Me MC et Me product is double bond IN frans fhic ense
3 -rotate c CH3 ナCH3 H 3 RO CH CHS CH C
Homework Answers
Add Answer to:
Hi. Can someone explain to me what I did wrong ? Is it not the correct...
I already know how to do 1 and 2. if you could show me how to...
I already know how to do 1 and 2. if you could show me how to do
number 3 on the graph above, and how to calculate the expected
energy of the conformer please
1 60 120 180 240 300 360 Torsion angle (degrees) AE (kcal/mol) In the box below each molecule, draw Newman projections for the structures A, B, and C shown from the perspective indicated. For each Newman projection that you've drawn, indicate if there are any eclipsed...
can you make sure i did these correctly 8. (3 pts) Draw the structure of 4,4-diethyl-6-Isopropyinonane....
can you make sure i did these correctly
8. (3 pts) Draw the structure of 4,4-diethyl-6-Isopropyinonane. 9. Draw the following: a. ( pts) Newman projection from the perspective of the arrow. = H tt (H) BO Use alkyl group abbreviations (Me, Etipr, etc. See table given in class on naming!) b. (4 pts) Newman projection from the perspective of the arrow. SH Use alkyl group abbreviations! Te C. (4 pts) The straight-chain drawing of the following Newman projection. Draw out...
Can someone make sure the questions I have answered below are corect. If incomect please give...
Can someone make sure the questions I have answered below are corect. If incomect please give right answer. Thank you in advance. 23) which newman projection corresponds to the compound below as viewed down the indicated bond in the compound below ? CI H CI A) CH3 ACH₃ Br H CH3y CI "Br H3C H Br c) Н. cl CH3 H H CH₃y os cl Br o CH3y TH BICI Catherine Tuner 2020
Hi, Can someone please explain me these questions. Thank you! Consider the wedge-line-dash representation of an...
Hi, Can someone please explain me these questions. Thank
you!
Consider the wedge-line-dash representation of an isomer of 3-methyl-2-phenylpentane shown at right. (We'll call it "Chuck") CH CH Нус" Complete the Newman projection at right of "Chuck" shown above. 2. Draw the wedge-line-dash representation of the most stable conformer of Chuck" at right. 3. Draw the Newman Projection of the most stable conformer of "Chuck" at right. 4.
1. In the structure of the antibiotic Aztreonam illustrated below, how many nitrogen atoms have a...
1. In the structure of the antibiotic Aztreonam illustrated
below, how many nitrogen atoms have a sp2 hybridization
state?
2. What is the number of oxygen atoms on which the negative
charge will resonate by following relevant resonance structures?
(0,1,2,3,4 or 5)
3. Identify the stereochemistry of each of these double bonds
marked 1 and 2 in the structure below ((E) or (Z))
4. What is the absolute configuration of the following molecule?
(R/S)
5. Determine the relationship between these...
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос...
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос B A D What is the major product of the following reaction? Cl2 Н,0 НО СІ. A \ Он С В с D CI CI ОН ОН Ов ОА D с What is the major product of the following reaction? CH3 нс Н сH,CH, NaNH2 DMSO Br А В CH3 CHCH3 9 CH3 с CH,CH H4C. D нс CH2CH3 CH3 "NH, нс Сн HECH...
I did A and D already! Would love if someone showed me E and F because...
I did A and D already! Would love if someone showed me E and F
because those are the two I am really struggling with!
5. Choose four (4) from the following problems, and provide a synthesis from the indicated starting material to the given product. (extra credit WILL NOT be given for doing more). H₃C OCH HOO CH₂ HC HC H 2CH₂ 8-deilhaben OEt OEt d) нс сн, O CH3 HC -CH₃ H2C f) CH3 CH3 .8--lumba - 30...
can someone explain these questions. Also verify if these answers are correct please. 3. What is...
can someone explain these questions. Also verify if these
answers are correct please.
3. What is the major product for the following reaction? 1. CH, MgBr нс 2. H,09 DV 4. What is the major product for the following reaction? CH Họco 1, LDA (1 mol) 2. CHE! HyC HjC CHS HjC CHS HSC CHS Hot Chs Hico Hyd HiC CH₂ HC CH LCH 5. Which of the following compounds is relatively the strongest acid?
can you please explain to me what i am supposed to do here? i do not...
can you please explain to me what i am supposed to do here? i
do not understand.
et + 3 Bra OOH + Soch I CH₃ CH₂ CH₂ SH + NaOH 7. (18 points) Write the organic products for the following reactions: 2. CH₃CHCH₂CH H+ heat CH3
Please help me correct the wrong answer. If you could also tell me what I did...
Please help me correct the wrong answer. If you could
also tell me what I did wrong that would be fantastic, thank
you!
Lopt.) 10/23/2019 7. (15-ptst Propose structures for the following compounds based on the spectral data provided. Please show or explain all work. All IR absorptions above 1500 cm are given. 7a) Molecular formula CiH4O IR peak at 30o0-2850 cm N SP C 1.10 ppm (doublet, 30 integration units) 3.60 ppm (septet, 5 integration units) 1HNMR data: Aa...
I already know how to do 1 and 2. if you could show me how to do
number 3 on the graph above, and how to calculate the expected
energy of the conformer please
1 60 120 180 240 300 360 Torsion angle (degrees) AE (kcal/mol) In the box below each molecule, draw Newman projections for the structures A, B, and C shown from the perspective indicated. For each Newman projection that you've drawn, indicate if there are any eclipsed...
can you make sure i did these correctly
8. (3 pts) Draw the structure of 4,4-diethyl-6-Isopropyinonane. 9. Draw the following: a. ( pts) Newman projection from the perspective of the arrow. = H tt (H) BO Use alkyl group abbreviations (Me, Etipr, etc. See table given in class on naming!) b. (4 pts) Newman projection from the perspective of the arrow. SH Use alkyl group abbreviations! Te C. (4 pts) The straight-chain drawing of the following Newman projection. Draw out...
Can someone make sure the questions I have answered below are corect. If incomect please give right answer. Thank you in advance. 23) which newman projection corresponds to the compound below as viewed down the indicated bond in the compound below ? CI H CI A) CH3 ACH₃ Br H CH3y CI "Br H3C H Br c) Н. cl CH3 H H CH₃y os cl Br o CH3y TH BICI Catherine Tuner 2020
Hi, Can someone please explain me these questions. Thank
you!
Consider the wedge-line-dash representation of an isomer of 3-methyl-2-phenylpentane shown at right. (We'll call it "Chuck") CH CH Нус" Complete the Newman projection at right of "Chuck" shown above. 2. Draw the wedge-line-dash representation of the most stable conformer of Chuck" at right. 3. Draw the Newman Projection of the most stable conformer of "Chuck" at right. 4.
1. In the structure of the antibiotic Aztreonam illustrated
below, how many nitrogen atoms have a sp2 hybridization
state?
2. What is the number of oxygen atoms on which the negative
charge will resonate by following relevant resonance structures?
(0,1,2,3,4 or 5)
3. Identify the stereochemistry of each of these double bonds
marked 1 and 2 in the structure below ((E) or (Z))
4. What is the absolute configuration of the following molecule?
(R/S)
5. Determine the relationship between these...
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос B A D What is the major product of the following reaction? Cl2 Н,0 НО СІ. A \ Он С В с D CI CI ОН ОН Ов ОА D с What is the major product of the following reaction? CH3 нс Н сH,CH, NaNH2 DMSO Br А В CH3 CHCH3 9 CH3 с CH,CH H4C. D нс CH2CH3 CH3 "NH, нс Сн HECH...
I did A and D already! Would love if someone showed me E and F
because those are the two I am really struggling with!
5. Choose four (4) from the following problems, and provide a synthesis from the indicated starting material to the given product. (extra credit WILL NOT be given for doing more). H₃C OCH HOO CH₂ HC HC H 2CH₂ 8-deilhaben OEt OEt d) нс сн, O CH3 HC -CH₃ H2C f) CH3 CH3 .8--lumba - 30...
can someone explain these questions. Also verify if these
answers are correct please.
3. What is the major product for the following reaction? 1. CH, MgBr нс 2. H,09 DV 4. What is the major product for the following reaction? CH Họco 1, LDA (1 mol) 2. CHE! HyC HjC CHS HjC CHS HSC CHS Hot Chs Hico Hyd HiC CH₂ HC CH LCH 5. Which of the following compounds is relatively the strongest acid?
can you please explain to me what i am supposed to do here? i
do not understand.
et + 3 Bra OOH + Soch I CH₃ CH₂ CH₂ SH + NaOH 7. (18 points) Write the organic products for the following reactions: 2. CH₃CHCH₂CH H+ heat CH3
Please help me correct the wrong answer. If you could
also tell me what I did wrong that would be fantastic, thank
you!
Lopt.) 10/23/2019 7. (15-ptst Propose structures for the following compounds based on the spectral data provided. Please show or explain all work. All IR absorptions above 1500 cm are given. 7a) Molecular formula CiH4O IR peak at 30o0-2850 cm N SP C 1.10 ppm (doublet, 30 integration units) 3.60 ppm (septet, 5 integration units) 1HNMR data: Aa...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 51 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago