Homework Answers
Add Answer to:
Question 8 Cancer cells (select all that apply) O proliferate uncontrollably O are always inherited have...
Question 9 1 pts Why are inherited forms of cancer autosomal dominant but not fully penetrant?...
Question 9 1 pts Why are inherited forms of cancer autosomal dominant but not fully penetrant? Even if the mutation is inherited, a loss-of-funciton mutation ipmscting one allele is not expressed The inherited allele is dominant at the cellular level, but might not be expressed depending on genetic background Most inherited mutations are recessive at the cellular level Sporadic, but not inherited forms of cancer forms of cancer are caused by somatic mutation Question 10 1 pts Select true statements...
1. Why do cancer cells spread throughout the body? Select all that apply (Think: how are...
1. Why do cancer cells spread throughout the body? Select all that apply (Think: how are cancer cells different than normal cells?) __________ a. They enrich nutrients at the original site b. They have loose adherence c. They travel through blood vessels d. They do not respond to contact inhibition e. They are fragile and damage easily f. They readily respond to signals for apoptosis 2. Benign cells have which characteristics? Select all that...
1a. Which of the following would tend to stimulate metastasis? Select all that apply. production of...
1a. Which of the following would tend to stimulate metastasis? Select all that apply. production of proteases that degrade structural proteins activation of rho-GTPases production of E-cadherin reduced DNA polymerase activity 1b. You observe a tumor that is producing VEGF and FGF but not displaying angiogenesis. Which of the following could explain this observation? Select all that apply. Angiostatin is present in high concentrations There are no blood vessels nearby enough The cancer is metastatic Angiogenesis inhibitors are present in...
B cell activation requires (select ALL that apply): O T cytotoxic cells O Tcell receptor (TCR)...
B cell activation requires (select ALL that apply): O T cytotoxic cells O Tcell receptor (TCR) binding to antigen displayed in MHC-|| O antigen binding to antibody on B cell surface T cell receptor (TCR) binding to antigen displayed in MHC-I Question 3 1 pts Which statement(s) about C proteins in the complement system is true (select ALL that apply): Cproteins are always active as they circulate through the body All of the C proteins are equally important for all...
which of the following could be an effective method to suppress tumor growth in a patient? (Select all that apply) C. Developing cancer reagents that promote insulin signaling to the cell would be be...
which of the following could be an effective method to
suppress tumor growth in a patient? (Select all that
apply)
C. Developing cancer reagents that promote insulin signaling to the cell would be beneficial because it would inhibit the cell's ability to take in glucose B. Developing cancer reagents that promote the TCA cycle would be beneficial because it could diminish the Walberg effect O D. Developing cancer reagents that inhibit pyruvate kinase would be beneficial because it inhibits glycolysis...
QUESTION 8 Select all that apply to Paramecium o flagellated ciliated o have an eyespot to...
QUESTION 8 Select all that apply to Paramecium o flagellated ciliated o have an eyespot to detect light o have a contractile vacuole that allows them to survive hypotonic environments o classified in the supergroup/major clade SAR o classified in the subgroup Stramenopila o autotrophic o heterotrophic
please answer all 6 questions Question 27 3 pts TRBP is a protein important for the...
please answer all 6 questions
Question 27 3 pts TRBP is a protein important for the formation of the RISC complex. Which of the following would you expect in cells with null mutations in TRBP? o Reduced siRNA-mediated mRNA degradation o Increased miRNA-mediated translational repression o Increased deadenylase-mediated mRNA degradation o Reduced proteasome-mediated protein degradation D Question 28 3 pts A protein that binds to the 3' UTR of a VEGF mRNA and promotes deadenylation and uncapping is likely to:...
please help!! transcription? How could the presence of a hormone in the blood have an effect...
please help!!
transcription? How could the presence of a hormone in the blood have an effect on this structure? 6 points 3. What is an enhancer region and why is it important in the regulation of eukaryotic Contents Cancer Genes that cause cancer are called oncogenes. d. promoter genes. a. operator genes. b. pseudogenes.c 2A mutation in which of the following genes would be LEAST likely lead to a cancer? a. growth hormone gene b. growth hormone receptor gene c....
1 What is an imprinted gene? Select one: a. A gene that is found on a...
1 What is an imprinted gene? Select one: a. A gene that is found on a Barr body b. A gene that is silenced upon inheritance from a designated parent c. A gene that is inherited from only one parent d. A gene that is encoded on only one of the two copies of a chromosome Question 2 Which of the following is NOT a typical characteristic of cancer? Select one: a. Malignant cancers are typically not able to metastasize...
Question 1 (1 point) Saved Which of these processes must precede fertilization? a) oxidation O b)...
Question 1 (1 point) Saved Which of these processes must precede fertilization? a) oxidation O b) respiration Oc) mitosis Od) meiosis O e) mutation Question 2 (1 point) Which of the following diseases is not hereditary? O a) sickle-cell anemia O b ) cystic fibrosis c) diabetes d) arthritis O e) none of the above Question 3 (1 point) was an early pioneer in the field of genetics with his famous experiments with pea plants. a) Mendel Ob) Linnaeus OC)...
Question 9 1 pts Why are inherited forms of cancer autosomal dominant but not fully penetrant? Even if the mutation is inherited, a loss-of-funciton mutation ipmscting one allele is not expressed The inherited allele is dominant at the cellular level, but might not be expressed depending on genetic background Most inherited mutations are recessive at the cellular level Sporadic, but not inherited forms of cancer forms of cancer are caused by somatic mutation Question 10 1 pts Select true statements...
B cell activation requires (select ALL that apply): O T cytotoxic cells O Tcell receptor (TCR) binding to antigen displayed in MHC-|| O antigen binding to antibody on B cell surface T cell receptor (TCR) binding to antigen displayed in MHC-I Question 3 1 pts Which statement(s) about C proteins in the complement system is true (select ALL that apply): Cproteins are always active as they circulate through the body All of the C proteins are equally important for all...
which of the following could be an effective method to
suppress tumor growth in a patient? (Select all that
apply)
C. Developing cancer reagents that promote insulin signaling to the cell would be beneficial because it would inhibit the cell's ability to take in glucose B. Developing cancer reagents that promote the TCA cycle would be beneficial because it could diminish the Walberg effect O D. Developing cancer reagents that inhibit pyruvate kinase would be beneficial because it inhibits glycolysis...
QUESTION 8 Select all that apply to Paramecium o flagellated ciliated o have an eyespot to detect light o have a contractile vacuole that allows them to survive hypotonic environments o classified in the supergroup/major clade SAR o classified in the subgroup Stramenopila o autotrophic o heterotrophic
please answer all 6 questions
Question 27 3 pts TRBP is a protein important for the formation of the RISC complex. Which of the following would you expect in cells with null mutations in TRBP? o Reduced siRNA-mediated mRNA degradation o Increased miRNA-mediated translational repression o Increased deadenylase-mediated mRNA degradation o Reduced proteasome-mediated protein degradation D Question 28 3 pts A protein that binds to the 3' UTR of a VEGF mRNA and promotes deadenylation and uncapping is likely to:...
please help!!
transcription? How could the presence of a hormone in the blood have an effect on this structure? 6 points 3. What is an enhancer region and why is it important in the regulation of eukaryotic Contents Cancer Genes that cause cancer are called oncogenes. d. promoter genes. a. operator genes. b. pseudogenes.c 2A mutation in which of the following genes would be LEAST likely lead to a cancer? a. growth hormone gene b. growth hormone receptor gene c....
Question 1 (1 point) Saved Which of these processes must precede fertilization? a) oxidation O b) respiration Oc) mitosis Od) meiosis O e) mutation Question 2 (1 point) Which of the following diseases is not hereditary? O a) sickle-cell anemia O b ) cystic fibrosis c) diabetes d) arthritis O e) none of the above Question 3 (1 point) was an early pioneer in the field of genetics with his famous experiments with pea plants. a) Mendel Ob) Linnaeus OC)...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 3 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago