What happens when you mix Sodium Bicarbonate, Bromothymol blue, and Calcium Chloride
What is Bromthymol blue used for in this experiment?
Homework Answers
The bromothymol blue reacts with the calcium chloride to form gas (bubbles), as well as create an orange foam. The sodium bicarbonate does not react or ionize.
Add Answer to:
What happens when you mix Sodium Bicarbonate, Bromothymol blue, and Calcium Chloride
Backkground on condensation polymers and what happens (in details) when 1,6-diaminohexane and adipoyl chloride mix.
Backkground on condensation polymers and what happens (in details) when 1,6-diaminohexane and adipoyl chloride mix.
what happens to calcium chloride in a moist environment?
what happens to calcium chloride in a moist environment?
when bromothymol blue was exposed to carbon dioxide what color was the solution? Does this mean...
when bromothymol blue was exposed to carbon dioxide what color was the solution? Does this mean you had an acid or a base? why?
What will be deposited at the cathode when the molten salts Calcium chloride and sodium bromi...
What will be deposited at the cathode when the molten salts Calcium chloride and sodium bromi are present in an electrolytic cell? Ca2+ +2e® +Ca (s) Eºred=-2.868 V Nat+e+Na (s) Eº red= -2.71 V Cl2(g)+ 2e → 2CF E° red= 1.358 V Brz(1) + 2e™ 2Br Eºred= 1.066 V o chlorine obromine O sodium O calcium
What is the percentage yield of calcium carbonate formed when calcium chloride reacts with sodium carbonate?
a
and bQuestion: What is the percentage yield of calcium carbonate formed when calcium chloride reacts with sodium carbonate? PART A: Use the balanced chemical equation below to determine: (a) the limiting reactant (b) theoretical yield (mass) of calcium carbonate \(\underset{\mathrm{m}=3.75 \mathrm{~g}}{\mathrm{Na}_{2} \mathrm{CO}_{3}(\mathrm{qq})}+\underset{\mathrm{m}=4.82 \mathrm{~g}}{\mathrm{CaCl}_{2}(\mathrm{oq})} \rightarrow \underset{\mathrm{m}=?}{\mathrm{CaCO}_{3}(\mathrm{~s})}+2 \mathrm{NaCl}_{(\mathrm{oq})}\)
A solution of 0.5M aluminum chloride and 1M calcium chloride, and WE add sodium phosphate to...
A solution of 0.5M aluminum chloride and 1M calcium chloride, and WE add sodium phosphate to it. The total volume is 2L. How much % is left of the 1st fabric that precipitates when the 2nd fabric just starts to precipitate. How much mass of sodium phosphate should you add so that the 2nd substance is just beginning to precipitate
Sodium oxalate reacts with calcium chloride. What is the sum of the coefficients for the reactants...
Sodium oxalate reacts with calcium chloride. What is the sum of the coefficients for the reactants and products?
What happens when you add chloride to hydrogen and oxygen?
What happens when you add chloride to hydrogen and oxygen?
Sodium bicarbonate reacts with hydrochloric acid in a gas-forming reaction to produce aqueous sodium chloride, water,...
Sodium bicarbonate reacts with hydrochloric acid in a gas-forming reaction to produce aqueous sodium chloride, water, and carbon dioxide gas: NaHCO3(s) + HCl(aq) → NaCl(aq) + H2O(l) + CO2(g) Determine the mass of CO2 gas produced when 8.67 g of NaHCO3 is added to a solution that contains 5.65 g of HCl. ___g?
3. (3 pts) If sodium carbonate is the limiting reagent and calcium chloride is in ex.cess...
3. (3 pts) If sodium carbonate is the limiting reagent and calcium chloride is in ex.cess a. Which ions are present in the supernatant? b. What would happen if you added CaCl to the supernatant? c. What would happen if you added Na CO, to the supernatant? othi wit hipen he ocon ekess 4. (3 pts) If calcium chloride is the limiting reagent and sodium carbonate is in excess: a. Which ions are present in the supernatant? . What would...
What will be deposited at the cathode when the molten salts Calcium chloride and sodium bromi are present in an electrolytic cell? Ca2+ +2e® +Ca (s) Eºred=-2.868 V Nat+e+Na (s) Eº red= -2.71 V Cl2(g)+ 2e → 2CF E° red= 1.358 V Brz(1) + 2e™ 2Br Eºred= 1.066 V o chlorine obromine O sodium O calcium
a
and bQuestion: What is the percentage yield of calcium carbonate formed when calcium chloride reacts with sodium carbonate? PART A: Use the balanced chemical equation below to determine: (a) the limiting reactant (b) theoretical yield (mass) of calcium carbonate \(\underset{\mathrm{m}=3.75 \mathrm{~g}}{\mathrm{Na}_{2} \mathrm{CO}_{3}(\mathrm{qq})}+\underset{\mathrm{m}=4.82 \mathrm{~g}}{\mathrm{CaCl}_{2}(\mathrm{oq})} \rightarrow \underset{\mathrm{m}=?}{\mathrm{CaCO}_{3}(\mathrm{~s})}+2 \mathrm{NaCl}_{(\mathrm{oq})}\)
3. (3 pts) If sodium carbonate is the limiting reagent and calcium chloride is in ex.cess a. Which ions are present in the supernatant? b. What would happen if you added CaCl to the supernatant? c. What would happen if you added Na CO, to the supernatant? othi wit hipen he ocon ekess 4. (3 pts) If calcium chloride is the limiting reagent and sodium carbonate is in excess: a. Which ions are present in the supernatant? . What would...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 38 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago