Consider the reaction: NiCl2·6H2O + 3en → [Ni(en)3]Cl2 + 6H2O You start with 2.19 mol of...
Consider the reaction: NiCl2·6H2O + 3en → [Ni(en)3]Cl2 + 6H2O You start with 2.19 mol of NiCl2·6H2O and 5.80 mol of en (en = H2NCH2CH2NH2). What is the theoretical yield of [Ni(en)3]Cl2
Homework Answers
Theoretical yield of [Ni(en)3]Cl2 = 599.01 grams or 1.933 moles
Add Answer to:
Consider the reaction: NiCl2·6H2O + 3en → [Ni(en)3]Cl2 + 6H2O
You start with 2.19 mol of...
Consider the reaction: NiCl2·6H2O + 3en → [Ni(en)3]Cl2 + 6H2O You start with 2.06 mol of...
Consider the reaction: NiCl2·6H2O + 3en → [Ni(en)3]Cl2 + 6H2O You start with 2.06 mol of NiCl2·6H2O and 5.46 mol of en (en = H2NCH2CH2NH2). What is the theoretical yield of [Ni(en)3]Cl2 ?
1.What is the maximum amount of [Ni(NH3)6]Cl2 product (the theoretical yield), that can be made if you...
1.What is the maximum amount of [Ni(NH3)6]Cl2 product (the theoretical yield), that can be made if you start with 5.107 g of NiCl2·6H2O? Data: [Ni(NH3)6]Cl2 = 231.77 g/mol NiCl2·6H2O = 237.71 g/mol 2.For synthesis experiments, purification steps tend to a. decrease yield b. can't be generalized c. not affect yield d. increase yield 3. What is the %yield for a reaction that produces 4.781 g of [Ni(NH3)6]Cl2 if the theoretical yield is 5.060 g?
NiSO4· 6H2O + en --> A. Using the moles of each species in your Ni-en complex,...
NiSO4· 6H2O + en --> A. Using the moles of each species in your Ni-en complex, show the calculations to determine the empirical formula for your Ni-en complex. Each complex’s moles / Ni 2+ moles: Ni2+ = 0.000824 mol / 0.000824 mol = 1 SO42-= 0.000824 mol / 0.000824 mol = 1 H2O = 0.006061 mol / 0.000824 mol = 7 en = 0.001001 mol / 0.000824 mol = 1 Empirical Formula: ??? B. Knowing your Ni-en complex’s empirical formula,...
2. You are in the lab; you dissolve 12.0 g NiCl2-6H2O (nickel chloride hexahydrate FW=237.69 g/mol);...
2. You are in the lab; you dissolve 12.0 g NiCl2-6H2O (nickel chloride hexahydrate FW=237.69 g/mol); you add a large excess of ammonia (NH3) in the form of concentrated ammonium hydroxide (NH4OH) and bring the solution to the mark in a 250 mL volumetric flask. The following nickel-amine complexes can be assumed to occur in the solution along with free nickel ion. Ni(NH3)2+ Ni(NH3)22+ (aq) Ni(NH3)3 2+ (aq) Ni(NH3)42 (aq) Ni(NH3)2+(aq) Ni(NH3)62+(aq) (a) Write a mass balance on Ni (for...
2. Consider the following substitution reactions: Ni(en)2Cl2 2 H20 [Ni(OH2)2(en)2] Cl2 Ni(deen)2Cl2 +2 H20INi(deen)2(0H:2}2] Cl2 where...
2. Consider the following substitution reactions: Ni(en)2Cl2 2 H20 [Ni(OH2)2(en)2] Cl2 Ni(deen)2Cl2 +2 H20INi(deen)2(0H:2}2] Cl2 where deen N, N-diethylenediamine (CH3CH2)2NCH2CH2N H2 Identify which of the two you would expect to have a faster rate and clearly explain your logic. For full credit on your explanation include comment(s) on the RDS.
Consider this reaction: 2C6H6 + 15O2 --> 12CO2 + 6H2O If you start with 1.5 moles...
Consider this reaction: 2C6H6 + 15O2 --> 12CO2 + 6H2O If you start with 1.5 moles of C6H6 and 10 moles of O2, then: how many moles of CO2 can be formed? how many moles of H2O can be formed?
Consider the overall balanced chemical equation: Ni(NO3)2·6H2O + 2 NaY + 2 PPh3 + 6 HC(OC2H5)3 →...
Consider the overall balanced chemical equation:
Ni(NO3)2·6H2O + 2 NaY + 2
PPh3 + 6
HC(OC2H5)3 →
[NiY2(PPh3)2] + 2 NaNO3
+ 12 C2H5OH + 6
HC(O)OC2H5
where Ph = C6H5 and Y = SCN or NCS
(ambidentate ion).
MW of Ni(NO3)2·6H2O = 290.8
g/mol
MW of NaSCN= 81.07 g/mol
MW of PPh3= 262.3 g/mol
MW of [NiY2(PPh3)2] (Y = SCN or
NCS) = 699.5 g/mol
If 0.252 g of Ni(NO3)2 6H20 reacts with 1.77 mmol of NaSCN and 1.65 mmol...
1. Consider the reaction: MnO2 (s) + 4 HCl (g)MnCl2 (s) + Cl2 (g) + 2 H20 (g) If 10.00 g of MnO2 ...
1. Consider the reaction: MnO2 (s) + 4 HCl (g)MnCl2 (s) + Cl2 (g) + 2 H20 (g) If 10.00 g of MnO2 and 10.00 g of HCl are reacted, how many grams of MnCl2 can be produced? Show all calculations 2. Consider the following unbalanced equation: NH4NOs(aq) + Na PO4(aq)(NH4)3PO4(aq NaNOs(aq) Assuming you start with 50.0 g of NHNOs and 50.0 g of NasPO4, which is the limiting reagent? What is the theoretical yield (g) of ammonium phosphate? a....
Cl2 + 3F2 → 2CIF: Chlorine reacts with fluorine to form gaseous chlorine trifluoride. You start with 500g of chlori...
Cl2 + 3F2 → 2CIF: Chlorine reacts with fluorine to form gaseous chlorine trifluoride. You start with 500g of chlorine and 95.0g of fluorine. a) What is the limiting reagent? b) What is the theoretical yield of chlorine trifluoride in grams? c) How many grams of excess reactant remain un-reacted? 2C2H2 + 50, 400, + 2H2O Oxyacetylene torches used in welding and cutting steel reach temperatures near 2000'C. The reaction involved is the complete combustion of acetylene (CH2). Starting with...
You have the following reaction: H2 + O2 --> H2O. You start the reaction with 10.0...
You have the following reaction: H2 + O2 --> H2O. You start the reaction with 10.0 grams of H2 and 10.0 grams of O2 and you experimentally produce 1.00 grams of H2O. What is theoretical and percent yield of H2O?
2. You are in the lab; you dissolve 12.0 g NiCl2-6H2O (nickel chloride hexahydrate FW=237.69 g/mol); you add a large excess of ammonia (NH3) in the form of concentrated ammonium hydroxide (NH4OH) and bring the solution to the mark in a 250 mL volumetric flask. The following nickel-amine complexes can be assumed to occur in the solution along with free nickel ion. Ni(NH3)2+ Ni(NH3)22+ (aq) Ni(NH3)3 2+ (aq) Ni(NH3)42 (aq) Ni(NH3)2+(aq) Ni(NH3)62+(aq) (a) Write a mass balance on Ni (for...
2. Consider the following substitution reactions: Ni(en)2Cl2 2 H20 [Ni(OH2)2(en)2] Cl2 Ni(deen)2Cl2 +2 H20INi(deen)2(0H:2}2] Cl2 where deen N, N-diethylenediamine (CH3CH2)2NCH2CH2N H2 Identify which of the two you would expect to have a faster rate and clearly explain your logic. For full credit on your explanation include comment(s) on the RDS.
Consider the overall balanced chemical equation:
Ni(NO3)2·6H2O + 2 NaY + 2
PPh3 + 6
HC(OC2H5)3 →
[NiY2(PPh3)2] + 2 NaNO3
+ 12 C2H5OH + 6
HC(O)OC2H5
where Ph = C6H5 and Y = SCN or NCS
(ambidentate ion).
MW of Ni(NO3)2·6H2O = 290.8
g/mol
MW of NaSCN= 81.07 g/mol
MW of PPh3= 262.3 g/mol
MW of [NiY2(PPh3)2] (Y = SCN or
NCS) = 699.5 g/mol
If 0.252 g of Ni(NO3)2 6H20 reacts with 1.77 mmol of NaSCN and 1.65 mmol...
1. Consider the reaction: MnO2 (s) + 4 HCl (g)MnCl2 (s) + Cl2 (g) + 2 H20 (g) If 10.00 g of MnO2 and 10.00 g of HCl are reacted, how many grams of MnCl2 can be produced? Show all calculations 2. Consider the following unbalanced equation: NH4NOs(aq) + Na PO4(aq)(NH4)3PO4(aq NaNOs(aq) Assuming you start with 50.0 g of NHNOs and 50.0 g of NasPO4, which is the limiting reagent? What is the theoretical yield (g) of ammonium phosphate? a....
Cl2 + 3F2 → 2CIF: Chlorine reacts with fluorine to form gaseous chlorine trifluoride. You start with 500g of chlorine and 95.0g of fluorine. a) What is the limiting reagent? b) What is the theoretical yield of chlorine trifluoride in grams? c) How many grams of excess reactant remain un-reacted? 2C2H2 + 50, 400, + 2H2O Oxyacetylene torches used in welding and cutting steel reach temperatures near 2000'C. The reaction involved is the complete combustion of acetylene (CH2). Starting with...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 34 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago