help please, all questionsHomework Answers
Add Answer to:
help please, all questions
14. (a) (4 points) Give the product for the following aldol addition...
4. In the following reaction the aldol product C is difficult to isolate, and even without...
4. In the following reaction the aldol product C is difficult to isolate, and even without heating the dehydration product D is formed instead. Explain. ОН н NaOH Н Н.о н С 5. Draw all possible aldol products from this mixed aldol reaction (not dehydrated). NaOH + Н.о H 6. Give the major organic product from each mixed aldol reaction. Then explain why the reaction conditions favor one product instead of generating a mixture of products. NaOH a. Но Н...
3. Give the major organic aldol product for each reaction, along with the dehydration product (if...
3. Give the major organic aldol product for each reaction, along with the dehydration product (if possible) formed after heating. NaOH HO NaOH HO NaOH heat H2O 4. In the following reaction the aldol product C is difficult to isolate, and even without heating the dehydration product D is formed instead. Explain. ОН Ін 10-4 NaOH HO 5. Draw all possible aldol products from this mixed aldol reaction (not dehydrated). NaOH HO
please answer all of the 4 questions What cyclic product is formed in the intramolecular Aldol...
please answer all of the 4 questions
What cyclic product is formed in the intramolecular Aldol condensation when the following compound is treated with aqueous NaOH? OT 11 0 0 IV What is the Aldol addition product formed from reaction of the following compound with itself? ++,C#o Cาถวาย 0 0 0 What is the cyclic product formed in the intramolecular Aldol condensation when the following compound is treated with aqueous NaOH? 08 pod od IV OT O II III O...
Plz help 4 Draw all of the possible Aldol products (P-hydroxycarbonyl) for the following reaction below....
Plz help
4 Draw all of the possible Aldol products (P-hydroxycarbonyl) for the following reaction below. Condensation products are not necessary. (3 points) Ph NaOH H2O Me Aldol Products Me
2. Give the products for the following aldol reactions. (5 points each) 1. Д. ОН: Н...
2. Give the products for the following aldol reactions. (5 points each) 1. Д. ОН: Н 2. н* 3. ОН: Н ОН ".. 5. ОН + CHO 6. ОН 3. Complete the following scheme. Two step reactions will contain two boxes. 5 points MgBr H CI 5 points AICI: 2. H 3. PCC, CH2Cl2 2 points 5 points 2 points 2. H 3. H Cr04 2 points 5 points OH 2 points 1. OH 5 points Final product shows strong...
please help me in all sections asap!! Predict the product of the following reaction sequence. NaCN...
please help me in all sections asap!!
Predict the product of the following reaction sequence. NaCN 1. LiAIHA HCN 2. H2O H2N NH2 но NH2 но но CN H2N H2N IV We were unable to transcribe this imagePredict the product for the following reaction. ОН excess 1. NH2NH2/H 2. KOH/ H2O/A NNH2 CH H_NHNH2 NH OH 0 CH CH NNH OH HO NHNH 0 NH IV v Predict the product of the following reaction sequence. NaCN HCN NH2 H2N но...
The following compound undergoes an intramolecular Robinson annulation reaction consisting of a conjugate addition followed by...
The following compound undergoes an intramolecular Robinson annulation reaction consisting of a conjugate addition followed by an aldol condensation. Draw the final product. No mechanism needed. Question 3 ( 5 points ) СН3 HO molargla H3C Create OscerSketch Answer 3 Question 4 Predict the product of the following reaction sequence. Draw the single main product structure only. ( 5 points ) H3C LDA (acid workup) Create OscerSketch Answer 4
14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH 14. (4 points...
14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH
14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH
1. Give the major product of the following reactions, write NR. if no reaction happens. Indicate the stereochemistr...
1. Give the major product of the following reactions, write NR. if no reaction happens. Indicate the stereochemistry if necessary CHCI KOC(CH3). (CH),COH 1. conc. HBr, heat 2. KOBU, HOBU 1. NaOM, MOH CI 2. BICN 1. 1 eq. BH3. THE 2. H2O2, NaOH, H2O 3. Hg(OAC), MeOH 4. NaBH4, NaOH, H2O 1. conc. HCI 2. LDA, THF 3. O. CH,OH 4.(CH), 1. Hg(OAC), THE 2. NaBH, NaOH, H2O > OH (Hint: product has a bicyclic ring)
Question 28 (4 points) The product formed by the following reaction sequence is 1) C12, AIC13...
