Calculate the pH and equilibrium concentrations of a 0.46M salt solution of sodium cyanide NaCN in...
Calculate the pH and equilibrium concentrations of a 0.46M salt solution of sodium cyanide NaCN in water. Write the balanced chemical reaction(s) and show your work. Ka(HCN) = 4.0x10-10. For the concentrations, input only the numeric answer.
What is the pH?
What is the HCN concentration?
What is the CN- concentration?
What is the OH- concentration?
What are the units of concentration?
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Calculate the pH and equilibrium concentrations of a 0.46M salt
solution of sodium cyanide NaCN in...
Consider a 0.375 M aqueous solution of sodium cyanide (NaCN). A) Write the reaction of the...
Consider a 0.375 M aqueous solution of sodium cyanide (NaCN). A) Write the reaction of the cyanide anion (CN-) with water. B) Calculate [OH-], pOH, pH. Also, calculate percent ionization. (Obeys 5% rule). (Ka of HCN = 4.9 x 10^-10)
Consider a 0.20 M solution of the salt, sodium cyanide, NaCN. A) What acid and What...
Consider a 0.20 M solution of the salt, sodium cyanide, NaCN. A) What acid and What base reacted to from this salt? B) Classify the acid above as a strong or weal acid. Classify the base as a strong or weak base? C) Will the salt solution be acidic, basic, or neutural? D) Calculate the ph of the solution? The Ka of HCN is 4.9 x 10-10?
1) Cyanide salts such as Sodium Cyanide (NaCN) are among the most rapidly acting of all...
1) Cyanide salts such as Sodium Cyanide (NaCN) are among the most rapidly acting of all known poisons and act by inhibiting respiration. a. Determine the pH of a solution of 0.054M Sodium Cyanide (NaCN) (assuming complete dissociation) and state whether sodium cyanide is an acidic basic or neutral salt (Ka HCN = 4.9x10-9) (6 marks) Chemistry Class
REterencES Calculate the OH concentration and pH of a 1.8 x 10 M aqueous solution of...
REterencES Calculate the OH concentration and pH of a 1.8 x 10 M aqueous solution of sodium cyanide, NaCN. Finally, calculate the CN concentration. (Ka(HCN)= 4.9 x 10-10) M [Hol pH [CN )-
Calculate pH of a salt solution. What is the pH of a 0.172 M aqueous solution...
Calculate pH of a salt solution. What is the pH of a 0.172 M aqueous solution of sodium cyanide, NaCN? (K for HCN = 4.0x1010) pH
The pH of an aqueous solution of 0.210 M sodium cyanide, NaCN (aq), is This solution...
The pH of an aqueous solution of 0.210 M sodium cyanide, NaCN (aq), is This solution is
4. Calculate the pH of an 8.27 x 10-3M solution of sodium cyanide, NaCN. Show transcribed...
4. Calculate the pH of an 8.27 x 10-3M solution of sodium cyanide, NaCN.
A buffer solution contains 0.58 mol of hydrocyanic acid (HCN) and 0.68 mol of sodium cyanide...
A buffer solution contains 0.58 mol of hydrocyanic acid (HCN) and 0.68 mol of sodium cyanide (NaCN) in 3.00 L. The Ka of hydrocyanic acid (HCN) is Ka = 4.9e-10. (a) What is the pH of this buffer? pH = (b) What is the pH of the buffer after the addition of 0.46 mol of NaOH? (assume no volume change) pH = (c) What is the pH of the original buffer after the addition of 0.23 mol of HI? (assume...
A 500.0 mL solution of NaCN was prepared from a 12.0g sample. What is the pH of the solution? (Ka for HCN is 4.0x10^-10)...
A 500.0 mL solution of NaCN was prepared from a 12.0g sample. What is the pH of the solution? (Ka for HCN is 4.0x10^-10)
Calculate the pH of a solution that is prepared by dissolving 0.470 mol of hydrocyanic acid...
Calculate the pH of a solution that is prepared by dissolving 0.470 mol of hydrocyanic acid (HCN, Ka = 6.17×10-10) and 0.180 mol of nitrous acid (HNO2, Ka = 4.60×10-4) in water and diluting to 2.30 L. Also, calculate the equilibrium concentrations of HCN, CN-, HNO2, and NO2-. Do not make an approximation unless the initial acid concentration is greater than 1000 × Ka. (Hint: The pH will be determined by the stronger acid of this pair.) pH = [HCN]...
REterencES Calculate the OH concentration and pH of a 1.8 x 10 M aqueous solution of sodium cyanide, NaCN. Finally, calculate the CN concentration. (Ka(HCN)= 4.9 x 10-10) M [Hol pH [CN )-
Calculate pH of a salt solution. What is the pH of a 0.172 M aqueous solution of sodium cyanide, NaCN? (K for HCN = 4.0x1010) pH
The pH of an aqueous solution of 0.210 M sodium cyanide, NaCN (aq), is This solution is
4. Calculate the pH of an 8.27 x 10-3M solution of sodium cyanide, NaCN.
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 28 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 59 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago