22) What are the products of the following reaction? CH3 CH3-C-O + CH3CH2Br - ? CH3...

Question

Question

22) What are the products of the following reaction? CH3 CH3-C-O + CH3CH2Br - ? CH3 CH3 CH3CH20C-CH3 СН3 B) CH2=CH2 CH3C=CH2

Answer 1

Answer #1

substitution product Since the subspate (Alkyl halide) is primary Alkyl halide, therefore substitution product can be formed.

Answer 2

Similar Homework Help Questions

24) What is/are the product(s) of the following reaction? CH3 CH3CH2O CH3CBr CH3 A) CH3 CH3CH...

24) What is/are the product(s) of the following reaction? CH3 CH3CH2O CH3CBr CH3 A) CH3 CH3CH 20c-CH3 CH3 B) CH2-CH2 C) CH3C CH2 CH3 D) A and B E) A and C 25) What is/are the product(s) of the following reaction? CH3 CH3-C- CH3CH2Br2 CH 3 A) CH3 CH3CH20C-CH3 CH3 B) CH2 CH2 C) CH3C CH2 CH3 D) A and B E) A and C
16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br...

16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br CH CH2-C-CH3 он CH CH-C=CH2 CH CH-GẠCH он н сна -CH=CH-CH3 CH CH2-CH-CH, OH AI B) II C) III D) IV 17) What is the major product of the following reaction? CH3 e CH3CH20 + CH3CBC - CH 3 A) CH2=CH2 B) СН3 CH3CH20C-CH3 CH3 CH 3C=CH2 CH3 D) A and B E) A and C
17) What are the products of the following reaction? CH3OH + CH3C=C--- ? A) CH3C=CH+CH30- B)...

17) What are the products of the following reaction? CH3OH + CH3C=C--- ? A) CH3C=CH+CH30- B) CH3C=COCH3 + HO- C) CH3OC=CH+ -CH3 D) CH3C=CCH3 + HO- E) no reaction

Which of the following pairs of formulas represent isomers? CH3 - CH2 - CH2 - CH3...

Which of the following pairs of formulas represent isomers? CH3 - CH2 - CH2 - CH3 and CH3 - CH2 - CH3 CH3 CH3 - C-CH3 and CH3 - CH2 - CH3 сH3 СН3 CH3 CH3 -CH-CH-CH3 and CH3 - CH2 - C-CH3 сна СН3 CH3 - CH2 and CH3 - CH2 - CH2 СН2-СН3 СН3 CH3 СН3 o CH3-CH-CH-CH3 and CH3-CH2-C-CH3 сH3 СН3 CH3 - CH2 and CH3 - CH2 - CH2 СН2-СН3 сHз CH3 CH3 СН3 о сH2...
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3...

Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
What is the major product of the following reaction? CH3 CH2-C-CH3 + KOH Br ? CH3...

What is the major product of the following reaction? CH3 CH2-C-CH3 + KOH Br ? CH3 CH3 -CH2-C-CH3 -CH-¢- I. IV. OH CH3 -CH2-C=CH2 OH H CH -CH=C-CH3 II. V. CH3 -CH2-CH-CH2OH -CH II. OT OI O III O TV OV

CH2-O-C-(CH2) 14CH3 O CH-O-C-(CH2)7-g=-(CH2),CH3 + 3H2 POR CH2-O-C-(CH2)-=9-CH2-9 9-(CH2); CH3 Show the product or products of...

CH2-O-C-(CH2) 14CH3 O CH-O-C-(CH2)7-g=-(CH2),CH3 + 3H2 POR CH2-O-C-(CH2)-=9-CH2-9 9-(CH2); CH3 Show the product or products of the reaction below:
6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3 6. What would be the major...

6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3 6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3
The amide functional group in the anti-viral drug Oseltamivir below is classified as O H N...

The amide functional group in the anti-viral drug Oseltamivir below is classified as O H N NH2 A) primary B) secondary C) tertiary D) quaternary Which of the given compounds is a minor resonance contributor for the compound shown below? -CH3 + CH3 A) B) O-CH₂ C) 2-CH₂ + Which of the following are the substitution products of the reaction shown below? CH3CH2Br + "OH → ? A) CH3CH2OH + Br B) CH2=CHBr + H20 C) CH2-CH2 + Br” +...

7 the following substitution reaction? Which is the major product of the follow CHOCHOH NaBr ?...

7 the following substitution reaction? Which is the major product of the follow CHOCHOH NaBr ? A) CH₂ CH₂ Br B) CH CH. Na c) CH₂-E-H D) All of the Above E) None of the Above of the following substitution reaction? CHE is the major product of the following substitut CH₂CH=CH-CH2 HBr ? CHz CÓ CH2=CH-CH3 OH A) CH₂CH=CH-CH3 B) CH3C-CH₂-CH3 D) None of the Above ? Which is the major product of the following reaction? PBra ? CHCH OH...