i need help with b,e, and f please!Homework Answers
Add Answer to:
i need help with b,e, and f please!
2) Fill in each of the following boxes...
2) Fill in each of the following boxes with the structure of the major reaction product(s)...
2) Fill in each of the following boxes with the structure of the major reaction product(s) from each of the following reactions. (28 points total). a) Pd(PPhale NaOH b) + Pd(OA) (CH CHN CN 1. NaBH 2. H2O HH OH но -н H- OH HH OH CH,OH HNO, но NH,OH trace of acid 1. CHI (excess 2. Ag,0 H2O, heat CI 1 CRUS POY Grubbs catalyst) Page 2 of 5
10. Please Check 1 by 1 and read carefully. I would need a perfect score for...
10.
Please Check 1 by 1 and read carefully. I would need a perfect
score for this . Thanks
Select the keyword or phrase that will best complete each sentence A Claisen reaction is a nucleophilic substitution in which an enolate is the nucleophile Key terms: Robinson annulation Aldol condensation: An aldol reaction in which the initially formed p hydroxyl carbonyl compound loses water by dehydration. Claisen reaction Aldol condensation Dieckmann reaction: An intramolecular Claisen reaction of a diester to...
2. Draw, in the provided spaces/ boxes, the major organic products of the following transformations. Be...
2. Draw, in the provided spaces/ boxes, the major organic products of the following transformations. Be sure to indicate appropriate stereochemistry. If the reaction generates enantiomers, draw one and write tenantiomer' 1. Cl2, H20 2. NaOH На Pd/C 1.Hg(OAc)2 CH,OH 2. NABH 1. CH CO H 2. Hао* Н,с" HC @) 1. ВНа, THF 2. H202, NaOH Br2 CH2CI2 (E)-5-methylhept-3-ene MeOH conc'd H3PO4 ОН Br NAOCH3
Organic Chemistry please help asap 70. What nucleophiles wou cleophiles would form the following compounds as...
Organic Chemistry please help asap
70. What nucleophiles wou cleophiles would form the following compounds as a result of reacting with l-iodobutane? OH SH 11. Draw (R)-2-bromopentane + CHO b. (R)-3-bromo-3-methylheptane + CH,OH c. benzyl chloride + CH CH OH te tollowing reactions: if the products can exist as stereoisomers, show what striscmers are obtained d. allyl chloride + CHOH e. 1-bromo-2-butene + CHO 1. l-bromo-2-butene + CH OH the products obtained from the solvolysis of each of the following...
please help! will give rating. thank you! L. 1.CH,Br 2. H,0 M. NaBH CH, OH 0....
please help! will give rating. thank you!
L. 1.CH,Br 2. H,0 M. NaBH CH, OH 0. Brz P. Hz, Pd N. 1. KCN 2. LIAIHA 3. H2O ОН Q. NaOH, Bra B. 1, KCN 2. HCI 3. cat NaOH H2O S. NHA mild H+ I. NH3 NaBH3CN U. 1. CHgMgBr 2. H2O, H Determine the reagents necessary to carry out each of the following transformations. The reagent choices are listed in the text box above this question (reagents L-U). You...
please help ? 25. Draw the product of the following reaction: CH,BE 1. N&CN, acetone 2....
please help ?
25. Draw the product of the following reaction: CH,BE 1. N&CN, acetone 2. H30, heat 26. Draw the product of the following reaction: CHOy, H,0* OH 27. Draw the product of the following reaction: CN 1. LiAH, THF 2.H309 28. Draw the product of the following reaction: CH3CH2CH2CHCNH, CH.CH SOCI), benzene heat 29. Draw the product of the following reaction: OO OH + CH3COCCH) NaOH H₂O ОН Salicylic acid lo-hydroxybenzoic acid) Acetic anhydride 30. Draw the product...
Please I need help on this. I'm so lost 1. Acetic acid (H)CO2H) has k, =...
Please I need help on this. I'm so lost
1. Acetic acid (H)CO2H) has k, = 1.8 x 10- and acetate (H:C:01") has ks = 5.6 x 10-10. (a) Write balanced chemical equilibrium equations (with physical states) for acid dissociation of acetic acid and base hydrolysis of acetate ion. (b) Write K, and equilibrium constant expressions for the above reactions. (c) Use your expressions from part b to show that Kx. = 1.0 x 10-* = [H,O'][OH). 2. For each...
1.) (9 points) Give structures for the following compounds: a) meta-phenylphenol b) 6-benzyl-3-heptanol e) ortho-sec-butyltoluene 2.)...
1.) (9 points) Give structures for the following compounds: a) meta-phenylphenol b) 6-benzyl-3-heptanol e) ortho-sec-butyltoluene 2.) (9 points) Name the following compounds: 3.) (8 points) Label the following molecules as aromatic, anti-aromatic, or non-aromatic. For the ones th aren't aromatic, explain why they are either non-aromatic or anti-aromatic. 0.8 4.) (11 points) For the following electrophilic aromatic substitution reaction: Вт, FeBr; a) Which product is the major one? b) Draw a complete mechanism for the formation of the major product...
2) Fill in each of the following boxes with the structure of the major reaction product(s) from each of the following reactions. (28 points total). a) Pd(PPhale NaOH b) + Pd(OA) (CH CHN CN 1. NaBH 2. H2O HH OH но -н H- OH HH OH CH,OH HNO, но NH,OH trace of acid 1. CHI (excess 2. Ag,0 H2O, heat CI 1 CRUS POY Grubbs catalyst) Page 2 of 5
10.
Please Check 1 by 1 and read carefully. I would need a perfect
score for this . Thanks
Select the keyword or phrase that will best complete each sentence A Claisen reaction is a nucleophilic substitution in which an enolate is the nucleophile Key terms: Robinson annulation Aldol condensation: An aldol reaction in which the initially formed p hydroxyl carbonyl compound loses water by dehydration. Claisen reaction Aldol condensation Dieckmann reaction: An intramolecular Claisen reaction of a diester to...
2. Draw, in the provided spaces/ boxes, the major organic products of the following transformations. Be sure to indicate appropriate stereochemistry. If the reaction generates enantiomers, draw one and write tenantiomer' 1. Cl2, H20 2. NaOH На Pd/C 1.Hg(OAc)2 CH,OH 2. NABH 1. CH CO H 2. Hао* Н,с" HC @) 1. ВНа, THF 2. H202, NaOH Br2 CH2CI2 (E)-5-methylhept-3-ene MeOH conc'd H3PO4 ОН Br NAOCH3
Organic Chemistry please help asap
70. What nucleophiles wou cleophiles would form the following compounds as a result of reacting with l-iodobutane? OH SH 11. Draw (R)-2-bromopentane + CHO b. (R)-3-bromo-3-methylheptane + CH,OH c. benzyl chloride + CH CH OH te tollowing reactions: if the products can exist as stereoisomers, show what striscmers are obtained d. allyl chloride + CHOH e. 1-bromo-2-butene + CHO 1. l-bromo-2-butene + CH OH the products obtained from the solvolysis of each of the following...
please help! will give rating. thank you!
L. 1.CH,Br 2. H,0 M. NaBH CH, OH 0. Brz P. Hz, Pd N. 1. KCN 2. LIAIHA 3. H2O ОН Q. NaOH, Bra B. 1, KCN 2. HCI 3. cat NaOH H2O S. NHA mild H+ I. NH3 NaBH3CN U. 1. CHgMgBr 2. H2O, H Determine the reagents necessary to carry out each of the following transformations. The reagent choices are listed in the text box above this question (reagents L-U). You...
please help ?
25. Draw the product of the following reaction: CH,BE 1. N&CN, acetone 2. H30, heat 26. Draw the product of the following reaction: CHOy, H,0* OH 27. Draw the product of the following reaction: CN 1. LiAH, THF 2.H309 28. Draw the product of the following reaction: CH3CH2CH2CHCNH, CH.CH SOCI), benzene heat 29. Draw the product of the following reaction: OO OH + CH3COCCH) NaOH H₂O ОН Salicylic acid lo-hydroxybenzoic acid) Acetic anhydride 30. Draw the product...
Please I need help on this. I'm so lost
1. Acetic acid (H)CO2H) has k, = 1.8 x 10- and acetate (H:C:01") has ks = 5.6 x 10-10. (a) Write balanced chemical equilibrium equations (with physical states) for acid dissociation of acetic acid and base hydrolysis of acetate ion. (b) Write K, and equilibrium constant expressions for the above reactions. (c) Use your expressions from part b to show that Kx. = 1.0 x 10-* = [H,O'][OH). 2. For each...
1.) (9 points) Give structures for the following compounds: a) meta-phenylphenol b) 6-benzyl-3-heptanol e) ortho-sec-butyltoluene 2.) (9 points) Name the following compounds: 3.) (8 points) Label the following molecules as aromatic, anti-aromatic, or non-aromatic. For the ones th aren't aromatic, explain why they are either non-aromatic or anti-aromatic. 0.8 4.) (11 points) For the following electrophilic aromatic substitution reaction: Вт, FeBr; a) Which product is the major one? b) Draw a complete mechanism for the formation of the major product...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 32 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago