The standard potentials at pH=0 for the couples Fe2+/Fe and Fe3+/Fe2+ are -0.44V and 0.77V, respectively....
The standard potentials at pH=0 for the couples Fe2+/Fe and Fe3+/Fe2+ are -0.44V and 0.77V, respectively. Should we expect Fe2+ to disproportionate in a deaerated acidic aqueous solution? Explain briefly.
Homework Answers
The disproportionation reaction would be Fe2+ -> Fe + Fe3+
Hence for a reaction to be feasible its E0 should be positive hence we can see the E0=-0.44-0.77=-1.21 V
The potentials are added according to the direction of the reaction like Fe2+ -> Fe is known and Fe2+ -> Fe3+ is negative of what is given.
Hence we can see as the E0 is negative the reaction cannot occur.
please give a thumbs up as it matters a lot. In case there are doubts leave a comment.
Add Answer to:
The standard potentials at pH=0 for the couples Fe2+/Fe and
Fe3+/Fe2+ are -0.44V and 0.77V, respectively....
Draw a pE-pH diagram illustrating predominant iron forms (Fe3+, Fe2+, Fe) in an aqueous system.
Draw a pE-pH diagram illustrating predominant iron forms (Fe3+, Fe2+, Fe) in an aqueous system.
The following standard reduction potentials have been determined for the aqueous chemistry of iron: Fe3 (a)e>Fe2-(aq...
The following standard reduction potentials have been determined for the aqueous chemistry of iron: Fe3 (a)e>Fe2-(aq 0.770 V Fe2 (aq) 2e>Fe(s E°-0.409 v Calculate the equilibrium constant (K) for the disproportionation of Fe2(aq) at 25 °C. Submit Answer 5 question attempts remaining
7.53 Given the following electrode potentials at 25°C, Fe3+ +e- = Fe2+ E' = 0.771 V Fe2+ + e = Fe(s) E = -0.440 V calcu...
7.53 Given the following electrode potentials at 25°C, Fe3+ +e- = Fe2+ E' = 0.771 V Fe2+ + e = Fe(s) E = -0.440 V calculate the electrode potential for [Fe3+ + e = {Fe E; = ? for
The standard half-cell potentials for three reactions are given below: Fe²+(aq) + 2e = Fe(s) Fe3+(aq)...
The standard half-cell potentials for three reactions are given below: Fe²+(aq) + 2e = Fe(s) Fe3+(aq) + 3e = Fe(s) Br2(aq) + 2e = 2Br (aq) E° = -0.44V E° = -0.04V E° = 1.09V Q 1(a) Determine what pair of half-cell reactions yields the most spontaneous redox process. Q 1(b) Calculate AGº for this process and comment on whether iron is plated during this process. Q 1(c) Draw a labelled energy level diagram showing the reactants, products and AGO....
Consider the following cell: Pt(s) | Fe3+ (aq). Fe2(aq) | CIF (aq) C12(e) Pt(s) If the...
Consider the following cell: Pt(s) | Fe3+ (aq). Fe2(aq) | CIF (aq) C12(e) Pt(s) If the standard reduction potentials of the Fe3+/Fe2+ and Cl2/Cl" couples are +0.77 and +1.36 V, respectively, calculate the value of Efor the given cell. +1.00 V O +1.77 v +0.59 V +2.13 V +0.95 V
Using the following standard reduction potentials: Fe3+ (aq) + e. → Fe2+ (aq) Eo = +0.77...
Using the following standard reduction potentials: Fe3+ (aq) + e. → Fe2+ (aq) Eo = +0.77 V Pb2+ (aq) + 2 e. → Pb(s) E。--0.13 V Calculate the standard cell potential for the galvanie cell reaction given below, and determine whether or not this reaction is spostaneous under standard conditions. Pb2+ (aq) + 2 Fe2+ (aq) → 2 Fe3+ (aq) + Pb(s) ⓔ A. E.-0.90 V, nonspontaneous OB. E-0.90 V, spontaneous C. Eo +0.90 V, nonspontaneous OD0.90 V, spontaneous
a.) Assuming the displacement of a water by a ligand were so favored that the back...
a.) Assuming the displacement of a water by a ligand were so favored that the back reaction could be ignored, calculate all the stepwise formation constants you would expect in the formation of [Ni(NH3)3(OH2)3]2+ from [Ni(NH3)2(OH2)4]2+. b.) The standard potentials for the couples Pb2+/Pb and Pb4+/ Pb2+ are +1.8 V and -0.126 V, respectively. Should we expect Pb2+ to disproportionate in aqueous solution?
Using the following standard reduction potentials Fe3+(aq) + e- → Fe2+(aq) E° = +0.77 V Pb2+(aq)...
Using the following standard reduction potentials Fe3+(aq) + e- → Fe2+(aq) E° = +0.77 V Pb2+(aq) + 2 e- → Pb(s) E° = -0.13 V calculate the standard cell potential for the galvanic cell reaction given below, and determine whether or not this reaction is spontaneous under standard conditions. Pb2+(aq) + 2 Fe2+(aq) → 2 Fe3+(aq) + Pb(s) Group of answer choices E° = -0.90 V, spontaneous E° = -0.90 V, nonspontaneous E° = +0.90 V, nonspontaneous E° = +0.90...
Relative Half-Cell Potentials Assuming standard conditions, answer the following questions. (Use the table of Standard Reduction...
Relative Half-Cell Potentials Assuming standard conditions, answer the following questions. (Use the table of Standard Reduction Potentials for common Half-reactions from your text. If hydrogen is one of the reagents, assume acidic solution.) cf Table 11.1 on p 403 of Zumdahl 8th ed. D y Is Fe2+ (aq) capable of oxidizing Cr metal? Is Ag+ (aq) capable of oxidizing H2(g)? Is Cr3+ (aq) capable of oxidizing Fe2+(aq) to Fe3+ (aq)? Is Cr3+ (aq) capable of oxidizing Fe2+(aq)? Is Fe3+(aq) capable...
Use the following standard cell potentials to answer the questions below. Fe3+(aq) + e− ⇌ Fe2+(aq)...
Use the following standard cell potentials to answer the questions below. Fe3+(aq) + e− ⇌ Fe2+(aq) E° = 0.771 V Ag3+(aq) + e− ⇌ Ag2+(aq) E° = 1.800 V 1. What is ΔG° (in kJ/mol) for this reaction? Report answer to three significant figures in scientific notation (i.e., 1.23e2 kJ/mol) 2. This reaction is (spontaneous/not spontaneous)
The following standard reduction potentials have been determined for the aqueous chemistry of iron: Fe3 (a)e>Fe2-(aq 0.770 V Fe2 (aq) 2e>Fe(s E°-0.409 v Calculate the equilibrium constant (K) for the disproportionation of Fe2(aq) at 25 °C. Submit Answer 5 question attempts remaining
7.53 Given the following electrode potentials at 25°C, Fe3+ +e- = Fe2+ E' = 0.771 V Fe2+ + e = Fe(s) E = -0.440 V calculate the electrode potential for [Fe3+ + e = {Fe E; = ? for
The standard half-cell potentials for three reactions are given below: Fe²+(aq) + 2e = Fe(s) Fe3+(aq) + 3e = Fe(s) Br2(aq) + 2e = 2Br (aq) E° = -0.44V E° = -0.04V E° = 1.09V Q 1(a) Determine what pair of half-cell reactions yields the most spontaneous redox process. Q 1(b) Calculate AGº for this process and comment on whether iron is plated during this process. Q 1(c) Draw a labelled energy level diagram showing the reactants, products and AGO....
Consider the following cell: Pt(s) | Fe3+ (aq). Fe2(aq) | CIF (aq) C12(e) Pt(s) If the standard reduction potentials of the Fe3+/Fe2+ and Cl2/Cl" couples are +0.77 and +1.36 V, respectively, calculate the value of Efor the given cell. +1.00 V O +1.77 v +0.59 V +2.13 V +0.95 V
Using the following standard reduction potentials: Fe3+ (aq) + e. → Fe2+ (aq) Eo = +0.77 V Pb2+ (aq) + 2 e. → Pb(s) E。--0.13 V Calculate the standard cell potential for the galvanie cell reaction given below, and determine whether or not this reaction is spostaneous under standard conditions. Pb2+ (aq) + 2 Fe2+ (aq) → 2 Fe3+ (aq) + Pb(s) ⓔ A. E.-0.90 V, nonspontaneous OB. E-0.90 V, spontaneous C. Eo +0.90 V, nonspontaneous OD0.90 V, spontaneous
Relative Half-Cell Potentials Assuming standard conditions, answer the following questions. (Use the table of Standard Reduction Potentials for common Half-reactions from your text. If hydrogen is one of the reagents, assume acidic solution.) cf Table 11.1 on p 403 of Zumdahl 8th ed. D y Is Fe2+ (aq) capable of oxidizing Cr metal? Is Ag+ (aq) capable of oxidizing H2(g)? Is Cr3+ (aq) capable of oxidizing Fe2+(aq) to Fe3+ (aq)? Is Cr3+ (aq) capable of oxidizing Fe2+(aq)? Is Fe3+(aq) capable...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 56 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago