Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
need help
4. Assume that you have samples of the following two molecules, both with the...
The following questions are based on the molecules below. f- 16) Which molecule has both hydrophilic...
The following questions are based on the molecules below. f- 16) Which molecule has both hydrophilic and hydrophobic properties and would be found in plasma membranes? A) 1 B) 6 C)12 D) 14 E)5 17) Which of the following molecules could be joined together by a peptide bond as a result of a dehydration reaction? A) 2 and 3 B) 12 and 13 C7 and 8 D) 3 and 7 E) 8 and 9 18) Which of the following statements...
I only need answer to 4 4- Which is stronger - the bond between water molecules...
I only need answer to 4
4- Which is stronger - the bond between water molecules or the bond between the two amino acids (formed from the dehydration synthesis above)? Explain why? (2pt) Imagine a biochemistry lab is testing out a new procedure to improve the synthesis of a dipeptide molecule made with the amino acids Valine and Threonine. The hypothesis is that acid as a catalyst will improve the condensation reaction between the amino acids and create a greater...
3. 14 points: Consider the two molecules below: Molecule A Molecule B CH(CH3)2 CH(CH3)2 1 CH...
3. 14 points: Consider the two molecules below: Molecule A Molecule B CH(CH3)2 CH(CH3)2 1 CH I ICH₃ 27 [ 2 CH3 a. Molecules A and B both have three chiral carbons (labeled 1, 2, and 3). How many unique stereoisomers does 1-isopropyl-2,3-dimethylcyclohexane have? b. Molecules A and B are pairs. C. Determine the configuration (R or S) of chiral carbons 1, 2, and 3 for both molecules. Chiral Carbon Molecule A Molecule B d. Draw the two 'chair' conformers...
You are evaluating two similar bonds. Both mature in four years, both have a K1,000 par...
You are evaluating two similar bonds. Both mature in four years, both have a K1,000 par value, and both pay a coupon rate of 10 percent. However, one bond pays that coupon in annual installments, whereas the other makes semiannual payments. Suppose you require a 10 percent return on either bond. Should these bonds sell at identical prices or should one be worth more than the other? What prices do you obtain for these bonds? Can you explain the apparent...
1. You wish to substitute the bromine in the following molecules with a nucleophile. Explain whether...
1. You wish to substitute the bromine in the following molecules with a nucleophile. Explain whether the given molecule would react by the Sn1 and Sn2 mechanism and explain why. 1-methyl-1-bromo-cyclohexane, 1-bromopropane, 2-bromohexane. 1.Why does benzyl bromide react under both Sn1 conditions and Sn2 conditions? 2.Why is bromobenzene nonreactive under both Sn1 and Sn2 conditions? 5. If bromocyclohexane reacts faster than chlorocyclohexane in an Sn2 reaction, what could be the reason? 11. Account for the rapid rate of ethanolysis of...
6) Draw molecules that satisfy the following prompts i- i1i. All molecules must have a minimum...
6) Draw molecules that satisfy the following prompts i- i1i. All molecules must have a minimum of 13 Carbon atoms and exactly 2 heteroatoms (i.e. atoms that are not carbon or hydrogen atoms). You may not use the same molecule twice for any parts of this question. Structures must be drawn using ChemBioDraw. You do not need to look up solubility information, but the answers must be reasonable (supported by the concepts that we have discussed). Also, the structures must...
Organic chemistry lab on Oxidation Puzzle Sample Questions 1. 2. 4. Write a mechanism for the...
Organic chemistry lab on Oxidation Puzzle
Sample Questions 1. 2. 4. Write a mechanism for the reaction of 2-butanol with sodium hypochlorite in an acetic acid solution. Provide two disadvantages associated with using dichromate for the process of oxidation (i.e. justify why you will be using NaOCl instead of dichromate). What is the purpose of adding NaHSO, solution to the reaction? Draw all of the possible products which could form if two equivalents of NaOCI are used in the oxidation...
URGENT I NEED HELP AND I HAVE A DEADLINE. PLEASE AND THANK YOU. 1. Which kind...
URGENT I NEED HELP AND I HAVE A DEADLINE. PLEASE AND THANK YOU. 1. Which kind of pathway describes glycolysis best? a. catabolic and synthetic b. aerobic and catabolic c. glycolytic and aerobic d. anaerobic and catabolic 2. which reaction occurs most often during aerobic cellular respiration? a. condensation b. phosphorylation c. redox d. hydrolysis 3. What is the function of oxygen in oxidative phosphorylation? a. to hydrolyze carbohydrates b. to accept electrons from the reduction of NADP c. to...
. Given the following molecules, answer the given questions: (2 pts Ha Me OMe ??? NO...
. Given the following molecules, answer the given questions: (2 pts Ha Me OMe ??? NO Which molecule will mot undergo any electrophilic substitution reaction? Which molecule will have exclusively one product upon bromination in presence of FeBr? Which molecule has the most acidic proton? Which molecule is most reactive towards any electrophilic aromatic substitution? Which molecule will give a tricarboxylic acid upon reacting with KMnOHSo b. d. 6. Give the reagents for the following reactions, then explain (to yourselt)...
The last two pictures is an example problem to help solve the question The N2Fg molecule...
The last two pictures is an example problem to help solve the
question
The N2Fg molecule could exist as two isomers, both of which are planar. Suppose you cool a sample of N2Fą until you have a liquid. Could you determine which isomer you have simply by collecting the Raman spectrum of the liquid? A simple "Yes" or "No" is not acceptable. You must show all of the work which is necessary to deduce the answer and you must explain...
The following questions are based on the molecules below. f- 16) Which molecule has both hydrophilic and hydrophobic properties and would be found in plasma membranes? A) 1 B) 6 C)12 D) 14 E)5 17) Which of the following molecules could be joined together by a peptide bond as a result of a dehydration reaction? A) 2 and 3 B) 12 and 13 C7 and 8 D) 3 and 7 E) 8 and 9 18) Which of the following statements...
I only need answer to 4
4- Which is stronger - the bond between water molecules or the bond between the two amino acids (formed from the dehydration synthesis above)? Explain why? (2pt) Imagine a biochemistry lab is testing out a new procedure to improve the synthesis of a dipeptide molecule made with the amino acids Valine and Threonine. The hypothesis is that acid as a catalyst will improve the condensation reaction between the amino acids and create a greater...
3. 14 points: Consider the two molecules below: Molecule A Molecule B CH(CH3)2 CH(CH3)2 1 CH I ICH₃ 27 [ 2 CH3 a. Molecules A and B both have three chiral carbons (labeled 1, 2, and 3). How many unique stereoisomers does 1-isopropyl-2,3-dimethylcyclohexane have? b. Molecules A and B are pairs. C. Determine the configuration (R or S) of chiral carbons 1, 2, and 3 for both molecules. Chiral Carbon Molecule A Molecule B d. Draw the two 'chair' conformers...
6) Draw molecules that satisfy the following prompts i- i1i. All molecules must have a minimum of 13 Carbon atoms and exactly 2 heteroatoms (i.e. atoms that are not carbon or hydrogen atoms). You may not use the same molecule twice for any parts of this question. Structures must be drawn using ChemBioDraw. You do not need to look up solubility information, but the answers must be reasonable (supported by the concepts that we have discussed). Also, the structures must...
Organic chemistry lab on Oxidation Puzzle
Sample Questions 1. 2. 4. Write a mechanism for the reaction of 2-butanol with sodium hypochlorite in an acetic acid solution. Provide two disadvantages associated with using dichromate for the process of oxidation (i.e. justify why you will be using NaOCl instead of dichromate). What is the purpose of adding NaHSO, solution to the reaction? Draw all of the possible products which could form if two equivalents of NaOCI are used in the oxidation...
. Given the following molecules, answer the given questions: (2 pts Ha Me OMe ??? NO Which molecule will mot undergo any electrophilic substitution reaction? Which molecule will have exclusively one product upon bromination in presence of FeBr? Which molecule has the most acidic proton? Which molecule is most reactive towards any electrophilic aromatic substitution? Which molecule will give a tricarboxylic acid upon reacting with KMnOHSo b. d. 6. Give the reagents for the following reactions, then explain (to yourselt)...
The last two pictures is an example problem to help solve the
question
The N2Fg molecule could exist as two isomers, both of which are planar. Suppose you cool a sample of N2Fą until you have a liquid. Could you determine which isomer you have simply by collecting the Raman spectrum of the liquid? A simple "Yes" or "No" is not acceptable. You must show all of the work which is necessary to deduce the answer and you must explain...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 2 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 19 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 20 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 34 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago