Homework Answers
Add Answer to:
Unit 3 Hinw '3 SNİSNDELE2 1. Give the major product(s) for the following reactions. Indicate the...
answer all three questions and circle the answers Which of the following reactions will not produce...
answer all three questions and circle the answers
Which of the following reactions will not produce the major product given? Br CH3OH (racemic) OSO?CF3 NaBr acetone но н NaBr acetone Br CH3 H CH3 CH3CH2ONa HRCH H3C CH2CH3 CH2CH3 H11.8 - Level 1 Homework . Unanswered For the given reaction, predict the major and minor products. NaCN DMF Premise Response Drag and drop to match = A Major B Minor Unanswered - Submit H11.9 - Level 1 Homework. Unanswered For...
please answer all Chemistry 420 1. For each of the following reactions, write S if it...
please answer all
Chemistry 420 1. For each of the following reactions, write S if it is a substitution and E if it is an elimination. Also write R for all of those that are also rearrangements. w = 8 2. Predict which reactions proceeded by an SI, SN2. El or E2 mechanism: NHOCHCH, OCH CHg+NaBr HOCH, CH, 50° + Naci Nal DMSO, 45° NaOCH +NaBr + HOCH HOCH, 100° H2O + HI acetone, 50° HO HOSO Hy0, 120° xha...
PART C: GIVE THE MISSING INFORMATIC REACTIONS, SHOW STEREO CHEMISTRY IF OH PBry Pyridine сно- сньон...
PART C: GIVE THE MISSING INFORMATIC REACTIONS, SHOW STEREO CHEMISTRY IF OH PBry Pyridine сно- сньон Тѕсr Pyridine NaCN Acetone CH3CH2OH NaSCH2CH3 HBr Acetone Br KOC(CH3)3 (CH3),COH OH H2SO4 Heat 1. BH3 2. H2O2/KOH Bry/H2O CH3COOH 1. Og 2. Zn/H20
the weakest base: CH3 HO HS the fastest in an Syl reaction: (CE)_CACHOSCH (CH3CB (CH.) CHCH(Br)CH, (CH),C(Br)CH (CH...
the weakest base: CH3 HO HS the fastest in an Syl reaction: (CE)_CACHOSCH (CH3CB (CH.) CHCH(Br)CH, (CH),C(Br)CH (CH3)2CHCH Br 2. For each pair of reactions given below indicate which is faster and explain your reasoning. + CHỊ N + C CH3Cl + N CH3 + Ng CH₃N₂ + i CHg. + NaCN CH, CN + Nal DMSO CH3-1 + NaCN C H, CN + Nal Cho (c) CH,0 + CH,CH,Br - HƠ + CHỊCH,Br CH,CH,OCH, + Bril CH,CH,OH + Br...
1. Give the major product of the following reactions, write NR. if no reaction happens. Indicate the stereochemistr...
1. Give the major product of the following reactions, write NR. if no reaction happens. Indicate the stereochemistry if necessary CHCI KOC(CH3). (CH),COH 1. conc. HBr, heat 2. KOBU, HOBU 1. NaOM, MOH CI 2. BICN 1. 1 eq. BH3. THE 2. H2O2, NaOH, H2O 3. Hg(OAC), MeOH 4. NaBH4, NaOH, H2O 1. conc. HCI 2. LDA, THF 3. O. CH,OH 4.(CH), 1. Hg(OAC), THE 2. NaBH, NaOH, H2O > OH (Hint: product has a bicyclic ring)
2. (16 pts) Reactions Provide reagents, products or starting materials for the following reactions. Show stereochemistry...
2. (16 pts) Reactions Provide reagents, products or starting materials for the following reactions. Show stereochemistry when relevant (or loss thereof). If a reaction produces no significant products, write "NR". If you have a question about an abbreviation, just ask. NaBr OH 1. TsCI 2. Nal, DMF CI DMSO OH 1. PBrg NaCN 2. KOC(CH3)3 Ether LDA НОН THE NaH NaH PO Acetone Heat, water
21) Which of the following reactions will produce the given product in good yield? Select all...
21) Which of the following reactions will produce the given product in good yield? Select all that apply он CH3OH a) OSO,CH3 Br NaBr (CH3)3COH b) O=U CH3 Nal c) acetone OSO,CH3 MeoNa Меон OH e) MeONa MeOH
1. For each of the following reactions, write S if it is a substitution and E...
1. For each of the following reactions, write S if it is a substitution and E if it is an elimination. Also write R for all of those that are also rearrangements. CH-Oн heat NaOCHs + HBr HG OH Nal Hо acetone NaBr +HBr 2. Predict which reactions proceeded by an SN1, SN2, El or E2 mechanism: NaOCH CH +NaBr оснCH Носн,сн, 50° +NaCl Nal DMSO, 45 Br NaOCHa +NaBr +HOCH Носн, 100° но +HI acetone, 50 HSO +HO HO,...
Part II - Reactions (16 marks] Draw the expected major product(s) for each of the following...
Part II - Reactions (16 marks] Draw the expected major product(s) for each of the following reactions. Question Answer 8. 1. NaH OH ? 2. OTs 9. NBS ? major product 10. Nal Br ? Acetone Br 11. 1. NaNH2 H3C-CECH ? 2. OTS 12. OH Br NaOH ? cyclic compound 13. OH HBT ? 14. ? OH cat. H2SO4 H20 Room temp. 15. Br MeOH
17. Draw the structure of the major organic product(s) for each of the following reactions. Indicate...
17. Draw the structure of the major organic product(s) for each of the following reactions. Indicate stereochemistry when appropriate. C(CH3)3 NASH Br (S)-2-bromononane - acetonitrile KOH CH,OH NaCN HE Br Acetonitrile C2H5 H, Br NaOH Acetone excess HBr ROOR HC1 + Br Na o DMSO
answer all three questions and circle the answers
Which of the following reactions will not produce the major product given? Br CH3OH (racemic) OSO?CF3 NaBr acetone но н NaBr acetone Br CH3 H CH3 CH3CH2ONa HRCH H3C CH2CH3 CH2CH3 H11.8 - Level 1 Homework . Unanswered For the given reaction, predict the major and minor products. NaCN DMF Premise Response Drag and drop to match = A Major B Minor Unanswered - Submit H11.9 - Level 1 Homework. Unanswered For...
please answer all
Chemistry 420 1. For each of the following reactions, write S if it is a substitution and E if it is an elimination. Also write R for all of those that are also rearrangements. w = 8 2. Predict which reactions proceeded by an SI, SN2. El or E2 mechanism: NHOCHCH, OCH CHg+NaBr HOCH, CH, 50° + Naci Nal DMSO, 45° NaOCH +NaBr + HOCH HOCH, 100° H2O + HI acetone, 50° HO HOSO Hy0, 120° xha...
PART C: GIVE THE MISSING INFORMATIC REACTIONS, SHOW STEREO CHEMISTRY IF OH PBry Pyridine сно- сньон Тѕсr Pyridine NaCN Acetone CH3CH2OH NaSCH2CH3 HBr Acetone Br KOC(CH3)3 (CH3),COH OH H2SO4 Heat 1. BH3 2. H2O2/KOH Bry/H2O CH3COOH 1. Og 2. Zn/H20
the weakest base: CH3 HO HS the fastest in an Syl reaction: (CE)_CACHOSCH (CH3CB (CH.) CHCH(Br)CH, (CH),C(Br)CH (CH3)2CHCH Br 2. For each pair of reactions given below indicate which is faster and explain your reasoning. + CHỊ N + C CH3Cl + N CH3 + Ng CH₃N₂ + i CHg. + NaCN CH, CN + Nal DMSO CH3-1 + NaCN C H, CN + Nal Cho (c) CH,0 + CH,CH,Br - HƠ + CHỊCH,Br CH,CH,OCH, + Bril CH,CH,OH + Br...
1. Give the major product of the following reactions, write NR. if no reaction happens. Indicate the stereochemistry if necessary CHCI KOC(CH3). (CH),COH 1. conc. HBr, heat 2. KOBU, HOBU 1. NaOM, MOH CI 2. BICN 1. 1 eq. BH3. THE 2. H2O2, NaOH, H2O 3. Hg(OAC), MeOH 4. NaBH4, NaOH, H2O 1. conc. HCI 2. LDA, THF 3. O. CH,OH 4.(CH), 1. Hg(OAC), THE 2. NaBH, NaOH, H2O > OH (Hint: product has a bicyclic ring)
2. (16 pts) Reactions Provide reagents, products or starting materials for the following reactions. Show stereochemistry when relevant (or loss thereof). If a reaction produces no significant products, write "NR". If you have a question about an abbreviation, just ask. NaBr OH 1. TsCI 2. Nal, DMF CI DMSO OH 1. PBrg NaCN 2. KOC(CH3)3 Ether LDA НОН THE NaH NaH PO Acetone Heat, water
21) Which of the following reactions will produce the given product in good yield? Select all that apply он CH3OH a) OSO,CH3 Br NaBr (CH3)3COH b) O=U CH3 Nal c) acetone OSO,CH3 MeoNa Меон OH e) MeONa MeOH
1. For each of the following reactions, write S if it is a substitution and E if it is an elimination. Also write R for all of those that are also rearrangements. CH-Oн heat NaOCHs + HBr HG OH Nal Hо acetone NaBr +HBr 2. Predict which reactions proceeded by an SN1, SN2, El or E2 mechanism: NaOCH CH +NaBr оснCH Носн,сн, 50° +NaCl Nal DMSO, 45 Br NaOCHa +NaBr +HOCH Носн, 100° но +HI acetone, 50 HSO +HO HO,...
Part II - Reactions (16 marks] Draw the expected major product(s) for each of the following reactions. Question Answer 8. 1. NaH OH ? 2. OTs 9. NBS ? major product 10. Nal Br ? Acetone Br 11. 1. NaNH2 H3C-CECH ? 2. OTS 12. OH Br NaOH ? cyclic compound 13. OH HBT ? 14. ? OH cat. H2SO4 H20 Room temp. 15. Br MeOH
17. Draw the structure of the major organic product(s) for each of the following reactions. Indicate stereochemistry when appropriate. C(CH3)3 NASH Br (S)-2-bromononane - acetonitrile KOH CH,OH NaCN HE Br Acetonitrile C2H5 H, Br NaOH Acetone excess HBr ROOR HC1 + Br Na o DMSO
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 28 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago