what is the predicted product from the following combination reaction (with input of heat) Li(s)+O2 (g)

Question

Question

Answer 1

Answer #1

Answer:

Combination reaction (with input of heat) Li(s)+O₂(g) gives Li₂O(s).

Please do give thumbs up.

Answer 2

Similar Homework Help Questions

Calculate the entropy change at 25°C for the following reaction: Li (s) + 0.5 O2 (g)...

Calculate the entropy change at 25°C for the following reaction: Li (s) + 0.5 O2 (g) + 0.5 H2 (g) → LiOH (s) The entropy contents of the reactants and product at 25°C are as follows: Substance S, J/mol•K Li (s) 29.12 O2 (g) 205.138 H2 (g) 130.68 LiOH (s) 42.8
The following reaction releases 1184.0 kJ of heat: 2 Sr (s) + O2 (g) ⟶ 2 SrO...

The following reaction releases 1184.0 kJ of heat: 2 Sr (s) + O2 (g) ⟶ 2 SrO (s) What is the heat absorbed/released when 50.0 g of strontium reacts with excess molecular oxygen?
1).From the following enthalpy changes, S (s) +3/2 O2 (g) 2 SO2 (g) SO3 (g) O2...

1).From the following enthalpy changes, S (s) +3/2 O2 (g) 2 SO2 (g) SO3 (g) O2 (g)2 SO3 (g) AH =-395.2 kJ AHo 198.2 kJ Calculate the value of AHo for the reaction by using Hess's law of Heat Summation S(s) O2 (g) SO2 (g) 2) Oxyacetylene torches are fueled by the combustion of acetylene, C2H2. 4 CO2 (g) +2 H20 (g) 2 C2H2 + 5 O2 (g) If the enthalpy change for the reaction is -2511.14 kJ/mol, a) How...

Calculate heat for the following reaction to produce sulfur dioxide, S(3) + O2(g) = SO2(E) given...

Calculate heat for the following reaction to produce sulfur dioxide, S(3) + O2(g) = SO2(E) given the thermochemical equations below. 2 S(s) + 3 O2(g) =2 SO3(g) AH° = -791.5 kJ 2 SO2(g) + O2(g) = 2 SO3(g) AH° = -197 9 kJ Show all work and calculate to the correct number of sig figs.
. For the reaction C(s)+O2(g) CO2(g), AH = -393.5 kJ/mol. What is the amount of heat...

. For the reaction C(s)+O2(g) CO2(g), AH = -393.5 kJ/mol. What is the amount of heat (in kJ) produced during the combustion of 34.56 g of coal (pure carbon)? pec To abiod to yedmun Decide whether each of these reactinns is exothorm
what is the predicted product from the following combination reaction? E) none of the above 33)...

what is the predicted product from the following combination reaction? E) none of the above 33) Which of the following produces the characteristic color of a fireworks display? A) atoms exploding B) molecules exploding C) electrons dropping to lower energy levels D) nuclei dropping to lower energy levels E) none of the above Chapter 8 34) How many atoms of cobalt equal a mass of 58.93 g? (Refer to the Periodic Table.) A) 1 B) 27 C) 58.93 D) 59...

The major product(s), A, of the following reaction, Li NHa0), EtOH Li +EtLi + EO

The major product(s), A, of the following reaction, Li NHa0), EtOH Li +EtLi + EO
In the combination reaction below, the completed and balanced reaction has what product(s): N2(g) + 3...

In the combination reaction below, the completed and balanced reaction has what product(s): N2(g) + 3 H2(g) → 2N+ 3H2 o 2NH3 3NH2 + H2 2NH2 + H2 O NH₃ Question 2 How many moles of Cu2S can be produced from the reaction of 4.00 g of Cu and excess sulfur? 5.10 0.0157 0.0315 2.00 0.510 What is the mass of a cylindrical rod that has a diameter of 2,00 cm, height of 10.00 cm and a density of 1135...
1). From the following enthalpy changes, S (s) + 3/2 O2 (g) → SO3 (9) 2...

1). From the following enthalpy changes, S (s) + 3/2 O2 (g) → SO3 (9) 2 SO2 (g) + O2(g) → 2 SO3 (9) AH° = -395.2 kJ AH° = -198.2 kJ Calculate the value of AH° for the reaction by using Hess's law of Heat Summation S (s) + O2 (g) → SO2 (g).

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=