Homework Answers
Equals V,
This is because the charged surface is equipotential surface with same potential everywhere.
always differs from E
Since, E = V/d
We know that
V = k q/r
V = 9 x 10^9 x -7.09 x 10^-9/6.61 = -9.65 Volts
Hence, V = - 9.65 Volts.
Add Answer to:
An isolated, irregularly shaped piece of platinum carries -7.09 x 10 this body is about 4...
An isolated, irregularly shaped piece of platinum carries -8.39 times 10^-9 C of charge and is...
An isolated, irregularly shaped piece of platinum carries -8.39 times 10^-9 C of charge and is in electric equilibrium. The size of this body is about 4 mm. When the electric potential at some point on the metal's surface has the value V, the potential at a different point on the surface (indicate one): always differs from V. equals V. may equal V. When the electric field strength at some point on the body's surface has the value E. the...
plz answer with some notes like explation . 1. Which of the following statements are correct?...
plz answer with some notes like explation .
1. Which of the following statements are correct? The force lines of the electric field a) cannot cross each other at right angle; b) cannot originate from a negative charge; c) cannot be closed; d) cannot cross equipotential surfaces at right angle; e) cannot be parallel to each other. 2. A positive charge g is located in the center of the conducting spherical layer shown in the figure. What is the absolute...
1. Parallel plates. You have two equal but oppositely charged parallel conducting plates, separated by 10...
1. Parallel plates. You have two equal but oppositely charged parallel conducting plates, separated by 10 cm. A voltmeter shows that the potential difference between the plates is 500 V. (a) Which is at a higher potential, the positive or negative plate? (b) How big is the electric field between the plates? (c) You let go of an electron next to the negative plate. How much work does the electric field do in moving the electron to the positive plate?...
Consider a cylindrical capacitor like that shown in Fig. 24.6. Let d = rb − ra...
Consider a cylindrical capacitor like that shown in Fig. 24.6. Let d = rb − ra be the spacing between the inner and outer conductors. (a) Let the radii of the two conductors be only slightly different, so that d << ra. Show that the result derived in Example 24.4 (Section 24.1) for the capacitance of a cylindrical capacitor then reduces to Eq. (24.2), the equation for the capacitance of a parallel-plate capacitor, with A being the surface area of...
Procedure: Materials: 1. apparatus 2. 2 pieces of metal track 3. plastic or metal ball 4....
Procedure: Materials: 1. apparatus 2. 2 pieces of metal track 3. plastic or metal ball 4. timer 5. meter stick 6. micrometer 7. 2 photogates Assemble your ramp as shown in Figure (1) in the next page. Then set up photogates in location 2 and 3. Measure the diameter (in m) of the metal balls (you will need it for speed calculations). Then, measure the weight (mass) of the ball (in kg). To have a better measurement of the time,...
please, answer all questions Question 4 a) Two 8k resistors are connected as a potential divider...
please, answer all questions
Question 4 a) Two 8k resistors are connected as a potential divider with a supply p.d. of 20 mv. What is the current flowing and the p.d. across each resistor? (5 mark) b) The circuit shows four arrangements A, to D of three 2uF capacitors which arrangement has the smallest capacitance, the largest capacitance. (5 mark) Total 10 marks Space to answer Question 4 here А HAHE D HA Question 5 a) A transformer has 500...
1. Figure G: The ideal battery has an emf of 14 V. What is the current...
1. Figure G: The ideal battery has an emf of 14 V. What is the current (A) in R a) 0.200 D0.250 b) 1.00 g) 0.100 c)0.500 h)0.235 2. Figure C shows, in cross section, a spherical conducting shell that surrounds a particle of charge -2e. The shell d) 0.667 i) 1.23 e) 0.750 has a net charge of -6e. What is the magnitude (N/C) of the electric field at point P, at distance2.00 m from the j)0.820 center of...
I.(20p) Fill the following spaces with or circle the appropriate answers (can be more than one!)....
I.(20p) Fill the following spaces with or circle the appropriate answers (can be more than one!). I.1. In Tom's frame of reference, two events A and B take place at different locations along the x axis but are observed by Tom to be simultaneous. Which of the following statements is true? (1) No observers moving relative to Tom will find A and B to be simultaneous, but some may see A before B and others B before A. (2) No...
5. What was the purpose of the NaNO3 solution in this experiment? 6. Could a solution...
5. What was the purpose of the NaNO3 solution in this experiment? 6. Could a solution of NaCl be used instead of NaNO3? 7. What was the purpose of FeSO4 solution in this experiment? 8. Could a solution of FeCl, be used instead of FeSO4? 9. Could a solution of NaSO4 be used instead of FeSO4? 10. Calculate the standard cell potential for the spontaneous redox reaction between a Pb(s)/Pb(NO3)2(aq) half-cell and a Ag(s)/AgNO3(aq) half-cell. Which metal would be oxidized?...
1) Write a Reaction equation using 4- aminobenzenesulfulfonic acid (aniline derivative) and 8-ani...
1) Write a Reaction equation using 4- aminobenzenesulfulfonic
acid (aniline derivative) and 8-anilino-1-naphthalenesulfonic acid
(coupling agent). Write the mechanism.
SYNTHESIS OF AZO DYES INTRODUCTION Humans' love of color dates back almost to prehistoric times, yet it is not actually until the modern era that the full range of the rainbow has been accessible to the majority of people irn their clothes and other textiles. Ancient or medieval times have often been described as being quite splendid with their "tyrian purple"...
An isolated, irregularly shaped piece of platinum carries -8.39 times 10^-9 C of charge and is in electric equilibrium. The size of this body is about 4 mm. When the electric potential at some point on the metal's surface has the value V, the potential at a different point on the surface (indicate one): always differs from V. equals V. may equal V. When the electric field strength at some point on the body's surface has the value E. the...
plz answer with some notes like explation .
1. Which of the following statements are correct? The force lines of the electric field a) cannot cross each other at right angle; b) cannot originate from a negative charge; c) cannot be closed; d) cannot cross equipotential surfaces at right angle; e) cannot be parallel to each other. 2. A positive charge g is located in the center of the conducting spherical layer shown in the figure. What is the absolute...
1. Parallel plates. You have two equal but oppositely charged parallel conducting plates, separated by 10 cm. A voltmeter shows that the potential difference between the plates is 500 V. (a) Which is at a higher potential, the positive or negative plate? (b) How big is the electric field between the plates? (c) You let go of an electron next to the negative plate. How much work does the electric field do in moving the electron to the positive plate?...
Consider a cylindrical capacitor like that shown in Fig. 24.6. Let d = rb − ra be the spacing between the inner and outer conductors. (a) Let the radii of the two conductors be only slightly different, so that d << ra. Show that the result derived in Example 24.4 (Section 24.1) for the capacitance of a cylindrical capacitor then reduces to Eq. (24.2), the equation for the capacitance of a parallel-plate capacitor, with A being the surface area of...
Procedure: Materials: 1. apparatus 2. 2 pieces of metal track 3. plastic or metal ball 4. timer 5. meter stick 6. micrometer 7. 2 photogates Assemble your ramp as shown in Figure (1) in the next page. Then set up photogates in location 2 and 3. Measure the diameter (in m) of the metal balls (you will need it for speed calculations). Then, measure the weight (mass) of the ball (in kg). To have a better measurement of the time,...
please, answer all questions
Question 4 a) Two 8k resistors are connected as a potential divider with a supply p.d. of 20 mv. What is the current flowing and the p.d. across each resistor? (5 mark) b) The circuit shows four arrangements A, to D of three 2uF capacitors which arrangement has the smallest capacitance, the largest capacitance. (5 mark) Total 10 marks Space to answer Question 4 here А HAHE D HA Question 5 a) A transformer has 500...
1. Figure G: The ideal battery has an emf of 14 V. What is the current (A) in R a) 0.200 D0.250 b) 1.00 g) 0.100 c)0.500 h)0.235 2. Figure C shows, in cross section, a spherical conducting shell that surrounds a particle of charge -2e. The shell d) 0.667 i) 1.23 e) 0.750 has a net charge of -6e. What is the magnitude (N/C) of the electric field at point P, at distance2.00 m from the j)0.820 center of...
5. What was the purpose of the NaNO3 solution in this experiment? 6. Could a solution of NaCl be used instead of NaNO3? 7. What was the purpose of FeSO4 solution in this experiment? 8. Could a solution of FeCl, be used instead of FeSO4? 9. Could a solution of NaSO4 be used instead of FeSO4? 10. Calculate the standard cell potential for the spontaneous redox reaction between a Pb(s)/Pb(NO3)2(aq) half-cell and a Ag(s)/AgNO3(aq) half-cell. Which metal would be oxidized?...
1) Write a Reaction equation using 4- aminobenzenesulfulfonic
acid (aniline derivative) and 8-anilino-1-naphthalenesulfonic acid
(coupling agent). Write the mechanism.
SYNTHESIS OF AZO DYES INTRODUCTION Humans' love of color dates back almost to prehistoric times, yet it is not actually until the modern era that the full range of the rainbow has been accessible to the majority of people irn their clothes and other textiles. Ancient or medieval times have often been described as being quite splendid with their "tyrian purple"...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 6 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 11 hours ago