Homework Answers
5th question solve as 4 th
Add Answer to:
4.) For the combustion of sucrose: C12H22011+ O2 CO2 H20 There are 10.0 g of sucrose...
3.103 When a mixture of 10.0 g acetylene (C, H,) and 10.0 g oxygen (O2) is...
3.103 When a mixture of 10.0 g acetylene (C, H,) and 10.0 g
oxygen (O2) is burned, the resulting combustion reaction produces
CO2 and H2O. a) Write the balanced chemical equation for this
reaction. b) What is the limiting reagent? c) How many grams of
C2H2, O2, CO2 and H, O are present after the reaction is
complete?
3.103 Cuando se quema una mezcla de 10.0 g de acetileno (CH) y 10.0 g oxígeno (O2), la reacción de combustión resultante...
59. Combustion of table sugar produces CO2(g) and H20(). When 1.46 g of table sugar is...
59. Combustion of table sugar produces CO2(g) and H20(). When 1.46 g of table sugar is combusted in a constant- volume (bomb) calorimeter, 24.00 kJ of heat is liberated. a. Assuming that table sugar is pure sucrose [C12H22O11(s)), write the balanced equation for the combustion reaction. b. Calculate AE in kJ/mol C12H22011 for the combus- tion reaction of sucrose.
Consider the combustion of methane: CH4 (g) + 2 02 (g) → CO2 (g) + 2...
Consider the combustion of methane: CH4 (g) + 2 02 (g) → CO2 (g) + 2 H2O (g) If 5.00 g of CH4 burns in the presence of 10.0 g O2, determine the limiting reactant and how many grams of CO2 are produced.
4. 2 NaOH (s) + CO2 (g) → NażCO3 (s) + H20 (1) a. Which reagent...
4. 2 NaOH (s) + CO2 (g) → NażCO3 (s) + H20 (1) a. Which reagent is the limiting reactant when 1.85 mol NaOH and 1.00 mol CO2 are allowed to react? 704 b. How many moles of Na2CO3 can be produced?
Which is the limiting reactant when 5.00 g of H2 and 10.0 g of O2 react...
Which is the limiting reactant when 5.00 g of H2 and 10.0 g of O2 react and form water? How many grams of water are formed and what mass of excess reagent remains?
Consider the combustion reaction of propane: C3H8(g)+ 5 02(g)3 CO2(g) +4 H20(g), where AH= -531 kcal....
Consider the combustion reaction of propane: C3H8(g)+ 5 02(g)3 CO2(g) +4 H20(g), where AH= -531 kcal. If 6.70 x 104 kcal of energy is released in the reaction, how many grams of oxygen were consumed? ed 12.6 g of O2 2.02x 104 g of O2 wer X 63.1g of O2 404 g of O2 Byt Hack
05 - Lab Report 3 Post-Lab Consider the combustion of methane. CH.(g) +20,(9) + CO2(g) +...
05 - Lab Report 3 Post-Lab Consider the combustion of methane. CH.(g) +20,(9) + CO2(g) + 2H2O(g) Suppose 2.8 mol of methane are allowed to react with 3.2 mol of oxygen. Part A What is the limiting reagent? methane oxygen Previous Answers Correct Part B How many moles of CO2 can be made from this reaction? % ALGO ? mol CO2
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowe...
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowed to react with 5.00 g of potassium. (write the chemical reaction first) 7.36 7.38 14.7 4.77 9.53 Question 2 1 pts Carbon dioxide is produced in the following reaction: 5 H2C204(aq) + 2 KMnO4 (aq) + 3 H2SO4 (aq) → 10 CO2(g) + 2 MnSO4 (aq) + K2SO4 (aq) + 8 H20 (1) What is the limiting reagent...
7. A. Balance the following combustion reaction of pentane(CsH12): (16 pts) CsH12 + O2(g) + CO2(g)...
7. A. Balance the following combustion reaction of pentane(CsH12): (16 pts) CsH12 + O2(g) + CO2(g) + H2O(9) B. If I begin with 6.85 grams of pentane how many grams of CO2 will theoretically be produced? C. What would the temperature(K) of CO2 gas be if the amount produced in Part B had a pressure of 1.55 atm. and occupied 27.3 liters?
Balancing Chemical Equations (5.0 pts) 1) CH CH + Ca(OH)2 - CHCI + CaCl + H20...
Balancing Chemical Equations (5.0 pts) 1) CH CH + Ca(OH)2 - CHCI + CaCl + H20 2(NH4)2Cr40. - N2 + Cros + H2O 3) 12HCIO4 + P400 H3PO4 + CIO 4) FeCl3 + AgNO3 - Fe(NO3)2 + Aga 5) FeSO4)3 + BaCl2 - F.Ch + BaSO4 Problem solving: (20.0 pts) 1. Consider the combustion of amyl alcohol, CH,OH. (10.0 pts) 2CSHOH + 150, 1000 + 12H:0 a) How many mol of O, is needed for the combustion of 1.0 mol...
3.103 When a mixture of 10.0 g acetylene (C, H,) and 10.0 g
oxygen (O2) is burned, the resulting combustion reaction produces
CO2 and H2O. a) Write the balanced chemical equation for this
reaction. b) What is the limiting reagent? c) How many grams of
C2H2, O2, CO2 and H, O are present after the reaction is
complete?
3.103 Cuando se quema una mezcla de 10.0 g de acetileno (CH) y 10.0 g oxígeno (O2), la reacción de combustión resultante...
59. Combustion of table sugar produces CO2(g) and H20(). When 1.46 g of table sugar is combusted in a constant- volume (bomb) calorimeter, 24.00 kJ of heat is liberated. a. Assuming that table sugar is pure sucrose [C12H22O11(s)), write the balanced equation for the combustion reaction. b. Calculate AE in kJ/mol C12H22011 for the combus- tion reaction of sucrose.
4. 2 NaOH (s) + CO2 (g) → NażCO3 (s) + H20 (1) a. Which reagent is the limiting reactant when 1.85 mol NaOH and 1.00 mol CO2 are allowed to react? 704 b. How many moles of Na2CO3 can be produced?
Consider the combustion reaction of propane: C3H8(g)+ 5 02(g)3 CO2(g) +4 H20(g), where AH= -531 kcal. If 6.70 x 104 kcal of energy is released in the reaction, how many grams of oxygen were consumed? ed 12.6 g of O2 2.02x 104 g of O2 wer X 63.1g of O2 404 g of O2 Byt Hack
05 - Lab Report 3 Post-Lab Consider the combustion of methane. CH.(g) +20,(9) + CO2(g) + 2H2O(g) Suppose 2.8 mol of methane are allowed to react with 3.2 mol of oxygen. Part A What is the limiting reagent? methane oxygen Previous Answers Correct Part B How many moles of CO2 can be made from this reaction? % ALGO ? mol CO2
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowed to react with 5.00 g of potassium. (write the chemical reaction first) 7.36 7.38 14.7 4.77 9.53 Question 2 1 pts Carbon dioxide is produced in the following reaction: 5 H2C204(aq) + 2 KMnO4 (aq) + 3 H2SO4 (aq) → 10 CO2(g) + 2 MnSO4 (aq) + K2SO4 (aq) + 8 H20 (1) What is the limiting reagent...
7. A. Balance the following combustion reaction of pentane(CsH12): (16 pts) CsH12 + O2(g) + CO2(g) + H2O(9) B. If I begin with 6.85 grams of pentane how many grams of CO2 will theoretically be produced? C. What would the temperature(K) of CO2 gas be if the amount produced in Part B had a pressure of 1.55 atm. and occupied 27.3 liters?
Balancing Chemical Equations (5.0 pts) 1) CH CH + Ca(OH)2 - CHCI + CaCl + H20 2(NH4)2Cr40. - N2 + Cros + H2O 3) 12HCIO4 + P400 H3PO4 + CIO 4) FeCl3 + AgNO3 - Fe(NO3)2 + Aga 5) FeSO4)3 + BaCl2 - F.Ch + BaSO4 Problem solving: (20.0 pts) 1. Consider the combustion of amyl alcohol, CH,OH. (10.0 pts) 2CSHOH + 150, 1000 + 12H:0 a) How many mol of O, is needed for the combustion of 1.0 mol...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 27 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 58 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago