6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3 6. What would be the major...

Question

Question

Answer 1

Answer #1

KoH O tu

Answer 2

Answer #2

C is the answer

Answer 3

Similar Homework Help Questions

What would be the major product of the dehydrohalogenation of 3-chloropentane by КОН? (A) CH3 CH2=CCH2CH3...

What would be the major product of the dehydrohalogenation of 3-chloropentane by КОН? (A) CH3 CH2=CCH2CH3 (B) CH3 CH3C=CHCHZ (C) CH2=CHCH2CH2CH3 (D) CH2CH=CHCH2CH3
24) What is/are the product(s) of the following reaction? CH3 CH3CH2O CH3CBr CH3 A) CH3 CH3CH...

24) What is/are the product(s) of the following reaction? CH3 CH3CH2O CH3CBr CH3 A) CH3 CH3CH 20c-CH3 CH3 B) CH2-CH2 C) CH3C CH2 CH3 D) A and B E) A and C 25) What is/are the product(s) of the following reaction? CH3 CH3-C- CH3CH2Br2 CH 3 A) CH3 CH3CH20C-CH3 CH3 B) CH2 CH2 C) CH3C CH2 CH3 D) A and B E) A and C
product(s) would be produced by acid-catalyzed dehydration of the alcohol? CH CH3CCH2CH2 CH3 HA, heat -H20)...

product(s) would be produced by acid-catalyzed dehydration of the alcohol? CH CH3CCH2CH2 CH3 HA, heat -H20) он A) CH B) C) CH3 D) CHa E) CH3CCH2CH2CH3 CH2-CCH2CH2CH3 and CH3C-CHCH2CH3 CH3CHCH CHCH3 and CH3CHCH2 CH3CHCH2CH-СНГ CH3 CH3 CH3 CH3 CH3 CHa CH3 11. Which alkene would you expect to be the major product of the following dehydration? so, /heol A) I B) II C) II D) IV E) V Page 6

16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br...

16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br CH CH2-C-CH3 он CH CH-C=CH2 CH CH-GẠCH он н сна -CH=CH-CH3 CH CH2-CH-CH, OH AI B) II C) III D) IV 17) What is the major product of the following reaction? CH3 e CH3CH20 + CH3CBC - CH 3 A) CH2=CH2 B) СН3 CH3CH20C-CH3 CH3 CH 3C=CH2 CH3 D) A and B E) A and C
What is the major product of the following reaction? CH3 CH2-C-CH3 + KOH Br ? CH3...

What is the major product of the following reaction? CH3 CH2-C-CH3 + KOH Br ? CH3 CH3 -CH2-C-CH3 -CH-¢- I. IV. OH CH3 -CH2-C=CH2 OH H CH -CH=C-CH3 II. V. CH3 -CH2-CH-CH2OH -CH II. OT OI O III O TV OV
What is the major product of the following reaction? CH -CH₂-C- CH2-C-CH3 + KOH Br alcohol...

What is the major product of the following reaction? CH -CH₂-C- CH2-C-CH3 + KOH Br alcohol heat ? сні -CH2-C-CH OH IV. I CH3 -CH-CACH OHH CHE -CH=C-CH3 сн -CH2-C=CH2 II. V. CH3 -CH2-CH-CH2OH TIL A) B) 11 OC) IV D) v

16) What is the major product of the towing CH-C- CH + KOH OJ BBC 17)...

16) What is the major product of the towing CH-C- CH + KOH OJ BBC 17) What is the m o st CHCH20- CH A) CH-CH2 B) CH3CH20C-CH3 CH3C=CH2 D) A and E) AC thalides 18) Which of the following А оноос CHCHCH Саснува CHCHCH E) CHUCHOCH
Problem 6.11 Part A What is the major product of the following reaction? CH3 CH3C-CH2 HC Draw the molecu le on the canv...

Problem 6.11 Part A What is the major product of the following reaction? CH3 CH3C-CH2 HC Draw the molecu le on the canvas by choosing butta by default.
7-57 Predict the major product in each of the following reactions: (a) CH3 H2O CH3CH2CH=CCH2CH3 13...

7-57 Predict the major product in each of the following reactions: (a) CH3 H2O CH3CH2CH=CCH2CH3 13 H2SO4 (Addition of H20 occurs.) (b) CHCH, HP, CH2CH3 HB hor 2 (c) CH₃ HBI ? (d) H2C=CHCH2CH2CH2CH=CH2 --- 2 HCI

Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3...

Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2