Homework Answers
| Complex | No.of ligands | coordination no. | Oxidation no. | Geometry | structure |
| 1 | 6 | 6 |
3 |
octahedral | octahedral |
| 2 | 6 | 6 | 3 | octahedral | octahedral |
| 3 | 6 | 6 | 2 | octahedral | octahedral |
| 4 | 4 | 4 | 2 | Tetrahedral | Tetrahedral |
| 5 | 4 | 4 | 2 | square planar | square planar |
3)Bond angles for
Linear----180°. Tetrahedral----109°28'
Square planar----90°. Octahedral-----90° and 180°
4) Formula------. [ W(H2O)4F2]+1
5) Formula-------[ Cu( en)(H2O)2]+2
5
Add Answer to:
Complex # of Coordination number Oxidation number Complex Structure ligands geometry NH4Co(NCS)(py): [RhBr(CO)s(NO...
2. (3 points) In lab, you will form complexes using different ligands. Use your lab manual to identify and draw the str...
2. (3 points) In lab, you will form complexes using different ligands. Use your lab manual to identify and draw the structural formula (lewis formula) for the following: a. A charged monodentate ligand (answer cannot be a halide ion) b. A polydentate ligand c. The CO ligand, not used in the laboratory. Is it likely CO can form a coordinate covalent bond from more than one atom? Explain. NC CN Ni Geometry of Coordination Compounds A compounds geometry (i.e., how...
The number of bonds between a metal ion and its ligands is can the complex ion....
The number of bonds between a metal ion and its ligands is can the complex ion. If four monodentate ligands na metal ion and its ligands is called the coordination number of coordination number in the complex ion is four. SIX four monodentate ligands or two bidentate ligands bond to a metal ion, the ethylenediamine molecules, or two diethylenetriamine molecules bonded oer in the complex ion is four. Six water molecules, or six cyanide ions, or three torm a complex...
For each of the following metal complexes, specify the number of ligands, the coordination number of...
For each of the following metal complexes, specify the number of ligands, the coordination number of the metal, the oxidation number of the metal, the geometry of the complex and draw the structure. Transition metal complexes with four ligands usually form tetrahedral structures unless the metal has a d8 configuration, in which case it can form either tetrahedral or square planar structures. NH4[Co(NCS)4(py)2] [RhBr(CO)5](NO3)2 K4[Fe(CN)6] [HgI4]2- [Cu(NH3)4]Cl2
i can't solve this question of coordination chemistry, could someone hlep me please Exercise 1: 1. What kind(s) o...
i
can't solve this question of coordination chemistry, could someone
hlep me please
Exercise 1: 1. What kind(s) of interaction between the ligand and the metal ion is(are) considered in the crystal field approach? 2. Give and justify the degeneracy lifting for a tetrahedral complex. Would it be the same for an octahedral complex? 3. Let us consider hexaaquacopper(II) ion. Justify the elongation of two opposite Cu-O bonds (along z for example) compared to the other four Cu-O bonds using...
What is the coordination number for each of the following complexes or compounds? [Co(NH3)4Cl2]+ [Ca(EDTA)]2− [Pt(NH3)4]2+...
What is the coordination number for each of the following
complexes or compounds?
[Co(NH3)4Cl2]+
[Ca(EDTA)]2−
[Pt(NH3)4]2+
Na[Ag(CN)2]
Enter the coordination numbers, in the order that the complexes
are listed, as four integers separated by commas (e.g.,
1,2,3,4).
What is the charge on each of the following complex ions?
hexaaquairon(II), [Fe(H2O)6]?
tris(carbonato)aluminate(III), [Al(CO3)3]?
amminepentachloroplatinate(IV), [Pt(NH3)Cl5]?
Express the charges numerically, in the order that the complexes
are listed, separated by commas. For a nonzero charge, be sure to
include the sign (e.g.,...
please I need help with this Х Lab 11.pdf Lab 11.pdf INTRODUCTION The chemical and physical...
please I need help with this
Х Lab 11.pdf Lab 11.pdf INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements, are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances Results of...
please I need help with the data sheet INTRODUCTION The chemical and physical properties of substances...
please I need help with the data sheet
INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances. Results of these measurements generally...
Can't figure out the concentration of the complex of solns. 10, 11, 12, 13, & 14. Modern...
Can't figure out the concentration of the complex of
solns. 10, 11, 12, 13, & 14.
Modern Experimental Chemistry Chemistry 153 The Iron(III) Thiocyanate Complex Purpose of the Experiment To determine the chemical formula of a complex ion and measure its formation equilibrium constant Equipment Spectro Vis spectrophotometer and LabQuest, cuvette, 25-mL buret (3), ring stand, buret clamp (2), 50-mL beaker (3), small plastic beakers Reagents SCN, as KSCN, 0.00200 M solution Fe; as Fe(NO), 0.00200 M solution and a...
Prelab questions 1,2, and 3 and Part E questions Also, write a flowchart of the experiments...
Prelab questions 1,2, and 3 and Part E questions Also, write a flowchart of the experiments process in each part. EXPERIMENT 3 DETERMINATION OF Δo The d orbitals of a metal ion in an octahedral ligand or crystal field are split into a higher energyset (eg) and a lower energy set (t2g) as shown in the following energy level diagram. 11 The energy difference between the upper and lower energy levels is Δo, the octahedral crystal field splitting. The degree...
2. (3 points) In lab, you will form complexes using different ligands. Use your lab manual to identify and draw the structural formula (lewis formula) for the following: a. A charged monodentate ligand (answer cannot be a halide ion) b. A polydentate ligand c. The CO ligand, not used in the laboratory. Is it likely CO can form a coordinate covalent bond from more than one atom? Explain. NC CN Ni Geometry of Coordination Compounds A compounds geometry (i.e., how...
The number of bonds between a metal ion and its ligands is can the complex ion. If four monodentate ligands na metal ion and its ligands is called the coordination number of coordination number in the complex ion is four. SIX four monodentate ligands or two bidentate ligands bond to a metal ion, the ethylenediamine molecules, or two diethylenetriamine molecules bonded oer in the complex ion is four. Six water molecules, or six cyanide ions, or three torm a complex...
i
can't solve this question of coordination chemistry, could someone
hlep me please
Exercise 1: 1. What kind(s) of interaction between the ligand and the metal ion is(are) considered in the crystal field approach? 2. Give and justify the degeneracy lifting for a tetrahedral complex. Would it be the same for an octahedral complex? 3. Let us consider hexaaquacopper(II) ion. Justify the elongation of two opposite Cu-O bonds (along z for example) compared to the other four Cu-O bonds using...
What is the coordination number for each of the following
complexes or compounds?
[Co(NH3)4Cl2]+
[Ca(EDTA)]2−
[Pt(NH3)4]2+
Na[Ag(CN)2]
Enter the coordination numbers, in the order that the complexes
are listed, as four integers separated by commas (e.g.,
1,2,3,4).
What is the charge on each of the following complex ions?
hexaaquairon(II), [Fe(H2O)6]?
tris(carbonato)aluminate(III), [Al(CO3)3]?
amminepentachloroplatinate(IV), [Pt(NH3)Cl5]?
Express the charges numerically, in the order that the complexes
are listed, separated by commas. For a nonzero charge, be sure to
include the sign (e.g.,...
please I need help with this
Х Lab 11.pdf Lab 11.pdf INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements, are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances Results of...
please I need help with the data sheet
INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances. Results of these measurements generally...
Can't figure out the concentration of the complex of
solns. 10, 11, 12, 13, & 14.
Modern Experimental Chemistry Chemistry 153 The Iron(III) Thiocyanate Complex Purpose of the Experiment To determine the chemical formula of a complex ion and measure its formation equilibrium constant Equipment Spectro Vis spectrophotometer and LabQuest, cuvette, 25-mL buret (3), ring stand, buret clamp (2), 50-mL beaker (3), small plastic beakers Reagents SCN, as KSCN, 0.00200 M solution Fe; as Fe(NO), 0.00200 M solution and a...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 27 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago