Homework Answers
Add Answer to:
What is d" for each of the following complexes? Number [W(CO)2 5 a) Number Pd(PPha)4 b)...
please explain and show the process. PROBLEM 18.9 What is d" for each of the following...
please explain and show the process.
PROBLEM 18.9 What is d" for each of the following complexes? (a) [W(CO):12- (b) Pd(PPhz)4 (c) PPhz Ph3PP Ph Rh" Ha
, determine the formal oxidation state of the transition metal and the corresponding number of d electrons. State whether each one is likely to be stable enough to be characterized.
Q1) For each of the following compounds, determine the formal oxidation state of the transition metal and the corresponding number of d electrons. State whether each one is likely to be stable enough to be characterized. (1) [Re(CO)5] (2) [HFe(CO)4]- (3) ((ŋ6-C5H5)2Fe) (4) ((ŋ6-C6H6)2Cr) (5) ((ŋ5-C5H5)ZrCl(OCH3) (6) (IrCl(PPh3)3) (7) (Mo(CO)3(PPh3)3) (8) (Fe(CO)4(C2H4)) (9) (W(CO)5Cl)- (10) Ni(CO)4)Q2) Use the 18-electron rule to predict the number of carbonyl ligands, n, in each of the following complexes: (1) [Cr(CO)n] (2) [Fe(CO)n(PPh3)2)] (3) [Mo(CO)n(PMe3)3] ...
4. Give chemical names for the following coordination complexes. a) [Cu(NH3)4]2+ b) [Pt(NH3). Cl]* c) [Mn(CN):)"....
4. Give chemical names for the following coordination complexes. a) [Cu(NH3)4]2+ b) [Pt(NH3). Cl]* c) [Mn(CN):)". d) (Co(en)2(PPha)]PO... e) [Ni(bipy)](NO3)2. 5. Give chemical formulas for the following coordination complexes. a) Triammineaquadichlorocobalt(III) chloride. b) Potassium diaquabis(oxalate)manganate(III). c) Tris(acetylacetonato Jiron(III). d) Tri--carbonylbis(tricarbonyliron(O)). e) Li-oxo-bis(pentaamminechromium(III)). 5. Draw a d-orbital energy-level diagram, and predict the number of unpaired electrons. a) [Fe(CN).] b) [Fe(H20):] c) (CoCil (tetrahedral) 6. Of the two complexes (a) (CoFs] and (b) (Coſen)] + one appears yellow and the other appears...
Draw the structure for each of the following organometallic complexes and show that the complex satisfies...
Draw the structure for each of the following organometallic complexes and show that the complex satisfies the 18-electron rule. a. [( ?6 -C6H6)Mo(CO)3] b. [MnBr(CO)5] c. [RhCl(H)2(?2 -C2H4)(PPh3)2]
What is the coordination number for each of the following complexes or compounds? [Co(NH3)4Cl2]+ [Ca(EDTA)]2− [Pt(NH3)4]2+...
What is the coordination number for each of the following
complexes or compounds?
[Co(NH3)4Cl2]+
[Ca(EDTA)]2−
[Pt(NH3)4]2+
Na[Ag(CN)2]
Enter the coordination numbers, in the order that the complexes
are listed, as four integers separated by commas (e.g.,
1,2,3,4).
What is the charge on each of the following complex ions?
hexaaquairon(II), [Fe(H2O)6]?
tris(carbonato)aluminate(III), [Al(CO3)3]?
amminepentachloroplatinate(IV), [Pt(NH3)Cl5]?
Express the charges numerically, in the order that the complexes
are listed, separated by commas. For a nonzero charge, be sure to
include the sign (e.g.,...
4. Give chemical names for the following coordination complexes a) [Cu(NH3)4]**. b) [P (NH3)3Cs]" c) [Mn(CN)...
4. Give chemical names for the following coordination complexes a) [Cu(NH3)4]**. b) [P (NH3)3Cs]" c) [Mn(CN) . d) (Co(en) (PPha).]PO4 e) [Ni(bipy))(NO3)2. 5. Give chemical formulas for the following coordination complexes. a) Triammineaquadichlorocobalt(III) chloride. b) Potassium diaquabis(oxalate)manganate(lll). c) Tris(acetylacetonato)iron(III). d) Tri--carbonylbis(tricarbonyliron(0)). e) #-oxo-bis(pentaamminechromium(III)).
1. Predict the molecular geometry of the following complexes, and determine whether each will be diamagnetic...
1. Predict the molecular geometry of the following complexes, and determine whether each will be diamagnetic or paramagnetic: (a) [Fe(CN)614- (b) [Fe(C2O4)314- (C) [Zn(NH3)4]2+ (d) [Mo(CO)6] (e) [Rh(NH3)4]+
5. State the number of isomers that exists for the following complexes, name each type of isomer ...
5. State the number of isomers that exists for the following complexes, name each type of isomer and draw the structure of the isomers: (8 points) Number of possible isomers Structure of each type and Name a. [Co(NHa)4Fl b. [Fe(H20)2Cla] c. [Pt(NHs)2Cl2] d. [Fe(CO)s(NH3)3]3
5. State the number of isomers that exists for the following complexes, name each type of isomer and draw the structure of the isomers: (8 points) Number of possible isomers Structure of each type and Name...
1. Consider the following 4-coordinate complexes. For each of these: a. Do you expect the complex...
1. Consider the following 4-coordinate complexes. For each of these: a. Do you expect the complex to be tetrahedral or square planar? Why? b. Draw an electron-orbital occupancy diagram for the d orbitals. c. If the complex is tetrahedral, calculate an LFSE in units of 4. Note that, for tetrahedral complexes, e orbitals are -3/54 relative to the average d-orbital energy, and t, orbitals are +2/54 relative to the average d-orbital energy. Ni(CO). [Rh(PPh.) (CO), [Rec] [PdCl.Bry] 2. Which of...
3. Hydroformylation of alkene is catalyzed by group complexes such A) [COH(CO)) B) [RhH(CO)(PPH3)3] C) [CaH(CO)s]...
3. Hydroformylation of alkene is catalyzed by group complexes such A) [COH(CO)) B) [RhH(CO)(PPH3)3] C) [CaH(CO)s] [AIH(PPh3)7] E) Both a and b can catalyzed hydroformylation. D) 4. Hydroformylation of alkene produce an aldehyde with: A) B) C) D) E) 2 more C atom than the alkene Less 1 C atom than the alkene. 1 more C atom 2 less C atom None of the above is true 5. Methanol converted to acetic acid using: a) Wacker process b) Cativa process...
please explain and show the process.
PROBLEM 18.9 What is d" for each of the following complexes? (a) [W(CO):12- (b) Pd(PPhz)4 (c) PPhz Ph3PP Ph Rh" Ha
4. Give chemical names for the following coordination complexes. a) [Cu(NH3)4]2+ b) [Pt(NH3). Cl]* c) [Mn(CN):)". d) (Co(en)2(PPha)]PO... e) [Ni(bipy)](NO3)2. 5. Give chemical formulas for the following coordination complexes. a) Triammineaquadichlorocobalt(III) chloride. b) Potassium diaquabis(oxalate)manganate(III). c) Tris(acetylacetonato Jiron(III). d) Tri--carbonylbis(tricarbonyliron(O)). e) Li-oxo-bis(pentaamminechromium(III)). 5. Draw a d-orbital energy-level diagram, and predict the number of unpaired electrons. a) [Fe(CN).] b) [Fe(H20):] c) (CoCil (tetrahedral) 6. Of the two complexes (a) (CoFs] and (b) (Coſen)] + one appears yellow and the other appears...
What is the coordination number for each of the following
complexes or compounds?
[Co(NH3)4Cl2]+
[Ca(EDTA)]2−
[Pt(NH3)4]2+
Na[Ag(CN)2]
Enter the coordination numbers, in the order that the complexes
are listed, as four integers separated by commas (e.g.,
1,2,3,4).
What is the charge on each of the following complex ions?
hexaaquairon(II), [Fe(H2O)6]?
tris(carbonato)aluminate(III), [Al(CO3)3]?
amminepentachloroplatinate(IV), [Pt(NH3)Cl5]?
Express the charges numerically, in the order that the complexes
are listed, separated by commas. For a nonzero charge, be sure to
include the sign (e.g.,...
4. Give chemical names for the following coordination complexes a) [Cu(NH3)4]**. b) [P (NH3)3Cs]" c) [Mn(CN) . d) (Co(en) (PPha).]PO4 e) [Ni(bipy))(NO3)2. 5. Give chemical formulas for the following coordination complexes. a) Triammineaquadichlorocobalt(III) chloride. b) Potassium diaquabis(oxalate)manganate(lll). c) Tris(acetylacetonato)iron(III). d) Tri--carbonylbis(tricarbonyliron(0)). e) #-oxo-bis(pentaamminechromium(III)).
1. Predict the molecular geometry of the following complexes, and determine whether each will be diamagnetic or paramagnetic: (a) [Fe(CN)614- (b) [Fe(C2O4)314- (C) [Zn(NH3)4]2+ (d) [Mo(CO)6] (e) [Rh(NH3)4]+
5. State the number of isomers that exists for the following complexes, name each type of isomer and draw the structure of the isomers: (8 points) Number of possible isomers Structure of each type and Name a. [Co(NHa)4Fl b. [Fe(H20)2Cla] c. [Pt(NHs)2Cl2] d. [Fe(CO)s(NH3)3]3
5. State the number of isomers that exists for the following complexes, name each type of isomer and draw the structure of the isomers: (8 points) Number of possible isomers Structure of each type and Name...
1. Consider the following 4-coordinate complexes. For each of these: a. Do you expect the complex to be tetrahedral or square planar? Why? b. Draw an electron-orbital occupancy diagram for the d orbitals. c. If the complex is tetrahedral, calculate an LFSE in units of 4. Note that, for tetrahedral complexes, e orbitals are -3/54 relative to the average d-orbital energy, and t, orbitals are +2/54 relative to the average d-orbital energy. Ni(CO). [Rh(PPh.) (CO), [Rec] [PdCl.Bry] 2. Which of...
3. Hydroformylation of alkene is catalyzed by group complexes such A) [COH(CO)) B) [RhH(CO)(PPH3)3] C) [CaH(CO)s] [AIH(PPh3)7] E) Both a and b can catalyzed hydroformylation. D) 4. Hydroformylation of alkene produce an aldehyde with: A) B) C) D) E) 2 more C atom than the alkene Less 1 C atom than the alkene. 1 more C atom 2 less C atom None of the above is true 5. Methanol converted to acetic acid using: a) Wacker process b) Cativa process...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 25 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 56 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago