Reaction of metals with Oxygen: metal + O2 (air) --> metal oxides Metals used: iron, tin,...
Reaction of metals with Oxygen: metal + O2 (air) --> metal oxides
Metals used: iron, tin, copper, magnesium, aluminum, and zinc
1) of these metals, do any burn (react) with oxygen?
2) Could you suggest an ingredient for making flares?
Homework Answers
Add Answer to:
Reaction of metals with Oxygen: metal + O2 (air)
--> metal oxides
Metals used: iron, tin,...
Which of the following metals could really be used as sacrificial anodes for iron (Fe2+(aq) +...
Which of the following metals could really be used as sacrificial anodes for iron (Fe2+(aq) + 2e??Fe(s), E0 =-0.44V )? A) Tin F) Magnesium B) Zinc G) Lithium C) Aluminum H) Copper D) Lead I) Nickel E) Sodium J) None of the above Enter all that apply in alphabetical order (e.g. AB, ABDF, etc.)
1. A 0.750-g sample of tin metal reacts with 0.201 g of oxygen gas to form tin oxide.
1. A 0.750-g sample of tin metal reacts with 0.201 g of oxygen gas to form tin oxide. Calculate the empirical formula of the tin oxide. 2. A 0.565-g sample of cobalt metal reacts with excess sulfur to give 1.027 g of cobalt sulfide. Calculate the empirical formula of the product. 3. A 1.164-g sample of iron filings reacts with chlorine gas to give 3.384 g of iron chloride. Calculate the empirical formula of the product? 4. A 0.626-8 sample of copper oxide...
Q1: It is observed that tin (Sn) will dissolve in acid, but it will not react...
Q1: It is observed that tin (Sn) will dissolve in acid, but it will not react with ZnSO4 solution. Where does tin fit in the activity series that you determined? What additional test(s) would be needed to determine the precise position of tin in the activity series relative to the other metals? Q2: (a) Would copper react with zinc (II) chloride? (b) If so, write the molecular equation. Under the molecular equation write the complete ionic equation and put an...
Write a balanced chemical equation for each reaction. If no reaction occurred, write "N.R."): Magnesium and...
Write a balanced chemical equation for each reaction. If no reaction occurred, write "N.R."): Magnesium and hydrochloric acid: Zine and hydrochloric acid: Copper and hydrochloric acid: 3. Metals reacting with a non-metal (oxygen); metal oxides reacting with water Write a balanced chemical equation for each reaction. Magnesium and oxygen: Calcium and oxygen What happened when magnesium oxide and calcium oxide were added to water containing phenol phthalein indicator? What differences, if any, did you observe? Turns basic Water turns Pince...
Questions: 1. Compare the burning of each element in air and in the oxygen bottle. 4....
Questions: 1. Compare the burning of each element in air and in the oxygen bottle. 4. Does ferric oxide appear to be soluble in water? Relate this observation with the acid/hase test. 5. What type of elements form oxides that produce acidic solutions? What type of elements form oxides that produce basic properties? Is there any relationship between acidic or basic properties of the oxides and the position of the element in the periodic table? 6. Explain whether we would...
When exposed to air, aluminum metal, Al, reacts with oxygen, O2, to produce a protective coating of aluminum oxide, Al2O...
When exposed to air, aluminum metal, Al, reacts with oxygen, O2, to produce a protective coating of aluminum oxide, Al2O3, which prevents the aluminum from rusting underneath. The balanced reaction is shown here: 4Al+3O2→2Al2O3 a. What is the theoretical yield of aluminum oxide if 1.60 mol of aluminum metal is exposed to 1.50 mol of oxygen?
When exposed to air, aluminum metal, Al, reacts with oxygen, O2, to produce a protective coating...
When exposed to air, aluminum metal, Al, reacts with oxygen, O2, to produce a protective coating of aluminum oxide, Al2O3, which prevents the aluminum from rusting underneath. The balanced reaction is shown here: 4Al+3O2→2Al2O3 In Part A, we saw that the theoretical yield of aluminum oxide is 1.90 mol . Calculate the percent yield if the actual yield of aluminum oxide is 1.18 mol .
Magnesium oxide can be made by heating magnesium metal in the presence of the oxygen. The...
Magnesium oxide can be made by heating magnesium metal in the presence of the oxygen. The balanced equation for the reaction is 2 Mg(s)+O2(g) 2 MgO(s) Consider that you react 12.62 g Mg with 13.08 g O2 gas. What is the theoretical yield of MgO that can be generated from this reaction? Enter a numerical answer only to three significant figures, in terms of grams.
+ + + + + + + + + Metal Oxidation Reaction Lithium Li(s) - Li+...
+ + + + + + + + + Metal Oxidation Reaction Lithium Li(s) - Li+ (aq) Potassium K(s) K+ (aq) Barium Ba(s) Ba2+ (aq) Calcium Ca(s) Ca2+ (aq) Sodium Na(s) Na+ (aq) Magnesium Mg(s) Mg2+ (aq) Aluminum Al(s) A13+(aq) Manganese Mn(s) Mn2+ (aq) Zn(s) Zn2+ (aq) Chromium Cr(s) Cr3+ (aq) Iron Fe(s) Fe2+ (aq) Cobalt Co(s) Co2+ (aq) Nickel Ni(s) Ni2+ (aq) Tin Sn(s) Sn2+ (aq) Lead Pb(s) Hydrogen H2(8) Copper Cu(s) Cu2+ (aq) Silver Ag(s) Ag+ (aq) Mercury...
1. Active metals reacting with water A. and B. Sodium and Potassium. Describe the reactions which...
1. Active metals reacting with water A. and B. Sodium and Potassium. Describe the reactions which you observed. What differences, if any, did you notice? Soolium:exPlosion fire occurned -exothrmic Potassium Fire no explosion -exother m Write a balanced chemical equation for each reaction. Sodium and water: Potassium and water: C and D. Magnesium and Calcium. Describe the reactions which you observed. Which m reacted more readily with water? How do you know? Calium, because it turned the saluhion pinl ulded...
Write a balanced chemical equation for each reaction. If no reaction occurred, write "N.R."): Magnesium and hydrochloric acid: Zine and hydrochloric acid: Copper and hydrochloric acid: 3. Metals reacting with a non-metal (oxygen); metal oxides reacting with water Write a balanced chemical equation for each reaction. Magnesium and oxygen: Calcium and oxygen What happened when magnesium oxide and calcium oxide were added to water containing phenol phthalein indicator? What differences, if any, did you observe? Turns basic Water turns Pince...
Questions: 1. Compare the burning of each element in air and in the oxygen bottle. 4. Does ferric oxide appear to be soluble in water? Relate this observation with the acid/hase test. 5. What type of elements form oxides that produce acidic solutions? What type of elements form oxides that produce basic properties? Is there any relationship between acidic or basic properties of the oxides and the position of the element in the periodic table? 6. Explain whether we would...
Magnesium oxide can be made by heating magnesium metal in the presence of the oxygen. The balanced equation for the reaction is 2 Mg(s)+O2(g) 2 MgO(s) Consider that you react 12.62 g Mg with 13.08 g O2 gas. What is the theoretical yield of MgO that can be generated from this reaction? Enter a numerical answer only to three significant figures, in terms of grams.
+ + + + + + + + + Metal Oxidation Reaction Lithium Li(s) - Li+ (aq) Potassium K(s) K+ (aq) Barium Ba(s) Ba2+ (aq) Calcium Ca(s) Ca2+ (aq) Sodium Na(s) Na+ (aq) Magnesium Mg(s) Mg2+ (aq) Aluminum Al(s) A13+(aq) Manganese Mn(s) Mn2+ (aq) Zn(s) Zn2+ (aq) Chromium Cr(s) Cr3+ (aq) Iron Fe(s) Fe2+ (aq) Cobalt Co(s) Co2+ (aq) Nickel Ni(s) Ni2+ (aq) Tin Sn(s) Sn2+ (aq) Lead Pb(s) Hydrogen H2(8) Copper Cu(s) Cu2+ (aq) Silver Ag(s) Ag+ (aq) Mercury...
1. Active metals reacting with water A. and B. Sodium and Potassium. Describe the reactions which you observed. What differences, if any, did you notice? Soolium:exPlosion fire occurned -exothrmic Potassium Fire no explosion -exother m Write a balanced chemical equation for each reaction. Sodium and water: Potassium and water: C and D. Magnesium and Calcium. Describe the reactions which you observed. Which m reacted more readily with water? How do you know? Calium, because it turned the saluhion pinl ulded...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 8 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago