Homework Answers
Add Answer to:
0.540 Eo cell = 0.956 4) Should the reaction, 2MnO2 (s) + 3CIO (aq) + 2OH; (aq) + 2MnO4 (aq) + 3Cl (aq) + H20 (1...
Consider an electrochemical cell based on the following reaction: Zn(s) + 2H2O(l) + 2OH-(aq) ⇄ [Zn(OH)4]2-(aq)...
Consider an electrochemical cell based on the following reaction: Zn(s) + 2H2O(l) + 2OH-(aq) ⇄ [Zn(OH)4]2-(aq) + H2(g) All dissolved species are at 2.5 x 10-3 M; pressure of H2 is 1 bar (standard state) Use the Nernst equation to calculate E.
Calculate the standard cell potential (Eo) for the reaction X(s)Y (aq)X (aq)Y(s) if K 4.12x10-3 Express...
Calculate the standard cell potential (Eo) for the reaction X(s)Y (aq)X (aq)Y(s) if K 4.12x10-3 Express your answer to three significant figures and include the appropriate units. View Available Hint(s) HA ? Value Units Eo Previous Answers Submit If the equilibrium constant for a two-electron redox reaction at 298 K is 1.4x10-4, calculate the corresponding AG° and Ec under standard Express your answer using two significant figures. cel ΑΣφ conditions. ? AG0 = kJ Request Answer Submit Part B Express...
PLEASE ANSWER ALL 4. The cell potential for the unbalanced chemical reaction: Hg2 2+(aq) + NO3...
PLEASE ANSWER ALL 4. The cell potential for the unbalanced chemical reaction: Hg2 2+(aq) + NO3 - (aq) + H+ (aq) → Hg2+(aq) + HNO2(aq) is measured under standard conditions and found to be + 0.02 V at 25C. a) What substance (not just the element) is oxidized in the cell? b) What substance (not just the element) is reduced in the cell? c) Write the half-reaction that occurs in the anode compartment. d) Write the half-reaction that occurs in...
A galvanic cell is powered by the following redox reaction: 3 Fe'*(aq) + MnO(s) + 4...
A galvanic cell is powered by the following redox reaction: 3 Fe'*(aq) + MnO(s) + 4 OH(aq) → 3 Fe2+ (aq) + Mno (aq) + 2 H,00 Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. Write a balanced equation for the half-reaction that takes place at the cathode. Write a balanced equation for the half-reaction that takes place at the anode. x 5 ? Calculate...
1. A voltaic cell is constructed that is based on the following reaction: Sn2+(aq)+Pb(s)→Sn(s)+Pb2+(aq). A. If...
1. A voltaic cell is constructed that is based on the following reaction: Sn2+(aq)+Pb(s)→Sn(s)+Pb2+(aq). A. If the concentration of Sn2+ in the cathode compartment is 1.30 M and the cell generates an emf of 0.25 V , what is the concentration of Pb2+ in the anode compartment? B. If the anode compartment contains [SO2−4]= 1.30 M in equilibrium with PbSO4(s), what is the Ksp of PbSO4? 2. A voltaic cell utilizes the following reaction: 2Fe3+(aq)+H2(g)→2Fe2+(aq)+2H+(aq). A. What is the emf...
half-reaction standard reduction potential Zn?" (aq)+2e" - Zn(s) Epod= -0.763 V MnO, (aq)+2 H,0(1+3e" - MnO,(s)+4...
half-reaction standard reduction potential Zn?" (aq)+2e" - Zn(s) Epod= -0.763 V MnO, (aq)+2 H,0(1+3e" - MnO,(s)+4 OH (aq). E = +0.59 V Answer the following questions about this cell. Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. X 5 ? Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written Yes Do you have...
help with this one Construct a galvanic cell using the following half-reactions: Cr3+ (aq) + 3e - Cr(s) º = -0.56 V...
help with this one
Construct a galvanic cell using the following half-reactions: Cr3+ (aq) + 3e - Cr(s) º = -0.56 V 2 Hg2+(aq) + 2e - H922+(aq) = 0.92 V 2 Ho2+ The initial concentrations are: [Cr3+] =0.31 M [Hg2+] =2.57 M [Hg22+] =0.49 M (1) What is the potential of this non-standard cell at 298 K? Give your answer to 3 sig. figs. E(V) = Submit Answer Tries 0/2 (ii) How will each of the following changes to...
Chem 1212 Lab Report on electrochemistry Electrochemistry When electrons transfer between reaction components in a redox...
Chem 1212 Lab Report on electrochemistry
Electrochemistry When electrons transfer between reaction components in a redox reaction, we can harness the motion of the electrons to create a potential. Electrochemistry revolves around the separation of the two half-reactions in a redox reaction and establishing two different electrodes. This might involve physically separating the half-reactions or including a separator, such as a semi-permeable membrane or plastic dividers. With the reactions separated, the electrons will need to flow through the wire connecting...
Please show all steps taken (prefer typed solution) Half-Reaction E ° (V) Ag+ (aq) + e−...
Please show all steps taken (prefer typed solution)
Half-Reaction
E
°
(V)
Ag+ (aq) + e− → Ag (s)
0.7996
Al3+ (aq) + 3e− → Al (s)
−1.676
Au+ (aq) + e− → Au (s)
1.692
Au3+ (aq) + 3e− → Au (s)
1.498
Ba2+ (aq) + 2e− → Ba (s)
−2.912
Br2 (l) + 2e− → 2Br− (aq)
1.066
Ca2+ (aq) + 2e− → Ca (s)
−2.868
Cl2 (g) + 2e− → 2Cl− (aq)
1.35827
Co2+ (aq) + 2e−...
Calculate the standard cell potential (Eo) for the reaction X(s)Y (aq)X (aq)Y(s) if K 4.12x10-3 Express your answer to three significant figures and include the appropriate units. View Available Hint(s) HA ? Value Units Eo Previous Answers Submit If the equilibrium constant for a two-electron redox reaction at 298 K is 1.4x10-4, calculate the corresponding AG° and Ec under standard Express your answer using two significant figures. cel ΑΣφ conditions. ? AG0 = kJ Request Answer Submit Part B Express...
A galvanic cell is powered by the following redox reaction: 3 Fe'*(aq) + MnO(s) + 4 OH(aq) → 3 Fe2+ (aq) + Mno (aq) + 2 H,00 Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. Write a balanced equation for the half-reaction that takes place at the cathode. Write a balanced equation for the half-reaction that takes place at the anode. x 5 ? Calculate...
half-reaction standard reduction potential Zn?" (aq)+2e" - Zn(s) Epod= -0.763 V MnO, (aq)+2 H,0(1+3e" - MnO,(s)+4 OH (aq). E = +0.59 V Answer the following questions about this cell. Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. X 5 ? Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written Yes Do you have...
help with this one
Construct a galvanic cell using the following half-reactions: Cr3+ (aq) + 3e - Cr(s) º = -0.56 V 2 Hg2+(aq) + 2e - H922+(aq) = 0.92 V 2 Ho2+ The initial concentrations are: [Cr3+] =0.31 M [Hg2+] =2.57 M [Hg22+] =0.49 M (1) What is the potential of this non-standard cell at 298 K? Give your answer to 3 sig. figs. E(V) = Submit Answer Tries 0/2 (ii) How will each of the following changes to...
Chem 1212 Lab Report on electrochemistry
Electrochemistry When electrons transfer between reaction components in a redox reaction, we can harness the motion of the electrons to create a potential. Electrochemistry revolves around the separation of the two half-reactions in a redox reaction and establishing two different electrodes. This might involve physically separating the half-reactions or including a separator, such as a semi-permeable membrane or plastic dividers. With the reactions separated, the electrons will need to flow through the wire connecting...
Please show all steps taken (prefer typed solution)
Half-Reaction
E
°
(V)
Ag+ (aq) + e− → Ag (s)
0.7996
Al3+ (aq) + 3e− → Al (s)
−1.676
Au+ (aq) + e− → Au (s)
1.692
Au3+ (aq) + 3e− → Au (s)
1.498
Ba2+ (aq) + 2e− → Ba (s)
−2.912
Br2 (l) + 2e− → 2Br− (aq)
1.066
Ca2+ (aq) + 2e− → Ca (s)
−2.868
Cl2 (g) + 2e− → 2Cl− (aq)
1.35827
Co2+ (aq) + 2e−...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 55 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago