Ans. Note that dH of the reaction = -55.5 kJ but NOT “-55.5 kJ/mol”. The value of MOLAR enthalpy, dHmolar may vary depending on the given reaction. So, follows the steps explained below-
# Note the following reactions-
#1. A(aq) + B(aq) ------> C(s) ; dH = -55.5 kJ
The dH for the reaction, i.e. formation of 1 mol precipitate, C(s), is -55.5 kJ.
So,
dHmolar = dH / moles of precipitate formed = (-55.5 kJ) / 1 mol = -55.5 kJ mol-1
Now,
Theoretical amount heat released during reaction = dHmolar x Moles of ppt. formed
= (-55.5 kJ mol-1) x 3.31 mol
= -183.705 kJ
#2. A(aq) + B(aq) ------> 2C(s) ; dH = -55.5 kJ
The dH for the reaction, i.e. formation of 2 mol precipitate, C(s), is -55.5 kJ.
So,
dHmolar = dH / moles of precipitate formed = (-55.5 kJ) / 2 mol = -27.75 kJ mol-1
Now,
Theoretical amount heat released during reaction = dHmolar x Moles of ppt. formed
= (-27.75 kJ mol-1) x 3.31 mol
= -91.8525 kJ
# Conclusion: If the given dH is in terms of “-55.5 kJ / mol” follow #1.
However, if dH of the reaction is given only as “-55.5 kJ”, first calculate dHmolar, then calculate the expected/theoretical amount of heat released.
How to calculate heat release given moles of precipitate and delta H of the reaction? Ex:...
for the reaction S(s)+O2(g)=SO2(g) delta H=-296 kJ per mole of SO2 formed calculate the quantity of heat released when 2.78g of sulfur is burned in oxygen=
how can i find the delta h of the reaction and the average delta h of the reacting in kj? Chemistry 1A Name Lab Partner Trial 1 Trial 2 Calorimeter Constant (Cel) from Part 1 - 462 Grın (heat released by reaction, in J) = AH =(heat absorbed by mixture + Cat AT) show calculations 103 6.35 + (-462/c- 9.4°c). cran : AM. - 3306,5 J - 2306.55 Moles of metal used. show calculations 0.4397n ( stan): 0.00066 mol en...
The overall reaction in a commercial heat pack can be represented as 4Fe(s) + 3O_2 (g) right arrow 2Fe_2 O_3(s) delta H = -1652 kJ How much heat is released when 4.20 moles of iron are reacted with excess O_2? Heat = How much heat is released when 1.00 mole of Fe_2O_3 is produced? Heat = How much heal is released when 1.00 g iron is reacted with excess O_2? Heat= How much heat is released when l2.6 g Fe...
consider the following reaction: 2K+Cl2-> 2KCl H=-873.0 kj how much heat is released if 5 moles of potassium react?
A chemist measures the energy change Delta H during the following reaction: 2H_2I(l) rightarrow 2H_2(g) + O_2(g) Delta H = 572. kJ Use the information to answer the following questions. This reaction is ... exothermic endothermic Suppose 94.8 g of H_2O react. Will any heat be released or absorbed? Yes, absorbed Yes, released No If you said heat will be released or absorbed in the second part of this question, calculate how much heat will be released or absorbed. Round...
consider the following reaction 2H2(g)+O2(g)--> 2H2O (I) delta H= -572KJ A) how much heat is evolved when 1.00 mole of H2O (I) is produced? B) how much heat is evolved when 4.03g H2 are reacted with 40.0g of O2? C) the total volume of hydrogen gas needed to fill the Hindenburg was 2.0*10^8 L at 1.0 atm and 25 degree C. How much HEAT was evolved when the Hidenburg exploded, assuming all of the hydrogen reacted (plenty of oxygen)?
Given that Delta H degree_rxn = sigma m Delta H degree_f (products) - sigma Delta H degree_f (reactants) (A) calculate the standard heat of reaction for the combustion of hydrogen sulfide with oxygen to produce water and sulfur dioxide shown below. 2H_2S (g) + 3O_2 (g) rightarrow 2 H_2O (l) + 2 SO_2 (g) (B) Is the reaction exothermic or endothermic? Some potentially useful information: Delta H degree_f (SO_2) = -291.1 kJ/mol Delta H degree_f (H_2O) =-285.8 kJ/mol Delta H...
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
Calculate the final temperature for each of the following mixtures. Assume no heat loss to the environment. Show your method for part b. 50.0 g of water at 25.0 degree C is mixed with 50.0 g of water at 85.0 degree C. 75.0 g of water at 25.0 degree C is mixed with 25.0 g of water at 85.0 degree C. In Part B of this experiment, 0.10 g of Mg is added to 50. mL of 1.0M HCl. Which...
2NH3(g)--------N2(g)+3H2(g) delta H=160.0 kJ suppose 50.3 g of NH3 react calculate how much heat is absorbed or released. please answer fast and explain each and every concept used in above question Provide proper calculation formula used and concept used