Homework Answers
Option A is correct as thehormone testosterone and follicle-stimulating hormone supports the growth of male internal genitalia in the men
Add Answer to:
Question 92 (1 point) Which of the following hormones supports growth of the male internal genitalia...
e) Progesterone Question 93 (1 point) Which hormones does the posterior pituitary produce? a) Follicle stimulating...
e) Progesterone Question 93 (1 point) Which hormones does the posterior pituitary produce? a) Follicle stimulating hormone and Thyroid stimulating hormone b) Oxytocin and Antidiruetic hormone Oc) Prolactin and Human Growth hormons d) Prolactin and ACTH e) Melatonin stimulating hormone and Oxytocin Question 94 (1 point) Saved Which of the following plasma proteins plays a role in blood clotting?
QUESTION 2 Match the following hormones with their actions stimulates secretion of hormones from adrenal cortex...
QUESTION 2 Match the following hormones with their actions stimulates secretion of hormones from adrenal cortex B testosterone and maintains female sex c antidluretic hormone (ADH) Dthyroxine E parathyroid hormone Promote s growth and maintenance of male sex characteristics Increases blood sugar Increases reabsorption of sodium by kidney tubules G adrenocorticotropic homone (ACTH) H cortisol Raises blood calcium Increases metabolism in body cell 1 insulin ympathomimetic, elevates heart rate, blood pressure Stimulates water reabsorption by kidney tubules; decreases urine ●回Helps...
QUESTION 1 Match each of the following hormones with the gland that produces it. - Growth...
QUESTION 1 Match each of the following hormones with the gland that produces it. - Growth hormone - Thyroid Stimulating Hormone Adrenocorticotropic hormone A. parathyroid gland B. Kidneys C. thyroid gland D. Pancreas E. Hypothalamus F. Pituitary Gland - Antidiuretic hormone - Thyrotropin-releasing hormone C. Growth hormone releasing hormone Corticotropin releasing hormone parathyroid hormone - thyroid hormone insulin glucagon Erythropoietin
Which combination of hormones helps a mother to produce milk and nurse her baby? A. Prolactin...
Which combination of hormones helps a mother to produce milk and nurse her baby? A. Prolactin and calcitrone. B. Oxytocin and prolactin. C. Follicle stimulating hormone and luteinizing hormone D. Luteinizing hormone and oxytocin. E. Oxytocin, prolactin and luteinizing hormone. Which of the following have nontropic effects only? A. FSH B. LH C. MSH D. ACTH E. TSH All of the following are steroid hormones except A. Androgen. B. Cortisol. c. Estrogen. D. Testosterone. E. Insulin Which of the following...
just answers no explaination thanks >> Question 14 2 pts Which of the following enzymes are...
just answers no explaination thanks
>> Question 14 2 pts Which of the following enzymes are found in saliva? CCK. Renin. Aldosterone. Amylase. Question 15 2 pts Diurnal testosterone release occurs in pulses in the human male. How is this physiologically possible? Negative feedback effects of testosterone. Specialized T calcium channels located in the testes. Daily circadian rhythm of the cells of the testes, Daily pulsating release of sperm from the testes. Question 16 2 pts Question 16 2 pts...
1. What are the 2 main ways that hormones can interact with their target cells? Which...
1. What are the 2 main ways that hormones can interact with their target cells? Which chemical classes of hormones use each of the different mechanisms? Give an example of each type of hormone. 2. Hormones may interact with each other in one of 3 ways to alter body function. Describe each type of interaction and give an example of hormones involved in each one. 3. How do circulating hormones differ from paracrines & autocrines? 4. How does a portal...
QUESTION 56 Why would a doctor do blood tests on a pregnant woman? A. Normally, a...
QUESTION 56 Why would a doctor do blood tests on a pregnant woman? A. Normally, a doctor does urine tests on a pregnant woman, not blood tests. B. To make sure she was actually pregnant C. To look for risky sexually transmitted diseases or cancers D. To prove paternity, or who the father of the fetus is E. To look for risky infections, diseases, or to screen fetal blood which gets mixed into the mother's blood 1 points QUESTION...
Odd #'s Only Question Help MULTIPLE CHOICE & Which hormone is produced in the hypothal a....
Odd #'s Only Question Help
MULTIPLE CHOICE & Which hormone is produced in the hypothal a. Adrenocorticotropic hormone b. Anti-diuretic hormone c. Luteinizing hormone d. Growth hormone 1. Which set of messengers acts on neighboring cells within the same tissue? a Autocrines b. Paracrines c. Hormones d. None of the above al poral system Hormones secreted into the hypophyseal portal detected by the a Posterior pituitary b. Anterior pituitary c. Median eminence d. Infundibulum 2. Which set of messengers acts...
1 points Question 38 Where does gonadotropin hormone come from and what does it do? 1...
1 points Question 38 Where does gonadotropin hormone come from and what does it do? 1 points Question 39 Menstruation is part of the uterine cycle. Why does it happen? A. Estrogen levels increase at ovulation, causing the development of the endometrial vaginal lining in preparation for pregnancy. If there is no pregnancy, the lining is shed. B. Scientists have not entirely explained why women menstruate. C. The corpus luteum secretes estrogen and progesterone, causing development of the endometrial ovarian...
Question 8 1 pts According to hemispheric lateralization of the human brain, each hemisphere: act as...
Question 8 1 pts According to hemispheric lateralization of the human brain, each hemisphere: act as a back up to the other hemisphere when it processes sensory information and sends motor commands to the entire body of one hemisphere fails, the other hemisphere works to receive input from the sensory system from the entire body and sends motor commands to the entire body). O has a sensory area that receives input for the opposite side of the body. has a...
e) Progesterone Question 93 (1 point) Which hormones does the posterior pituitary produce? a) Follicle stimulating hormone and Thyroid stimulating hormone b) Oxytocin and Antidiruetic hormone Oc) Prolactin and Human Growth hormons d) Prolactin and ACTH e) Melatonin stimulating hormone and Oxytocin Question 94 (1 point) Saved Which of the following plasma proteins plays a role in blood clotting?
QUESTION 2 Match the following hormones with their actions stimulates secretion of hormones from adrenal cortex B testosterone and maintains female sex c antidluretic hormone (ADH) Dthyroxine E parathyroid hormone Promote s growth and maintenance of male sex characteristics Increases blood sugar Increases reabsorption of sodium by kidney tubules G adrenocorticotropic homone (ACTH) H cortisol Raises blood calcium Increases metabolism in body cell 1 insulin ympathomimetic, elevates heart rate, blood pressure Stimulates water reabsorption by kidney tubules; decreases urine ●回Helps...
QUESTION 1 Match each of the following hormones with the gland that produces it. - Growth hormone - Thyroid Stimulating Hormone Adrenocorticotropic hormone A. parathyroid gland B. Kidneys C. thyroid gland D. Pancreas E. Hypothalamus F. Pituitary Gland - Antidiuretic hormone - Thyrotropin-releasing hormone C. Growth hormone releasing hormone Corticotropin releasing hormone parathyroid hormone - thyroid hormone insulin glucagon Erythropoietin
Which combination of hormones helps a mother to produce milk and nurse her baby? A. Prolactin and calcitrone. B. Oxytocin and prolactin. C. Follicle stimulating hormone and luteinizing hormone D. Luteinizing hormone and oxytocin. E. Oxytocin, prolactin and luteinizing hormone. Which of the following have nontropic effects only? A. FSH B. LH C. MSH D. ACTH E. TSH All of the following are steroid hormones except A. Androgen. B. Cortisol. c. Estrogen. D. Testosterone. E. Insulin Which of the following...
just answers no explaination thanks
>> Question 14 2 pts Which of the following enzymes are found in saliva? CCK. Renin. Aldosterone. Amylase. Question 15 2 pts Diurnal testosterone release occurs in pulses in the human male. How is this physiologically possible? Negative feedback effects of testosterone. Specialized T calcium channels located in the testes. Daily circadian rhythm of the cells of the testes, Daily pulsating release of sperm from the testes. Question 16 2 pts Question 16 2 pts...
Odd #'s Only Question Help
MULTIPLE CHOICE & Which hormone is produced in the hypothal a. Adrenocorticotropic hormone b. Anti-diuretic hormone c. Luteinizing hormone d. Growth hormone 1. Which set of messengers acts on neighboring cells within the same tissue? a Autocrines b. Paracrines c. Hormones d. None of the above al poral system Hormones secreted into the hypophyseal portal detected by the a Posterior pituitary b. Anterior pituitary c. Median eminence d. Infundibulum 2. Which set of messengers acts...
Question 8 1 pts According to hemispheric lateralization of the human brain, each hemisphere: act as a back up to the other hemisphere when it processes sensory information and sends motor commands to the entire body of one hemisphere fails, the other hemisphere works to receive input from the sensory system from the entire body and sends motor commands to the entire body). O has a sensory area that receives input for the opposite side of the body. has a...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 51 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago