What would be the major product of the dehydrohalogenation of 3-chloropentane by КОН? (A) CH3 CH2=CCH2CH3...
6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3
6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3
product(s) would be produced by acid-catalyzed dehydration of the alcohol? CH CH3CCH2CH2 CH3 HA, heat -H20) он A) CH B) C) CH3 D) CHa E) CH3CCH2CH2CH3 CH2-CCH2CH2CH3 and CH3C-CHCH2CH3 CH3CHCH CHCH3 and CH3CHCH2 CH3CHCH2CH-СНГ CH3 CH3 CH3 CH3 CH3 CHa CH3 11. Which alkene would you expect to be the major product of the following dehydration? so, /heol A) I B) II C) II D) IV E) V Page 6
7-57 Predict the major product in each of the following reactions: (a) CH3 H2O CH3CH2CH=CCH2CH3 13 H2SO4 (Addition of H20 occurs.) (b) CHCH, HP, CH2CH3 HB hor 2 (c) CH₃ HBI ? (d) H2C=CHCH2CH2CH2CH=CH2 --- 2 HCI
24) What is/are the product(s) of the following reaction? CH3 CH3CH2O CH3CBr CH3 A) CH3 CH3CH 20c-CH3 CH3 B) CH2-CH2 C) CH3C CH2 CH3 D) A and B E) A and C 25) What is/are the product(s) of the following reaction? CH3 CH3-C- CH3CH2Br2 CH 3 A) CH3 CH3CH20C-CH3 CH3 B) CH2 CH2 C) CH3C CH2 CH3 D) A and B E) A and C
What product is formed by the addition of two
H2 molecules to CH2CH-CHCH2?
a. CH3-CH2-CH=CH2 b.
CH3-CH2-CH=CH3
c. CH3-CH2-CH2-CH3
d. CH3-CH2-C=CH
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br CH CH2-C-CH3 он CH CH-C=CH2 CH CH-GẠCH он н сна -CH=CH-CH3 CH CH2-CH-CH, OH AI B) II C) III D) IV 17) What is the major product of the following reaction? CH3 e CH3CH20 + CH3CBC - CH 3 A) CH2=CH2 B) СН3 CH3CH20C-CH3 CH3 CH 3C=CH2 CH3 D) A and B E) A and C
Question 7 What is the major product of the reaction shown below? H+ CH3-CH2-CH=CH2 + HOH A) OH OH CH3 - CH2 -CH-CH2 B) OH | CH3 - CH2 -CH-CH3 OH OH CH3 -CH-CH - CH3 D) OH CH3 - CH2 -C=CH2 Choice A Choice B Choice C Choice D
What is the major product of the reaction shown
below?
Question 4 What b the major product of the reacton shown below CH,-CH2-CH-CH2+ HOH → ● CH,-CHI-CH2-CH2CH o CH CH 3-CE-CH.CH3 CH 매3-CH2-c.on CH3 CH2-C CH2 CH3 CH2-CH-CH3 OH OH CH3-CH2-CH CH2
Problem 6.11 Part A What is the major product of the following reaction? CH3 CH3C-CH2 HC Draw the molecu le on the canvas by choosing butta by default.