When diamond oxidizes (burns), heat is released: C(s) diamond O2(g) - CO, (a): AH = 395.4...

Question

Question

Answer 1

Answer #1

AS per given Infor mation C(s) diamond mole 3 95 4 kJ/ care seleased C3) diamond mole oreieased 395.4 Por than 15400 seleased

Answer 2

Similar Homework Help Questions

Coal burns in oxygen exothermically as shown below: C(s) + O2(g) → CO2 (g) AH =...

Coal burns in oxygen exothermically as shown below: C(s) + O2(g) → CO2 (g) AH = -393.5 kJ What amount of heat will be released when 100.0 g of it is burned? Molar mass of C = 12.01/mol -3935 kJ -0.3930 kJ -3276 kJ -4726 kJ
4 Fe(s) + 3 O2(g) → 2 Fe2O3(s) AH = -1652 kJ (a) How much heat is released when 3.54 mol iron are reacted with exce...

4 Fe(s) + 3 O2(g) → 2 Fe2O3(s) AH = -1652 kJ (a) How much heat is released when 3.54 mol iron are reacted with excess O2? Ok] (b) How much heat is released when 1.48 mol Fe2O3 is produced? CJ) (c) How much heat is released when 2.50 g iron are reacted with excess O2? DJ (d) How much heat is released when 12.6 g Fe and 1.02 g O2 are reacted? CkJ
c. How much heat is released when iting reacts to 4.59 grams of oxygen? AS da...

c. How much heat is released when iting reacts to 4.59 grams of oxygen? AS da la reacción: 4 Al(s) + 3 O2(g) → 2 Al2O3 (5) AH = 3.35 kJ/mol ¿Cuánto calor se libera cuando reaccionan 4.567g de oxigeno? (8 pts)

Gasoline (octane) burns according the following equation. 2 C3H18 (1) + 25 O2 (g) 16 CO2...

Gasoline (octane) burns according the following equation. 2 C3H18 (1) + 25 O2 (g) 16 CO2 (g) +18 H20 (1) AH°= - 10,943 kJ How much heat is released when 10 g of octane is burned? (The molar mass of C = 12.0 g/mol, the molar mass of H = 1.0 g/mol). 960 kJ 62,400 kJ 480 kJ 1920 kJ
Gasoline (octane) burns according the following equation. 2 C3H18 (1) + 25 O2 (g) 16 CO2...

Gasoline (octane) burns according the following equation. 2 C3H18 (1) + 25 O2 (g) 16 CO2 (g) +18 H20 (1) AH°= – 10,943 kJ How much heat is released when 10 g of octane is burned? (The molar mass of C = 12.0 g/mol, the molar mass of H = 1.0 g/mol). O 1920 kJ O 960 kJ 480 kJ 62,400 kJ
Consider the following reaction: C(s, diamond) + O2(g) - CO2(g) substance AHF (kJ/mol) C(s, diamond) 2.0...

Consider the following reaction: C(s, diamond) + O2(g) - CO2(g) substance AHF (kJ/mol) C(s, diamond) 2.0 CO2(g) -393.5 H20(1) -286.0 02(9) 0.0 How much heat is evolved when 1.201x101 g of C(s, diamond) is burned in excess oxygen. Answer to 4 sig figs. Assume standard conditions. Note that, by convention, a decrease in enthalpy of the system will result in a positive quantity of heat being evolved. Submit Answer Incorrect. Tries 7/99 Previous Tries How much heat is evolved when...

Enter your answer in the provided box. Diamond and graphite are two crystalline forms of carbon. At 1 atm and 25°C, dia...

Enter your answer in the provided box. Diamond and graphite are two crystalline forms of carbon. At 1 atm and 25°C, diamond changes to graphite so slowly that the enthalpy change of the process must be obtained indirectly. Determine A Hrxn for C(diamond) — Сgraphite) with equations from the following list: (1) C(diamond) + O2(g) + CO2(g) (2) 2 CO2(g) → 2 CO(g) + O2(8) (3) C(graphite) + O2(g) → CO2(g) (4) 2 CO(g) → C(graphite) + CO2(g) AH=-395.4 kJ...
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
Methanol (CH3OH) burns according to the equation 2CH3OH(l) + 3O2(g) → 2CO2(g) + 4H2O(l), ΔH°rxn =...

Methanol (CH3OH) burns according to the equation 2CH3OH(l) + 3O2(g) → 2CO2(g) + 4H2O(l), ΔH°rxn = –1454 kJ/mol. A) How much heat, in kilojoules, is given off when 150.0 g of methanol is burned? [ Select ] B) How many grams of CO2 are produced when the amount of heat determined in part A is released? [ Select ] Molar masses: CH3OH = 32.04 g/mol O2 = 32.00 g/mol CO2 = 44.01 g/mol H2O = 18.02 g/mol

. For the reaction C(s)+O2(g) CO2(g), AH = -393.5 kJ/mol. What is the amount of heat...

. For the reaction C(s)+O2(g) CO2(g), AH = -393.5 kJ/mol. What is the amount of heat (in kJ) produced during the combustion of 34.56 g of coal (pure carbon)? pec To abiod to yedmun Decide whether each of these reactinns is exothorm