Suppose that at least 15.4 eV is needed to free an electron from a particular element,...
Suppose that at least 15.4 eV is needed to free an electron from a particular element, i.e., to ionize the atom. What is the lowest frequency photon which can accomplish this? And, what is the corresponding wavelength for that photon? Give frequency for answer 1 and wavelength for answer 2.
Homework Answers
The formula is E = hv
where h = Plancks constant = 6.626*10^-34 J s and v = frequency
E=15.4 ev=15.4*1.6*10^-19=2.464*10^18 j=hv
v=2.464*10^18 /6.63*10^-34=3.71*10^15 Hz
lamda=c/mu=3*10^8/3.71*10^15 =8.07*10^-8 m
Add Answer to:
Suppose that at least 15.4 eV is needed to free an electron from
a particular element,...
Suppose that at least 17.8 eV is needed to free an electron from a particular element,...
Suppose that at least 17.8 eV is needed to free an electron from a particular element, i.e., to ionize the atom. What is the lowest frequency photon which can accomplish this? And, what is the corresponding wavelength for that photon? Give frequency for answer 1 and wavelength for answer 2.
Suppose that at least 14.6 eV is needed to free an electron from a particular element,...
Suppose that at least 14.6 eV is needed to free an electron from a particular element, i.e., to ionize the atom. What is the lowest frequency photon which can accomplish this? And, what is the corresponding wavelength for that photon? Give frequency for answer 1 and wavelength for answer 2. Remember, energy depends upon the frequency of the radiation.
S OMWA S oue was 112 11. Freeing an Electron Suppose that at least 13.1 eV...
S OMWA S oue was 112 11. Freeing an Electron Suppose that at least 13.1 eV is needed to free an electron from a particular element, le, tolonize the atom. What is the lowest frequency photon which can accomplish this? And, what is the corresponding wavelength for that photon? Give frequency for answer and wavelength for answer 2. what is the lowest pie many reason which can accomalet en mand, who Submit Awet Tries 0/20 Post Discussion Send Feedback
A; You are measuring the lattice constant (the distance between planes of atoms) of a sample...
A; You are measuring the lattice constant (the distance between planes of atoms) of a sample crystal using X-ray diffraction. The crystal structure is known to be SC or simple cubic. Your X-ray tube produces X-rays with a wavelength of 0.630 nm. You observe the first diffraction peak at an angle of 28.5°. What is the lattice constant of the crystal? _____??? B: Suppose that at least 21.5 eV is needed to free an electron from a particular element, i.e.,...
An energy of 30.6 eV is needed to remove an electron from the n = 2...
An energy of 30.6 eV is needed to remove an electron from the n = 2 state of a lithium atom. If a single photon accomplishes this task, what wavelength is needed? (h = 6.63 × 10−34 J⋅s, c = 3.00 × 108 m/s, 1 eV = 1.6 × 10−19 J, and 1 nm = 10−9 m)
Calculate the energy of a photon required to excite a hydrogen atom from the n =...
Calculate the energy of a photon required to excite a hydrogen
atom from the n = 1 state to the n = 2 state.
10. [1pt] Calculate the energy of a photon required to excite a hydrogen atom from the - 1 state to the n - 2 state, Answer: Submit All Answers 11. [1pt] An electron in a hydrogen atom falls to an energy level n = 2. If the wavelength of the emitted electromagnetic radiation is 4.86x10m, what...
Question 8 An electron in an atom absorbs a photon with an energy of 3.07 eV and jumps from the n 2 to n = 4 energy lev...
Question 8 An electron in an atom absorbs a photon with an energy of 3.07 eV and jumps from the n 2 to n = 4 energy level in the atom. Tries remaining: Calculate the wavelength of the photon absorbed by the electron. Marked out of 1.00 Answer m Flag question Check Question 9 4 level then jumps down to the n 3 level, emitting a photon with a wavelength of 2.14 um. The electron in the n Tries remaining:...
A particular material has a workfunction of (15.2 + A)/10 eV. Find the maximum wavelength of...
A particular material has a workfunction of (15.2 + A)/10 eV. Find the maximum wavelength of electromagnetic radiation that will result in the emission of photoelectrons from this surface. Give your answer in nanometers (nm) and with 3 significant figures. A: 6 An electron is accelerated from rest by a potential difference of (24.5 + A) V for a distance of (4.50 + B) cm. Determine the de Broglie wavelength of the electron. Give your answer in picometers (pm) and...
The minimum energy needed to eject an electron from an atom is called its ionization energy...
The minimum energy needed to eject an electron from an atom is called its ionization energy I. In atomic physics, I is usually measured in electron-Volts (eV), with 1 eV being the energy needed to move a charge of 1 e across an electrostatic potential difference of 1 V, 1 eV = 1.602 x 10-19 CX1V -1.602 x 10-19 J. For the hydrogen atom | = 13.60 eV. If a photon ejects an electron with kinetic energy 5.0 eV from...
Answers for questions 1-12 please The energy level diagram for a hydrogen atom is shown. The...
Answers for questions 1-12 please
The energy level diagram for a hydrogen atom is shown. The following 000 ev questions are about the energy levels of the hydrogen atom. An0544 ev -1.51 ev 0.850 ev electron jumps from the n 5 level to the n 1 level. 1. Will this result in an emission line, or an absorption line in then-3 n 4 spectrum of this atom? 2. Which excited state did the electron start at? n-2 3.40 ev 2....
Suppose that at least 14.6 eV is needed to free an electron from a particular element, i.e., to ionize the atom. What is the lowest frequency photon which can accomplish this? And, what is the corresponding wavelength for that photon? Give frequency for answer 1 and wavelength for answer 2. Remember, energy depends upon the frequency of the radiation.
S OMWA S oue was 112 11. Freeing an Electron Suppose that at least 13.1 eV is needed to free an electron from a particular element, le, tolonize the atom. What is the lowest frequency photon which can accomplish this? And, what is the corresponding wavelength for that photon? Give frequency for answer and wavelength for answer 2. what is the lowest pie many reason which can accomalet en mand, who Submit Awet Tries 0/20 Post Discussion Send Feedback
Calculate the energy of a photon required to excite a hydrogen
atom from the n = 1 state to the n = 2 state.
10. [1pt] Calculate the energy of a photon required to excite a hydrogen atom from the - 1 state to the n - 2 state, Answer: Submit All Answers 11. [1pt] An electron in a hydrogen atom falls to an energy level n = 2. If the wavelength of the emitted electromagnetic radiation is 4.86x10m, what...
Question 8 An electron in an atom absorbs a photon with an energy of 3.07 eV and jumps from the n 2 to n = 4 energy level in the atom. Tries remaining: Calculate the wavelength of the photon absorbed by the electron. Marked out of 1.00 Answer m Flag question Check Question 9 4 level then jumps down to the n 3 level, emitting a photon with a wavelength of 2.14 um. The electron in the n Tries remaining:...
The minimum energy needed to eject an electron from an atom is called its ionization energy I. In atomic physics, I is usually measured in electron-Volts (eV), with 1 eV being the energy needed to move a charge of 1 e across an electrostatic potential difference of 1 V, 1 eV = 1.602 x 10-19 CX1V -1.602 x 10-19 J. For the hydrogen atom | = 13.60 eV. If a photon ejects an electron with kinetic energy 5.0 eV from...
Answers for questions 1-12 please
The energy level diagram for a hydrogen atom is shown. The following 000 ev questions are about the energy levels of the hydrogen atom. An0544 ev -1.51 ev 0.850 ev electron jumps from the n 5 level to the n 1 level. 1. Will this result in an emission line, or an absorption line in then-3 n 4 spectrum of this atom? 2. Which excited state did the electron start at? n-2 3.40 ev 2....
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 36 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago