= -
2633.5 kJ
Please show all work!
Homework Answers
Add Answer to:
= -
2633.5 kJ
Please show all work!
22. (20) Given the reaction to assemble solid...
4) Calculate the lattice enthalpy for calcium fluoride using the Born-Haber cycle method, using the provided...
4) Calculate the lattice enthalpy for calcium fluoride using the Born-Haber cycle method, using the provided table. (Show all your work; 2 points) Enthalpies, AH/(kJ mol) +192 Process Sublimation of Ca(s) Ionization of Ca(g) Dissociation of F2(g) Electron gain by F(g) Formation of CaF (s) +1735 to Ca(ag +157 -328 -1220
Structure with an (8,4) coordination unit cell (0) Given the b. Calcium fluorite (CaF2) has a...
Structure with an (8,4) coordination unit cell (0) Given the b. Calcium fluorite (CaF2) has a fluorite structure with an (8,4) coordina Given the following data, use Born-Haber cycle to calculate the lattice enthalpy of CaF2 AH KJ/mol +178 +1228 Sublimation of Ca(s) Decomposition of CaF2(s) Dissociation of F2(g) lonisation of Ca(s) lonisation of Ca (8) Electron gain of F(b) +79 +590 +1145 -328 Given the following data d* = 0.345x10-11m, K=1.20 MJÅ. mol-, e = 1.602x10-19 C, N =...
Help please! Show work xercise 14.16 thodynamic 2. The equilibrium constant for the following reaction is called the...
Help please! Show work
xercise 14.16 thodynamic 2. The equilibrium constant for the following reaction is called the fluoride: constant for the following reaction is called the "solubility product of calcium CaF2(s) - Ca2+(aq) + 2F (aq) K = K = 3.2 x 10-11 a write an expression for the equilibrium constant of this reaction in terms of concentrations. why do you suppose we call this a solubility product instead of a solubility quotient or ratio (b) Calculate the equilibrium...
need help to solve it. thx! Write you answers on separate paper. Show your work for...
need help to solve it. thx!
Write you answers on separate paper. Show your work for full credit. Include the version by your name. Given the following data Ca(s)+2C(graphite) → Cac, (s) AH = -62.8 kJ Ca(s)+10,(g)>CaO(s) AH; = -634.9 kJ Cao(s)+H,0(1) + Ca(OH), (aq) AH; = -653.1 kJ C,H,(g)+{0,(8) ► 200,(g)+H,0(1) AH; =-1300.2 kJ C(graphite) +0,(g) → CO2(g) AH; = -393.5 kJ calculate AH for the reaction Cac (s)+2H,0(1) Ca(OH), (aq)+C,H,(8) Using standard enthalpies of formation along with the...
Problem Solving: Show all work, units, sie fies and balanced equations needed to answer the following...
Problem Solving: Show all work, units, sie fies and balanced equations needed to answer the following 1. To make the hydrogen necessary for the manufacture of ammonia in the Haber/Bosch process a steam reforming method is used. This method combines methane gas with steam (water gas) to make hydrogen gas and carbon monoxide gas. The AH for this reaction is + 206 kJ/mole. What amount of energy is needed to produce 1 kg of hydrogen? 2. Given: P.(s) + 3...
1. Write the equilibrium constant expression for the reaction N2 (g) + 3 H2 (g) D ...
1. Write the equilibrium constant expression for the reaction N2 (g) + 3 H2 (g) D 2 NH3 (g) 2. For the reaction in question 1, delta H = -92 kj*mol^-1 Predict the direction of shift of the equilibrium of the above reaction caused by adding N2 at constant volume and temperature removing H2 at constant volume and temperature adding N2 at constant volume and temperature raising the temperature at constant total pressure 3. Hydrogen fluoride (HF) is a weak...
Please show all steps and work. ThanksTodd? < Time's Up! View Solution Using the equations H2...
Please show all steps and work. ThanksTodd?
< Time's Up! View Solution Using the equations H2 (g) + F2 (g) → 2 HF (g) AH° = -79.2 kJ/mol C(s) + 2 F2 (g) → CF4 (g) AH° = 141.3 kJ/mol Determine the enthalpy for the reaction C(s) + 4 HF (g) → CF, (g) + 2 H2 (g). | kJ/mol
Show all work and equations please 5. The value, in kJ, of AH for the reaction below is -3351 kJ. Therefore, the...
Show all work and equations please
5. The value, in kJ, of AH for the reaction below is -3351 kJ. Therefore, the value of AH for formation of 4.000 moles of Al2O3 (s) is__ kJ. 4 Al() + 3 02 (8) 2 AlO3 (9) C) -6702 kJ A) -3351 kJ D) 3351 kJ B) -1676 kJ E) 6702 kJ
to 14. (20 points) Use the following information to Show your work. e the following information...
to 14. (20 points) Use the following information to Show your work. e the following information to determine the enthalpy for the reaction shown below. CH(g) + H2O(g) → CO(g) + 3H-(8) AH = ? 2C(s) + 2H2O(g) CH.(g) + CO:(8) All = 15.3 kJ C(s) + H2O(g) → CO(g) +H;(8) AH = 131.3 kJ CO(g) + H2O(g) + CO2(g) + H:(g) AH -41.2 kJ 15. (15 points) Ethanol is being promoted as renewable biofuel. Use the standard enthalpies of...
Answer both question below. Show all work and chemical equations. 1. Using the information below answer...
Answer both question below. Show all work and chemical equations. 1. Using the information below answer questions a to c. Ca sº = 41.6 J/mol K CaCO3 (s) sº = 91.7 J/mol K AH° = -1207.6 kJ/mol O2 Sº = 205.2 J/mol K Cao (s) S0 = 38.1 J/mol K AH = -634.9 kJ/mol CO2 (g) sº = 213.8 J/mol K AH° = -393.5 kJ/mol AH° O2 = 0 kJ/mol AH° Ca= 0 kJ/mol a) Calculate AS9rxn and AH°rxn for...
4) Calculate the lattice enthalpy for calcium fluoride using the Born-Haber cycle method, using the provided table. (Show all your work; 2 points) Enthalpies, AH/(kJ mol) +192 Process Sublimation of Ca(s) Ionization of Ca(g) Dissociation of F2(g) Electron gain by F(g) Formation of CaF (s) +1735 to Ca(ag +157 -328 -1220
Structure with an (8,4) coordination unit cell (0) Given the b. Calcium fluorite (CaF2) has a fluorite structure with an (8,4) coordina Given the following data, use Born-Haber cycle to calculate the lattice enthalpy of CaF2 AH KJ/mol +178 +1228 Sublimation of Ca(s) Decomposition of CaF2(s) Dissociation of F2(g) lonisation of Ca(s) lonisation of Ca (8) Electron gain of F(b) +79 +590 +1145 -328 Given the following data d* = 0.345x10-11m, K=1.20 MJÅ. mol-, e = 1.602x10-19 C, N =...
Help please! Show work
xercise 14.16 thodynamic 2. The equilibrium constant for the following reaction is called the fluoride: constant for the following reaction is called the "solubility product of calcium CaF2(s) - Ca2+(aq) + 2F (aq) K = K = 3.2 x 10-11 a write an expression for the equilibrium constant of this reaction in terms of concentrations. why do you suppose we call this a solubility product instead of a solubility quotient or ratio (b) Calculate the equilibrium...
need help to solve it. thx!
Write you answers on separate paper. Show your work for full credit. Include the version by your name. Given the following data Ca(s)+2C(graphite) → Cac, (s) AH = -62.8 kJ Ca(s)+10,(g)>CaO(s) AH; = -634.9 kJ Cao(s)+H,0(1) + Ca(OH), (aq) AH; = -653.1 kJ C,H,(g)+{0,(8) ► 200,(g)+H,0(1) AH; =-1300.2 kJ C(graphite) +0,(g) → CO2(g) AH; = -393.5 kJ calculate AH for the reaction Cac (s)+2H,0(1) Ca(OH), (aq)+C,H,(8) Using standard enthalpies of formation along with the...
Problem Solving: Show all work, units, sie fies and balanced equations needed to answer the following 1. To make the hydrogen necessary for the manufacture of ammonia in the Haber/Bosch process a steam reforming method is used. This method combines methane gas with steam (water gas) to make hydrogen gas and carbon monoxide gas. The AH for this reaction is + 206 kJ/mole. What amount of energy is needed to produce 1 kg of hydrogen? 2. Given: P.(s) + 3...
Please show all steps and work. ThanksTodd?
< Time's Up! View Solution Using the equations H2 (g) + F2 (g) → 2 HF (g) AH° = -79.2 kJ/mol C(s) + 2 F2 (g) → CF4 (g) AH° = 141.3 kJ/mol Determine the enthalpy for the reaction C(s) + 4 HF (g) → CF, (g) + 2 H2 (g). | kJ/mol
Show all work and equations please
5. The value, in kJ, of AH for the reaction below is -3351 kJ. Therefore, the value of AH for formation of 4.000 moles of Al2O3 (s) is__ kJ. 4 Al() + 3 02 (8) 2 AlO3 (9) C) -6702 kJ A) -3351 kJ D) 3351 kJ B) -1676 kJ E) 6702 kJ
to 14. (20 points) Use the following information to Show your work. e the following information to determine the enthalpy for the reaction shown below. CH(g) + H2O(g) → CO(g) + 3H-(8) AH = ? 2C(s) + 2H2O(g) CH.(g) + CO:(8) All = 15.3 kJ C(s) + H2O(g) → CO(g) +H;(8) AH = 131.3 kJ CO(g) + H2O(g) + CO2(g) + H:(g) AH -41.2 kJ 15. (15 points) Ethanol is being promoted as renewable biofuel. Use the standard enthalpies of...
Answer both question below. Show all work and chemical equations. 1. Using the information below answer questions a to c. Ca sº = 41.6 J/mol K CaCO3 (s) sº = 91.7 J/mol K AH° = -1207.6 kJ/mol O2 Sº = 205.2 J/mol K Cao (s) S0 = 38.1 J/mol K AH = -634.9 kJ/mol CO2 (g) sº = 213.8 J/mol K AH° = -393.5 kJ/mol AH° O2 = 0 kJ/mol AH° Ca= 0 kJ/mol a) Calculate AS9rxn and AH°rxn for...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago