what is the difference in how spiriva and servent work
what is the difference in how spiriva and servent work
Homework Answers
Spiriva and serevent are both used in respiratory conditions like COPD and asthma. They both act in smooth muscles and cause bronchodilation.
1. Spiriva is more effective than serevent
2. Serevent can be given in combination with other corticosteroids
3. Spiriva acts on muscuranic receptors present in smooth muscles mainly M3 receptors. Whereas serevent acts on beta 2 adrenergic receptors to show its effect.
How are spiriva and servant different? How do they work? Can they be used togerher?
How are spiriva and servant different? How do they work? Can they be used togerher?
What is the difference between Ethics and Morals? How do they work together? How can they...
What is the difference between Ethics and Morals? How do they work together? How can they be at odds with each other? (Please respond in terms of a medical setting. Remember you are in a Medical Law and Ethics course)
What is the difference between a flow-blocking delay and lack-of-work delay? How can each be reduced?
What is the difference between a flow-blocking delay and lack-of-work delay? How can each be reduced?
(3) How do ETF’s work? What is the difference between an ETF and Closed and Open...
(3) How do ETF’s work? What is the difference between an ETF and Closed and Open End Mutual Funds? If you are saving for your retirement does the choice have a big impact? (20 points)
8. What is the difference between how hot and cold therapy work? Give an example for...
8. What is the difference between how hot and cold therapy work? Give an example for each of what you would use it for. 9. If your client is diabetic and has an ingrown toenail and you are applying warm soaks to his foot - what are 2 (Two) signs that would indicate to you that there is a problem that you would need to report to the nurse? online come
How much work is done (by a battery, generator, or some other source of potential difference)...
How much work is done (by a battery, generator, or some other source of potential difference) in moving Avogadro's number of electrons from an initial point where the electric potential is 6.40 V to a point where the electric potential is -7.70 V? (The potential in each case is measured relative to a common reference point.) 1.3 1x What is the relationship giving the work required to move a charge through a potential difference? MJ
In Healthcare: What is the difference between an index and a registry? How can an index...
In Healthcare: What is the difference between an index and a registry? How can an index serve or help work/operations in a registry? (Use your knowledge and critical thinking to answer the second question.)
Typed please. How do motors and generators work from a physics standpoint? What’s the basic difference?...
Typed please. How do motors and generators work from a physics standpoint? What’s the basic difference? How does a transformer work?
What is the difference between DM Type 1 and DM Type 2. Discuss the difference in...
What is the difference between DM Type 1 and DM Type 2. Discuss the difference in pharmacologic treatment and why? Discuss the difference between the 4 different types of insulin (look at power point slides) and what each is used for. What is “insulin shock?” what are the signs and symptoms and how is it treated. Discuss how oral hyperglycemics such at Metformin work to reduce blood glucose level. What are the side effects, contraindications, and drug interactions of Metformin?...
7. What is the difference between independent and dependent demand, and how does this difference affect...
7. What is the difference between independent and dependent demand, and how does this difference affect inventory control? 8. What are the underlying assumptions of the basic EOQ (economic Order Quantity) model? 9. What is the relation between ordering and carrying costs if an EOQ is used?
8. What is the difference between how hot and cold therapy work? Give an example for each of what you would use it for. 9. If your client is diabetic and has an ingrown toenail and you are applying warm soaks to his foot - what are 2 (Two) signs that would indicate to you that there is a problem that you would need to report to the nurse? online come
How much work is done (by a battery, generator, or some other source of potential difference) in moving Avogadro's number of electrons from an initial point where the electric potential is 6.40 V to a point where the electric potential is -7.70 V? (The potential in each case is measured relative to a common reference point.) 1.3 1x What is the relationship giving the work required to move a charge through a potential difference? MJ
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 34 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago