The following reaction releases 1184.0 kJ of heat:
2 Sr (s) + O2 (g) ⟶ 2 SrO (s)
What is the heat absorbed/released when 50.0 g of strontium reacts with excess molecular oxygen?
Solution:
2 Sr(s) + O2(g) → 2 SrO(s) ΔHrxn = 1184 kJ
In this case, you can say that when 2 moles of Sr react with 1 mole of oxygen gas, 2 moles of SrO are produced and the enthalpy change of reaction is ΔHrxn = + 1184 kJ.
In other words, when 2 moles of Sr undergo combustion, +1184 kJ" of heat are being absorned, hence the plus sign used for ΔHrxn.
So, you know that the reaction absorb 1184 kJ of heat when two moles of Sr react. Use the compound's molar mass to determine how many moles you get in that 50.0-g sample
moles of Sr = mass of Sr / molar mass = 50 / 87.5 = 0.57 mol Sr
You can now use the known enthalpy change of reaction for when two moles of Sr undergo combustion as a conversion factor to figure out how much heat is being given off when 0.57 moles react
0.57 x (1184 / 2 mol Sr) = 337.44 KJ
So the heat absorbed = 337.44 KJ
The following reaction releases 1184.0 kJ of heat: 2 Sr (s) + O2 (g) ⟶ 2 SrO...
Question 17 of 20 Using the equations 2 Sr(s) + O2 (g) → 2 Sro (s) AH° = -1184 kJ/mol CO2 (g) → C(s) + O2 (g) AH° = 394 kJ/mol Determine the enthalpy for the reaction C(s) + 2 Sro(s) → CO2 (g) + 2 Sr(s). kJ/mol
Using the equations 2Sr(s)+O2(g) → 2 SrO (s) ΔH° = -1184 kJ/mol SrO (s) +CO2 (g) → SrCO3 (s) ΔH° = -234 kJ/mol CO2 (g) → C(s) +O2 (g) ΔH°= 394 kJ/mol Determine the enthalpy for the reaction 2 SrCO3 (s) → 2 Sr (s)+2 C(s)+ 3O2 (g). kJ/mol
Pb.8. Consider the following balanced thermochenmical equation for the decomposition of the mineral magnesite: MgCOs(s) MgO(s)+CO2(g) AHn 117.3 kJ a) Is heat absorbed or released in the reaction? b) What is AHnn for the reverse reaction? c) What is AH when 5.35 mol of CO2 reacts with excess MgO? d) What is AH when 35.5 g of CO2 reacts with excess MgO? Page 3 of 4 CHE 120 Pb.9. Liquid hydrogen peroxide, an oxidizing agent used in many rocket fuel...
4 Na(s) + O2(g) --> 2 Na2O(s) ΔH0 = - 828 kJ This reaction is _______, and therefore heat is_____ by the reaction. a)exothermic, absorbed b)exothermic, released c)endothermic, absorbed d)endothermic, released
How much heat is absorbed/released when 20.00 g of NH3(g) reacts in the presence of excess O2 (g) to produce NO (g) and H2O (l) according to the following chemical equation? 4NH3 (g) + 5O2 (g) ---> 4NO (g) +6H2O (l) Δ H: +1168 kJ a. 342.9 kJ of heat are absorbed. b. 342.9 kJ of heat are released. c. 1372 kJ of heat are absorbed. d. 1372 kJ of heat are released. Please explain your answer.
help The value of H° for the reaction below is -1107 kJ: 2Ba (s) + O2 (g) 2BaO (s) How many kJ of heat are released when 5.75 g of Ba (s) reacts completely with oxygen to form BaO (s)? 23.2 kJ 26.3 kJ 96.3 kJ 46.4 kJ 193 kJ
The DeltaH value for the reaction 1/2 O2(g) + Hg(l)----> HgO(s) is -90.8 kJ. How much heat is released when 84.6 g Hg is reacted with oxygen?
How much heat is absorbed/released when 30.00 g of NH3(g) reacts in the presence of excess O2(g) to produce NO(g) and H2O(l) according to the following chemical equation? 4 NH3(g) + 5 O2(g) ? 4 NO(g) + 6 H2O(l) ?H° = 1168 kJ
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
Given: C(s) + O2(g) ---> CO2(g) ΔH = −393.5 kJ/mol S(s) + O2(g) ---> SO2(g) ΔH = −296.8 kJ/mol C(s) + 2S(s) ---> CS2(ℓ) ΔH = +87.9 kJ/mol A) Calculate the standard enthalpy change for the following reaction CS2(ℓ) + 3O2(g) ---> CO2(g) + 2SO2(g) ΔH° rxn = -1075 kJ/mol B) Using the equation and standard enthalpy change for the reaction (from part A), calculate the amount of heat produced or consumed when 3.2 mol of CS2 reacts with excess...