24) What is/are the product(s) of the following reaction? CH3 CH3CH2O CH3CBr CH3 A) CH3 CH3CH...

Question

Question

Answer 1

Answer #1

it t CM3 (major 2 S CH 2 miner

Answer 2

Similar Homework Help Questions

6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3 6. What would be the major...

6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3 6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3...

Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br...

16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br CH CH2-C-CH3 он CH CH-C=CH2 CH CH-GẠCH он н сна -CH=CH-CH3 CH CH2-CH-CH, OH AI B) II C) III D) IV 17) What is the major product of the following reaction? CH3 e CH3CH20 + CH3CBC - CH 3 A) CH2=CH2 B) СН3 CH3CH20C-CH3 CH3 CH 3C=CH2 CH3 D) A and B E) A and C

53) What alkene is formed in greatest yield in the following Hofmann elimination? он CH3 CH3...

53) What alkene is formed in greatest yield in the following Hofmann elimination? он CH3 CH3 CH 3CH2CH2N CCH3? CH3 CH3 lheat A) CH3CH2CH-CH2 B) CH3CH2C=CH2 CH3 C) CH3-C-CH3 CH2 D) CH3CHCH CH2 CH3 E) CH3CH-CH2 54) What is the product of the following reaction sequence? (CH3)2Culi Ho C CCH CCH CH2OH C CCHCH CH OH IIL. CH,OCH,CH,
22) What are the products of the following reaction? CH3 CH3-C-O + CH3CH2Br - ? CH3...

22) What are the products of the following reaction? CH3 CH3-C-O + CH3CH2Br - ? CH3 CH3 CH3CH20C-CH3 СН3 B) CH2=CH2 CH3C=CH2 CH3 D) A and B E) A and C
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...

1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid

23) What is the product of the following reaction? 23) Hас CH3 c=c н OSO4, (CH3)3COOH...

23) What is the product of the following reaction? 23) Hас CH3 c=c н OSO4, (CH3)3COOH (CH);CОН, ОН н A) CH3CH=0 B) cis-2,3-epoxybutane D) 1,3-butanediol C) 2,3-butanediol 24) Which of the following reagents will convert cyclohexene into cis-1,2-cyclohexanediol? 24) CIP НОlи TO(E p (CH d bavrollo A) CH3CO3H (peroxyacetic acid) B) Os04, (CH3)3COOH, (CH3)3COH, OH C) 03 followed by Zn/H20 D) HIO4 (CE
7 the following substitution reaction? Which is the major product of the follow CHOCHOH NaBr ?...

7 the following substitution reaction? Which is the major product of the follow CHOCHOH NaBr ? A) CH₂ CH₂ Br B) CH CH. Na c) CH₂-E-H D) All of the Above E) None of the Above of the following substitution reaction? CHE is the major product of the following substitut CH₂CH=CH-CH2 HBr ? CHz CÓ CH2=CH-CH3 OH A) CH₂CH=CH-CH3 B) CH3C-CH₂-CH3 D) None of the Above ? Which is the major product of the following reaction? PBra ? CHCH OH...
OH H 0. What is (are) the product(s) of the following reaction? OH ( Η' CH3...

OH H 0. What is (are) the product(s) of the following reaction? OH ( Η' CH3 B. CH3 C. CH3 =CH, D. A and B E. A, B, and C A) A B) BC) CD) DE) E P. What is (are) the product(s) of the following reaction?

product(s) would be produced by acid-catalyzed dehydration of the alcohol? CH CH3CCH2CH2 CH3 HA, heat -H20)...

product(s) would be produced by acid-catalyzed dehydration of the alcohol? CH CH3CCH2CH2 CH3 HA, heat -H20) он A) CH B) C) CH3 D) CHa E) CH3CCH2CH2CH3 CH2-CCH2CH2CH3 and CH3C-CHCH2CH3 CH3CHCH CHCH3 and CH3CHCH2 CH3CHCH2CH-СНГ CH3 CH3 CH3 CH3 CH3 CHa CH3 11. Which alkene would you expect to be the major product of the following dehydration? so, /heol A) I B) II C) II D) IV E) V Page 6