Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Question 15 Which of the following is not a condition for optimum SN 1 reaction? aprotic...
Oorai Which is the better leaving group in protic solvent? 1. Which is the better leaving group in aprotic solvent?...
Oorai Which is the better leaving group in protic solvent? 1. Which is the better leaving group in aprotic solvent? I or Cl 2. Which is stronger base? I or Cl 3. Which is the stronger nucleophile in protic solvent? I or Cl 4. or CI Which is the stronger nucleophile in aprotic solvent? 5. Which is the stronger nucleophile? HO or H2N 6. 7. Which ion the better leaving group? CH,O or CH3CO2
Oorai Which is the better leaving...
+ Fit to page Page view 1. (10 pts) For the following reactions: a. Label the...
+ Fit to page Page view 1. (10 pts) For the following reactions: a. Label the Nucleophile (Nu) and whether it is strong or weak b. Label the Electrophile (E) and whether it is primary, secondary, or tertiary and circle the leaving group c. Label the Solvent and whether it is polar protic or polar aprotic d. Categorize each as preferring SN1, Preferring SN2, or could do either e Draw the product of the reaction, based upon your categorization, remember...
HWS 5: Due 10/30/2019 15 points total SN1, SN2, Elimination pt 1 1. (10 pts) For...
HWS 5: Due 10/30/2019 15 points total SN1, SN2, Elimination pt 1 1. (10 pts) For the following reactions: a. Label the Nucleophile (Nu) and whether it is strong or weak b. Label the Electrophile (E) and whether it is primary, secondary, or tertiary and circle the leaving group C. Label the Solvent and whether it is polar protic or polar aprotic d. Categorize each as preferring SN1, Preferring SN2, or could do either e. Draw the product of the...
Propose a mechanism from the reaction in the box NaOH H,CH2CH.CH DMF Use the reaction for...
Propose a mechanism from the reaction in the box
NaOH H,CH2CH.CH DMF Use the reaction for 28-32 28. What is the classification of the alkyl halide? a.) methyl b.) 1° c.) 2° d.) 30 29. Is the base strong or weak? a.) Strong b.) Weak 30. Is the solvent protic or aprotic? a.) Protic b.) Aprotic 31. According to the base and solvent, which substitution mechanism will the reaction undergo? a.) SNI b.) SN2 32. The stereochemistry of the reactant...
3. a. List the and state if( ) (10 pts ca.) i. Nucleophile (strong/weak), Basicity (strong/weak)...
3. a. List the and state if( ) (10 pts ca.) i. Nucleophile (strong/weak), Basicity (strong/weak) ii. Substrate (1°/2°/3°) iii. Leaving group (good/poor) iv. Solvent (protic/aprotic) b. Label the mechanism for the reaction (S1/S2/E1/E2) c. Draw the mechanism for the reactions and predict the major product(s). Use proper stereochemistry where necessary d. State which is the rate determining step (RDS) e. Give a rate law for each reaction. Ex: Rate=K[ A B NaSCH CH2CN OH HI MeOH
Which of the following molecules possess both stereogenic carbons and is a meso compound? For the...
Which of the following molecules possess both stereogenic
carbons and is a meso compound?
For the following molecule, which statement is correct
Which of the following will NOT increase the rate of an SN2
reaction?
6) Which of the following molecules possess both stereogenic carbons and is a meso compound? (I mark) CH3 Br Н- -ОН Н- -ОН Br Br Н. Br -OH НС Н CH2CH3 Molecule B Molecule D Molecule A Molecule C a) Molecule A b) Molecule B...
21. Which of the following is NOT considered a good leaving group? в се AOH CHOH...
21. Which of the following is NOT considered a good leaving group? в се AOH CHOH 22 are less stable, thus more reactive in a polar aprotic solvent. Polar aprotic Potential energy Protic Reaction coordinate A. Anions/Nucleophiles B. Cations/Electrophiles/Alkyl halides
please hurry medewes the best leaving group? mist the expected for product of the following reaction...
please hurry
medewes the best leaving group? mist the expected for product of the following reaction sequence? 1. A-BUOK, BUOH Question 23 What type of solvent is ethanol (EtOH)? 4. polar aprotic apolar aprotic polar protic
1. Sketeh the energy diagram for a spontaneous second order reaction. Clearly label all axis, the...
1. Sketeh the energy diagram for a spontaneous second order reaction. Clearly label all axis, the rate limiting step, transition state(a), intermediate(s), and enthalpy change. (4pta) Draw the mechanism given the following reaction: 2. (4pta) (3pts) Rank the following in decreasing strength (1-strongest) of the C-halogen bond: 3. 4. Of all halogens we talked about in lecture, which halogen is considered the best leaving group? Explain why (give 2 reasons). (4pts) 5. Rank the following in decreasing nucleophile quality (1-strongest)?...
(3 pt) For the following reactions: a) Label the substrate (1°, 2°, 3°), reagent (Good/Poor Nu,...
(3 pt) For the following reactions:
a) Label the substrate (1°, 2°, 3°), reagent (Good/Poor Nu,
Strong/Weak Base) and solvent (protic, aprotic).
b) Determine what mechanism will predominate (SN1, SN2, E1, or
E2).
c) Draw the product(s) you would expect to form, paying
attention to regioselectivity and stereoselectivity.
4. (3 pt) For the following reactions: a) Label the substrate (1º, 2º, 3º), reagent (Good/Poor Nu, Strong/Weak Base) and solvent (protic, aprotic). b) Determine what mechanism will predominate (SN1, SN2, E1,...
Oorai Which is the better leaving group in protic solvent? 1. Which is the better leaving group in aprotic solvent? I or Cl 2. Which is stronger base? I or Cl 3. Which is the stronger nucleophile in protic solvent? I or Cl 4. or CI Which is the stronger nucleophile in aprotic solvent? 5. Which is the stronger nucleophile? HO or H2N 6. 7. Which ion the better leaving group? CH,O or CH3CO2
Oorai Which is the better leaving...
+ Fit to page Page view 1. (10 pts) For the following reactions: a. Label the Nucleophile (Nu) and whether it is strong or weak b. Label the Electrophile (E) and whether it is primary, secondary, or tertiary and circle the leaving group c. Label the Solvent and whether it is polar protic or polar aprotic d. Categorize each as preferring SN1, Preferring SN2, or could do either e Draw the product of the reaction, based upon your categorization, remember...
HWS 5: Due 10/30/2019 15 points total SN1, SN2, Elimination pt 1 1. (10 pts) For the following reactions: a. Label the Nucleophile (Nu) and whether it is strong or weak b. Label the Electrophile (E) and whether it is primary, secondary, or tertiary and circle the leaving group C. Label the Solvent and whether it is polar protic or polar aprotic d. Categorize each as preferring SN1, Preferring SN2, or could do either e. Draw the product of the...
Propose a mechanism from the reaction in the box
NaOH H,CH2CH.CH DMF Use the reaction for 28-32 28. What is the classification of the alkyl halide? a.) methyl b.) 1° c.) 2° d.) 30 29. Is the base strong or weak? a.) Strong b.) Weak 30. Is the solvent protic or aprotic? a.) Protic b.) Aprotic 31. According to the base and solvent, which substitution mechanism will the reaction undergo? a.) SNI b.) SN2 32. The stereochemistry of the reactant...
3. a. List the and state if( ) (10 pts ca.) i. Nucleophile (strong/weak), Basicity (strong/weak) ii. Substrate (1°/2°/3°) iii. Leaving group (good/poor) iv. Solvent (protic/aprotic) b. Label the mechanism for the reaction (S1/S2/E1/E2) c. Draw the mechanism for the reactions and predict the major product(s). Use proper stereochemistry where necessary d. State which is the rate determining step (RDS) e. Give a rate law for each reaction. Ex: Rate=K[ A B NaSCH CH2CN OH HI MeOH
Which of the following molecules possess both stereogenic
carbons and is a meso compound?
For the following molecule, which statement is correct
Which of the following will NOT increase the rate of an SN2
reaction?
6) Which of the following molecules possess both stereogenic carbons and is a meso compound? (I mark) CH3 Br Н- -ОН Н- -ОН Br Br Н. Br -OH НС Н CH2CH3 Molecule B Molecule D Molecule A Molecule C a) Molecule A b) Molecule B...
21. Which of the following is NOT considered a good leaving group? в се AOH CHOH 22 are less stable, thus more reactive in a polar aprotic solvent. Polar aprotic Potential energy Protic Reaction coordinate A. Anions/Nucleophiles B. Cations/Electrophiles/Alkyl halides
please hurry
medewes the best leaving group? mist the expected for product of the following reaction sequence? 1. A-BUOK, BUOH Question 23 What type of solvent is ethanol (EtOH)? 4. polar aprotic apolar aprotic polar protic
1. Sketeh the energy diagram for a spontaneous second order reaction. Clearly label all axis, the rate limiting step, transition state(a), intermediate(s), and enthalpy change. (4pta) Draw the mechanism given the following reaction: 2. (4pta) (3pts) Rank the following in decreasing strength (1-strongest) of the C-halogen bond: 3. 4. Of all halogens we talked about in lecture, which halogen is considered the best leaving group? Explain why (give 2 reasons). (4pts) 5. Rank the following in decreasing nucleophile quality (1-strongest)?...
(3 pt) For the following reactions:
a) Label the substrate (1°, 2°, 3°), reagent (Good/Poor Nu,
Strong/Weak Base) and solvent (protic, aprotic).
b) Determine what mechanism will predominate (SN1, SN2, E1, or
E2).
c) Draw the product(s) you would expect to form, paying
attention to regioselectivity and stereoselectivity.
4. (3 pt) For the following reactions: a) Label the substrate (1º, 2º, 3º), reagent (Good/Poor Nu, Strong/Weak Base) and solvent (protic, aprotic). b) Determine what mechanism will predominate (SN1, SN2, E1,...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago