16) What is the major product of the towing CH-C- CH + KOH OJ BBC 17)...
16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br CH CH2-C-CH3 он CH CH-C=CH2 CH CH-GẠCH он н сна -CH=CH-CH3 CH CH2-CH-CH, OH AI B) II C) III D) IV 17) What is the major product of the following reaction? CH3 e CH3CH20 + CH3CBC - CH 3 A) CH2=CH2 B) СН3 CH3CH20C-CH3 CH3 CH 3C=CH2 CH3 D) A and B E) A and C
What is the major product of the following reaction? CH -CH₂-C- CH2-C-CH3 + KOH Br alcohol heat ? сні -CH2-C-CH OH IV. I CH3 -CH-CACH OHH CHE -CH=C-CH3 сн -CH2-C=CH2 II. V. CH3 -CH2-CH-CH2OH TIL A) B) 11 OC) IV D) v
6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3
6. What would be the major product of the dehydrohalogenation of 3-chloropentane by KOH? CH3 CH2 CCH2CH3 (B) CH3 CH3C-CHCH3 (C) CH2 CHCH2CH2CH3 (D) CH3CH CHCH2CH3
What is the major product of the following reaction? CH3 CH2-C-CH3 + KOH Br ? CH3 CH3 -CH2-C-CH3 -CH-¢- I. IV. OH CH3 -CH2-C=CH2 OH H CH -CH=C-CH3 II. V. CH3 -CH2-CH-CH2OH -CH II. OT OI O III O TV OV
11. Provide the major organic product in the reaction below. 1. BH, THE 2. HO, HẠO: 12. Provide the major organic product in the reaction below. Hy Lindlar catalyst 13. Provide the structure of the major organic product of the following reaction. H, (excess) Pd/C 14. Which is the correct order of decreasing acidity in the following compounds? H20 CH3CH3NH3 CH2-CH2 HC=CH А в C E A) AME>C>D>B B) A >E>D>B>C CE>A>C>B>D D) A > C>E>D>B E) E>D>B>A>C 15. What...
7 the following substitution reaction? Which is the major product of the follow CHOCHOH NaBr ? A) CH₂ CH₂ Br B) CH CH. Na c) CH₂-E-H D) All of the Above E) None of the Above of the following substitution reaction? CHE is the major product of the following substitut CH₂CH=CH-CH2 HBr ? CHz CÓ CH2=CH-CH3 OH A) CH₂CH=CH-CH3 B) CH3C-CH₂-CH3 D) None of the Above ? Which is the major product of the following reaction? PBra ? CHCH OH...
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
is the major product of the following substitution reaction! CH₂CH₂OH NaBr ? A) CH₃ CH₂ Br D) All of the Above B) CH₃ CH₂ Na E) None of the above c) CH3-C-H 20 Which is the major product of the following substitution reaction? ? CHICH-CH-CH2 HBr CH OH CH₂ C) CH₂ C=CH-CH₂ Shy A) CH₂ CH-CH=CH₂ D) None of the Above. B) CH₃ ¢-CH₂-CH₃ Br 2) Which is the major product of the following reaction? CH3 CH PBr3 ? CH₂...
Identify the major product of 16 HO following reaction. CH3 НРО beat (A) CH3 (B) CH; (C) CH3 (D) CH2
24) What is/are the product(s) of the following reaction? CH3 CH3CH2O CH3CBr CH3 A) CH3 CH3CH 20c-CH3 CH3 B) CH2-CH2 C) CH3C CH2 CH3 D) A and B E) A and C 25) What is/are the product(s) of the following reaction? CH3 CH3-C- CH3CH2Br2 CH 3 A) CH3 CH3CH20C-CH3 CH3 B) CH2 CH2 C) CH3C CH2 CH3 D) A and B E) A and C