyclopentane is heated in ethanol, one of the products which results is shown below. Provide a detailed, stepwise mechanism for the production of this compound, and give the name of the mechanism by which it is produced. CH3 CH3
1. indicate whether the following reactions will proceed via an Sni, Sn2, E1 or 2 mechanism....
1. indicate whether the following reactions will proceed via an Sni, Sn2, E1 or 2 mechanism. 2 NISCH reaction type SN NaOCH.CH reaction type 2 2. Briefly explain your answer to question 1b 3. Provide the missing starting material(s), reactant(s) or product(s) as necessary for the following reactions. DBN (a bulky base) Br NaBr B) heat 4. For the following reaction, draw the MAJOR and the MINOR products formed. Label the type of reaction the produced the product below it...
Experiment 14 SN2: Synthesis of 1-Bromobutane Alkyl halides can be prepared from their corresponding alcohols via...
Experiment 14 SN2: Synthesis of 1-Bromobutane Alkyl halides can be prepared from their corresponding alcohols via an acid catalyzed substitution reaction. The mechanism of these acid catalyzed substitution reactions are labeled as SNI (substitution, nucleophilie, unimolecular) and S2 (substitution, nucleophilie, bimolecular). Tertiary alcohols follow the Syl route, primary alcohols follow the S2, route and secondary alcohols can follow either path. Sth CyHe 81 CH? Br-CH e-OH- -C-OH OH Figure / Conversion of 1-butanol into 1-bromobutane by an Sp2 mechanism The...
Questions 2-10 please!!
1) A substitution reaction is: [2] a) A reaction during which an OH group of a molecule is replaced by a halogen. b) A reaction during which water is the leaving group. c) A reaction during which a functional group of a molecule is replaced by an electrophile. d) A reaction during which a functional group of a molecule is replaced by another functional group. V 12 2) Substitution reactions are classified either as electrophilic or nucleophilic...
explain whether the reaction would more likely proceed via Sn1
or Sn2 mechanism (consider both)
H2SO4 H2O
1. Predict whether the following reactions are likely to proceed
by an E1 or E2 mechanism. PLEASE show the mechanism and product of
the reaction!!!!
2. Explain each prediction.
Predicting mechanisms: E1 or E2? 1. Predict whether the following reactions are likely to proceed by an El or E2 mechanism. 2. Explain each prediction. Br co KOH H2O Br CH,CH,OH Br CH2CH OH CH,0/CH,OH Br
1.1 In which of the following solvents would the reaction of
1-bromobutane with sodium azide,NaN3, proceed the fastest?
a.aceticacid
b.ethanol
c.water
d.acetonitrile
1.2 Which of the following solvents is the best choice for the
reaction of 1-chlorohexane with sodium bromide?
a.dimethylsulfoxide
b.water
c.hexane
d.toluene,PhCH3
1.3 Which of the following is most likely to undergo
rearrangement during reaction with methanol?
1.4 Name which energy diagrams represents the course of an
exothermic SN1, SN2,E1, or E2 reaction?
1.5 Which of the following...
for possible organic products from the following reaction via
sn1 and sn2 mechanism select the one with the lowest heat of
combustion
QUESTION 11 11) For possible organic products from the following reaction via Sul or S 2 mechanism (both a possible): select the one with LOWEST Heat of Combustion: or organic + CH2OH → product + HBr D. CHO* -- or to werden med barn when we OCH3 .CH OH CH3 H2C are
30. Late papers not accepted. Work Independently. 1. Predict the most likely reaction mechanism (SN1, SN2, E1, E2) and draw all products. CH₂ Na O=CH₂ Hic Br 2 Draw complete mechanism with arrows for the SNI/E1 mechanism. Check for carbocation rearrangements CH3 + H2O 3. Which is the major product for the following reaction? Y CH + NaOH CH HO HO H₃ CH₂ H₃ HOCH CH₂ H₃ CHE CH₂ CH₂ CH3 CH 4. Name the following including the R/S, E/Z...
7) Give the mechanism including the transition state. сн.ct çı SN2 НН 8) Give the mechanism. CH1 보 SN1 CHCH,CH-C CH. но H Br 9) Give the mechanism of the reaction shown below. CH CI E1 CH,OH 10) When 1-bromo-2,2-dimethylcyclopentane is heated in ethanol, one of the products which results is shown below. Provide a detailed, stepwise mechanism for the production of this compound, and give the name of the mechanism by which it is produced. CH3 CH3
1. indicate whether the following reactions will proceed via an Sni, Sn2, E1 or 2 mechanism. 2 NISCH reaction type SN NaOCH.CH reaction type 2 2. Briefly explain your answer to question 1b 3. Provide the missing starting material(s), reactant(s) or product(s) as necessary for the following reactions. DBN (a bulky base) Br NaBr B) heat 4. For the following reaction, draw the MAJOR and the MINOR products formed. Label the type of reaction the produced the product below it...
Experiment 14 SN2: Synthesis of 1-Bromobutane Alkyl halides can be prepared from their corresponding alcohols via an acid catalyzed substitution reaction. The mechanism of these acid catalyzed substitution reactions are labeled as SNI (substitution, nucleophilie, unimolecular) and S2 (substitution, nucleophilie, bimolecular). Tertiary alcohols follow the Syl route, primary alcohols follow the S2, route and secondary alcohols can follow either path. Sth CyHe 81 CH? Br-CH e-OH- -C-OH OH Figure / Conversion of 1-butanol into 1-bromobutane by an Sp2 mechanism The...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 minute ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 50 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago