20. (10 points) Name or draw a structure for each of the following molecules using IUPAC rules. CH2CH2CH3 HỌC=CHC(CH3)2...
Draw a skeletal structure for each of the following molecules. a. CH3CH(CH2CH2CH3)CH2CH3 Edit b. CH3C(CH2CH3)2CH(CH3)CH3 Name each molecule. Draw the conjugate base of each carboxylic acid. Get help answering Molecular Drawing questions. a. 3-methylhexanoic acid Edit Get help answering Molecular Drawing questions. b. formic acid Edit Get help answering Molecular Drawing questions. c. 3,5-dibromobenzoic acid Edit
2. Draw structure (or) name the molecules according to IUPAC rules. (10 pt) i. 2,6-dimethyl-5-propyloctane Name the following compounds according to IUPAC nomenclature. ii. E: CH.CH C(CH3) 3. Give five different structures of CH3 alkyl groups, and identify the carbon at the point of attachment as primary, secondary or tertiary as appropriate. (10 pt)
Name these compounds using IUPAC rules. Name these compounds using IUPAC rules. (20 points; 5 each) LOH
ease name or draw the correct structure for the following molecules using IUPAC rules. i) (R)-6-ethyl-6-methyl-2,4-cyclohexadienone Pl
Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....
1. Name these compounds using IUPAC rules. (20 points; 5 each) COCH3
Question 12 What is the correct IUPAC name for the following alkene? CH3 CHỊCH,CHC=CH, CH2CH3 a. 2-ethyl-3-methylhex-2-ene b. octene c. 3-isobutyl)but-3-ene d. 3-methyl-4-ethylpent-4-ene e. 4-ethyl-3-methylpent-4-ene f. 2-ethyl-3-methylpent-1-ene Gg. 2-(sec-butyl)but-1-ene A Moving to another question will save this response.
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
[References] Give the IUPAC name for each of the following alkanes. wH3c.성3년, 생생대 CH3 H (6) Học–– 8-CCH, CH3 CH3 снэн, H2C-C-C2-CH3 (c) CH2 CH3 (a) Học- BB - CH,