Question 28 (4 points) The product formed by the following reaction sequence is 1) C12, AIC13 2) HNO3/H2SO4 3) Fe, HCI 4) NaNO2, HCI 5) KCN CI CN NH2 CI CN O CI NH2
4. In the following reaction the aldol product C is difficult to isolate, and even without heating the dehydration product D is formed instead. Explain. ОН н NaOH Н Н.о н С 5. Draw all possible aldol products from this mixed aldol reaction (not dehydrated). NaOH + Н.о H 6. Give the major organic product from each mixed aldol reaction. Then explain why the reaction conditions favor one product instead of generating a mixture of products. NaOH a. Но Н...
3. Give the major organic aldol product for each reaction, along with the dehydration product (if possible) formed after heating. NaOH HO NaOH HO NaOH heat H2O 4. In the following reaction the aldol product C is difficult to isolate, and even without heating the dehydration product D is formed instead. Explain. ОН Ін 10-4 NaOH HO 5. Draw all possible aldol products from this mixed aldol reaction (not dehydrated). NaOH HO
please answer all of the 4 questions
What cyclic product is formed in the intramolecular Aldol condensation when the following compound is treated with aqueous NaOH? OT 11 0 0 IV What is the Aldol addition product formed from reaction of the following compound with itself? ++,C#o Cาถวาย 0 0 0 What is the cyclic product formed in the intramolecular Aldol condensation when the following compound is treated with aqueous NaOH? 08 pod od IV OT O II III O...
Plz help
4 Draw all of the possible Aldol products (P-hydroxycarbonyl) for the following reaction below. Condensation products are not necessary. (3 points) Ph NaOH H2O Me Aldol Products Me
2. Give the products for the following aldol reactions. (5 points each) 1. Д. ОН: Н 2. н* 3. ОН: Н ОН ".. 5. ОН + CHO 6. ОН 3. Complete the following scheme. Two step reactions will contain two boxes. 5 points MgBr H CI 5 points AICI: 2. H 3. PCC, CH2Cl2 2 points 5 points 2 points 2. H 3. H Cr04 2 points 5 points OH 2 points 1. OH 5 points Final product shows strong...
please help me in all sections asap!!
Predict the product of the following reaction sequence. NaCN 1. LiAIHA HCN 2. H2O H2N NH2 но NH2 но но CN H2N H2N IV We were unable to transcribe this imagePredict the product for the following reaction. ОН excess 1. NH2NH2/H 2. KOH/ H2O/A NNH2 CH H_NHNH2 NH OH 0 CH CH NNH OH HO NHNH 0 NH IV v Predict the product of the following reaction sequence. NaCN HCN NH2 H2N но...
The following compound undergoes an intramolecular Robinson annulation reaction consisting of a conjugate addition followed by an aldol condensation. Draw the final product. No mechanism needed. Question 3 ( 5 points ) СН3 HO molargla H3C Create OscerSketch Answer 3 Question 4 Predict the product of the following reaction sequence. Draw the single main product structure only. ( 5 points ) H3C LDA (acid workup) Create OscerSketch Answer 4
14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH
14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH
1. Give the major product of the following reactions, write NR. if no reaction happens. Indicate the stereochemistry if necessary CHCI KOC(CH3). (CH),COH 1. conc. HBr, heat 2. KOBU, HOBU 1. NaOM, MOH CI 2. BICN 1. 1 eq. BH3. THE 2. H2O2, NaOH, H2O 3. Hg(OAC), MeOH 4. NaBH4, NaOH, H2O 1. conc. HCI 2. LDA, THF 3. O. CH,OH 4.(CH), 1. Hg(OAC), THE 2. NaBH, NaOH, H2O > OH (Hint: product has a bicyclic ring)
Question 28 (4 points) The product formed by the following reaction sequence is 1) C12, AIC13 2) HNO3/H2SO4 3) Fe, HCI 4) NaNO2, HCI 5) KCN CI CN NH2 CI CN O CI NH2
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 18 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago