Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
9-17. Syntheses: draw / provide the likely organic product(s) generated in each of the reactions (or...
(4 pts each, unless otherwise noted, 47 pts total) 9-17. Syntheses: draw / provide the likely...
(4 pts each, unless otherwise noted, 47 pts total) 9-17. Syntheses: draw / provide the likely organic product(s) generated in each of the reactions (or reaction sequences) below. As appropriate, pay attention to regiospecificity (new bond formation and location in the product formed) and stereochemistry (direction in space of new bond(s) formed). Indicate ALL likely products; where one product does not predominate, label / indicate the MAJOR product(s). Where a product mix results, indicate the MINOR or TRACE product(s). (12...
(4 pts each, unless otherwise noted, 45 pts total) 10-18. Syntheses: draw / provide the likely...
(4 pts each, unless otherwise noted, 45 pts total) 10-18. Syntheses: draw / provide the likely organic product(s) generated in each of the reactions (or reaction sequences) below. As appropriate, pay attention to regiospecificity (new bond formation and location in the product formed) and stereochemistry (direction in space of new bond(s) formed). Indicate ALL likely products: where one product does not predominate, label / indicate the MAJOR or predominant product(s). Where a product mix results, indicate the MINOR or TRACE...
Organic chemistry mechanisms i need help with systheses questions 6,7,8,9 2-hydroxybenzoic (3 pts) 5. Provide an...
Organic chemistry mechanisms
i need help with systheses questions 6,7,8,9
2-hydroxybenzoic (3 pts) 5. Provide an appropriate structure for: 3,3-dimethylcyclobutanecarbonitrile. (4 pts each, unless otherwise noted, 12 pts total) 6-8. Syntheses: draw / provide the likely organic product(s) generated in each of the reactions (or reaction sequences) below. As appropriate, pay attention to regiospecificity (new bond formation and location in the product formed) and stereochemistry (direction in space of new bond(s) formed). Indicate ALL likely products: where one product does...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. HI H) 1) CH3Li CrO3, H2SO4 1) H 2) H30+ H20 (xs) CI mCPBA (CH3)3COK J) (CH3)3COH CHCI2 K) H2SO4, 1800C OH Nah, DMSO...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H ) 1) CH3Li CrO2, H2S04 1) H 2) H30+ H2O (xs) CI mCPBA (CH3)3COK J) (CH3)3COH CH2Cl2 K) H2SO4, 1800C OH NaH,...
Help sos 1. Show the expected product(s) of the following reactions. For products containin or cis/trar...
Help sos
1. Show the expected product(s) of the following reactions. For products containin or cis/trar asymmetric carbon atoms, indicate relative stereochemistry (syn/anti relationships) and/or whether a racemic mixture is produced. (8 pts each) 1. HNO3, H2so4 NO 2. Fe, HCI OCH3 3. NaNO2 aq. HCI 4, CuCN, Δ сно но 1. Br2 H20 2. Fe SO)S b. HO- -H OH s CH2OH 1. SOCI2 2. NH3 H3C 3. Br2 NaOH, H2O 1. KOH 2. PhCH2CH Br 3. NH2NH2 d....
6. (60 pts) Provide the major organic product(s) of the reactions below, including any stereoisomers formed...
6. (60 pts) Provide the major organic product(s) of the
reactions below, including any stereoisomers formed in substantial
amounts. You may write ‘racemic’ to indicate a pair of enantiomeric
products. Assume that all the chiral starting materials are single
enantiomers.
1) KOIBU 8 2) Og, then S(CH3)2 1) O 2) H.02 e 1) NaP, NH, (0) 2) C1, CH2Cl2 PBrg, Pyridine é 8 3 1) NaN 2) H2O
2. Reactions: (27 pts) Draw the structure of the expected organic product(s) formed in the following...
2. Reactions: (27 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. H2, Pd/C Cla, hv A) Br CH2OH B) C) CH2CH2CH2OH H2SO4 NaBH4 SOCI2 D) H CH3CH2OH TEA OTS CH3 SNa E) DMSO OH PCC...
(4 pts each, unless otherwise noted, 47 pts total) 9-17. Syntheses: draw / provide the likely organic product(s) generated in each of the reactions (or reaction sequences) below. As appropriate, pay attention to regiospecificity (new bond formation and location in the product formed) and stereochemistry (direction in space of new bond(s) formed). Indicate ALL likely products; where one product does not predominate, label / indicate the MAJOR product(s). Where a product mix results, indicate the MINOR or TRACE product(s). (12...
(4 pts each, unless otherwise noted, 45 pts total) 10-18. Syntheses: draw / provide the likely organic product(s) generated in each of the reactions (or reaction sequences) below. As appropriate, pay attention to regiospecificity (new bond formation and location in the product formed) and stereochemistry (direction in space of new bond(s) formed). Indicate ALL likely products: where one product does not predominate, label / indicate the MAJOR or predominant product(s). Where a product mix results, indicate the MINOR or TRACE...
Organic chemistry mechanisms
i need help with systheses questions 6,7,8,9
2-hydroxybenzoic (3 pts) 5. Provide an appropriate structure for: 3,3-dimethylcyclobutanecarbonitrile. (4 pts each, unless otherwise noted, 12 pts total) 6-8. Syntheses: draw / provide the likely organic product(s) generated in each of the reactions (or reaction sequences) below. As appropriate, pay attention to regiospecificity (new bond formation and location in the product formed) and stereochemistry (direction in space of new bond(s) formed). Indicate ALL likely products: where one product does...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. HI H) 1) CH3Li CrO3, H2SO4 1) H 2) H30+ H20 (xs) CI mCPBA (CH3)3COK J) (CH3)3COH CHCI2 K) H2SO4, 1800C OH Nah, DMSO...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H ) 1) CH3Li CrO2, H2S04 1) H 2) H30+ H2O (xs) CI mCPBA (CH3)3COK J) (CH3)3COH CH2Cl2 K) H2SO4, 1800C OH NaH,...
Help sos
1. Show the expected product(s) of the following reactions. For products containin or cis/trar asymmetric carbon atoms, indicate relative stereochemistry (syn/anti relationships) and/or whether a racemic mixture is produced. (8 pts each) 1. HNO3, H2so4 NO 2. Fe, HCI OCH3 3. NaNO2 aq. HCI 4, CuCN, Δ сно но 1. Br2 H20 2. Fe SO)S b. HO- -H OH s CH2OH 1. SOCI2 2. NH3 H3C 3. Br2 NaOH, H2O 1. KOH 2. PhCH2CH Br 3. NH2NH2 d....
6. (60 pts) Provide the major organic product(s) of the
reactions below, including any stereoisomers formed in substantial
amounts. You may write ‘racemic’ to indicate a pair of enantiomeric
products. Assume that all the chiral starting materials are single
enantiomers.
1) KOIBU 8 2) Og, then S(CH3)2 1) O 2) H.02 e 1) NaP, NH, (0) 2) C1, CH2Cl2 PBrg, Pyridine é 8 3 1) NaN 2) H2O
2. Reactions: (27 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. H2, Pd/C Cla, hv A) Br CH2OH B) C) CH2CH2CH2OH H2SO4 NaBH4 SOCI2 D) H CH3CH2OH TEA OTS CH3 SNa E) DMSO OH PCC...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago