We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Provide the full IUPAC name for the following molecule. HC Br H3C
What is the product of the following reaction? H3C—= 2 eq Br2 CH2CH3 - A.H3C— -CH2CH2Br D. Br CH2CH3 Br- -Br H3C CH2CH3 BO CH₃ E. CH3CBr2CH2CH2CH3 CH2CH3
What is the correct IUPAC name for the compound shown below? H3C CH3 C=C H CH2CH3 O cis-2-ethyl-2-butene (Z)-2-ethyl-2-butene O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O (Z)-3-methyl-2-pentene
Problem #3 Provide the full IUPAC name for the following molecule. H3C/ H3C
What is the systematic name (IUPAC name) of CH3CH2CH2CH(CH2CH3)CH2CH3?
what is the IUPAC name of this molecule? Question 12 What is the IUPAC name of this molecule? Br nomenclature
Problem #3 Provide the full IUPAC name for the following molecule. H3C
Write the correct IUPAC name for the following molecule. CH2-OH Hz HC-CH2-CH-CH-CH2 CH2 CH2 H3C H3C CH₂ CH3 CH3 IUPAC name: 5,6-dimethyl nonane about us creen privacy policy terms of us contact us Write the correct IUPAC name for the following molecule. сH, —он H3C нс —СН2—сн—сн—сна CH2 H3C CH2 СН3 Сна IUPAC name:
Write the common and systematic (IUPAC) names of the ether that has the following structure. H3C-O-CH2CH3 Common name: Systematic name
What is the IUPAC name of the molecule shown below HO Br Select one: O a. 7-bromo-2-cycloheptenol b. 1-bromo-3-cyclohepten-2-ol O c. 2-bromo-cycloheptenol O d. 2-bromo-6-cycloheptenol